Misplaced Pages

Amidantel: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 14:11, 24 December 2024 editCitation bot (talk | contribs)Bots5,409,828 edits Add: pages, issue, volume, journal, title, date, authors 1-6. | Use this bot. Report bugs. | Suggested by Innerstream | #UCB_webform← Previous edit Latest revision as of 19:25, 24 December 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,643 edits added missing data to drug box; consistent citation formattingTag: nowiki added 
Line 1: Line 1:
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug {{Infobox drug
| drug_name = | drug_name =
Line 4: Line 5:
| type = <!-- empty --> | type = <!-- empty -->
| image = Amidantel.svg | image = Amidantel.svg
⚫ | width =
| alt = | alt =
| caption = | caption =
⚫ | image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =

<!-- Clinical data --> <!-- Clinical data -->
| pronounce = | pronounce =
Line 11: Line 25:
| Drugs.com = | Drugs.com =
| MedlinePlus = | MedlinePlus =
| licence_CA =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment = | pregnancy_AU_comment =
| pregnancy_category= | pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = | routes_of_administration =
| class =
| ATCvet = | ATCvet =
| ATC_prefix = <!-- 'none' if uncategorised --> | ATC_prefix =
| ATC_suffix = | ATC_suffix =
| ATC_supplemental =

<!-- Legal status --> <!-- Legal status -->
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled -->
Line 38: Line 61:
| legal_UN_comment = | legal_UN_comment =
| legal_status = <!-- For countries not listed above --> | legal_status = <!-- For countries not listed above -->

<!-- Pharmacokinetic data --> <!-- Pharmacokinetic data -->
| bioavailability = | bioavailability =
Line 47: Line 71:
| duration_of_action= | duration_of_action=
| excretion = | excretion =

<!-- Identifiers --> <!-- Identifiers -->
| CAS_number = 49745-00-8 | CAS_number = 49745-00-8
| CAS_supplemental =
| PubChem = 39521 | PubChem = 39521
| PubChemSubstance =
⚫ | UNII = C67IS11N0O
| IUPHAR_ligand =
| DrugBank = | DrugBank =
| ChemSpiderID =
| UNII = C67IS11N0O
| KEGG =
| ChEBI =
| ChEMBL = 2105966
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =

<!-- Chemical and physical data --> <!-- Chemical and physical data -->
| IUPAC_name = ''N''-phenyl]-2-methoxyacetamide | IUPAC_name = <nowiki>N-phenyl]-2-methoxyacetamide</nowiki>
| C=13 | H=19 | N=3 | O=2
⚫ | smiles = CC(=NC1=CC=C(C=C1)NC(=O)COC)N(C)C
| molecular_weight =
⚫ | C = 13 | H = 19 | N = 3 | O = 2
⚫ | SMILES = CC(=NC1=CC=C(C=C1)NC(=O)COC)N(C)C
| Jmol =
| StdInChI = InChI=1S/C13H19N3O2/c1-10(16(2)3)14-11-5-7-12(8-6-11)15-13(17)9-18-4/h5-8H,9H2,1-4H3,(H,15,17)
| StdInChI_comment =
| StdInChIKey = MKFMTNNOZQXQBP-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}


'''Amidantel''' is a pharmaceutical drug used in veterinary medicine.<ref>{{cite journal | pmid = 295548 | date = 1979 | last1 = Thomas | first1 = H. | title = The efficacy of amidantel, a new anthelmintic, on hookworms and ascarids in dogs | journal = Tropenmedizin und Parasitologie | volume = 30 | issue = 3 | pages = 404–408 }}</ref> It is an ] active against ]s, ], and ]s.<ref>{{cite journal | pmid = 582114 | date = 1979 | last1 = Wollweber | first1 = H. | last2 = Niemers | first2 = E. | last3 = Flucke | first3 = W. | last4 = Andrews | first4 = P. | last5 = Schulz | first5 = H. P. | last6 = Thomas | first6 = H. | title = Amidantel, a potent anthelminthic from a new chemical class | journal = Arzneimittel-Forschung | volume = 29 | issue = 1 | pages = 31–32 }}</ref> '''Amidantel''' is a pharmaceutical drug used in veterinary medicine.<ref>{{cite journal | vauthors = Thomas H | title = The efficacy of amidantel, a new anthelmintic, on hookworms and ascarids in dogs | journal = Tropenmedizin Und Parasitologie | volume = 30 | issue = 3 | pages = 404–408 | date = September 1979 | pmid = 295548 }}</ref> It is an ] active against ]s, ], and ]s.<ref>{{cite journal | vauthors = Wollweber H, Niemers E, Flucke W, Andrews P, Schulz HP, Thomas H | title = Amidantel, a potent anthelminthic from a new chemical class | journal = Arzneimittel-Forschung | volume = 29 | issue = 1 | pages = 31–32 | date = 1979 | pmid = 582114 }}</ref>


==References== ==References==

Latest revision as of 19:25, 24 December 2024

Pharmaceutical compound
Amidantel
Identifiers
IUPAC name
  • N-phenyl]-2-methoxyacetamide
CAS Number
PubChem CID
UNII
ChEMBL
Chemical and physical data
FormulaC13H19N3O2
Molar mass249.314 g·mol
3D model (JSmol)
SMILES
  • CC(=NC1=CC=C(C=C1)NC(=O)COC)N(C)C
InChI
  • InChI=InChI=1S/C13H19N3O2/c1-10(16(2)3)14-11-5-7-12(8-6-11)15-13(17)9-18-4/h5-8H,9H2,1-4H3,(H,15,17)
  • Key:MKFMTNNOZQXQBP-UHFFFAOYSA-N

Amidantel is a pharmaceutical drug used in veterinary medicine. It is an anthelmintic active against nematodes, filaria, and cestodes.

References

  1. Thomas H (September 1979). "The efficacy of amidantel, a new anthelmintic, on hookworms and ascarids in dogs". Tropenmedizin Und Parasitologie. 30 (3): 404–408. PMID 295548.
  2. Wollweber H, Niemers E, Flucke W, Andrews P, Schulz HP, Thomas H (1979). "Amidantel, a potent anthelminthic from a new chemical class". Arzneimittel-Forschung. 29 (1): 31–32. PMID 582114.
Stub icon

This veterinary medicine–related article is a stub. You can help Misplaced Pages by expanding it.

Categories: