Revision as of 00:26, 5 December 2010 editTea with toast (talk | contribs)Extended confirmed users, Pending changes reviewers5,393 edits replaced "wikify" with "expand"← Previous edit | Latest revision as of 16:49, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids | ||
(24 intermediate revisions by 13 users not shown) | |||
Line 1: | Line 1: | ||
{{Unreferenced|date=February 2007}} | |||
{{expand|date=December 2010}} | |||
{{Chembox | {{Chembox | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | |||
| verifiedrevid = 424832042 | |||
| ImageFile = isodesmosine.svg | | ImageFile = isodesmosine.svg | ||
| ImageSize = | | ImageSize = | ||
| IUPACName = | | IUPACName = | ||
| OtherNames = | | OtherNames = | ||
| |
|Section1={{Chembox Identifiers | ||
| Abbreviations = | | Abbreviations = | ||
| CASNo_Ref = {{cascite|correct|??}} | |||
| CASNo = 991-01-5 | | CASNo = 991-01-5 | ||
| EINECS = | | EINECS = | ||
| PubChem = 13811 | | PubChem = 13811 | ||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| SMILES = | |||
| |
| ChemSpiderID = 13214 | ||
| SMILES = c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N | |||
| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1 | |||
| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1 | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O | |||
| RTECS = | | RTECS = | ||
| MeSHName = | | MeSHName = D007524 | ||
| ChEBI_Ref = {{ebicite|changed|EBI}} | |||
| ChEBI = | | ChEBI = 64366 | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = | | KEGG = | ||
}} | |||
| ATCCode_prefix = | |||
⚫ | |Section2={{Chembox Properties | ||
| ATCCode_suffix = | |||
| C=24 | |||
| ATC_Supplemental =}} | |||
| H=40 | |||
⚫ | | |
||
| N=5 | |||
| Formula = C<sub>24</sub>H<sub>40</sub>N<sub>5</sub>O<sub>8</sub> | |||
| O=8 | |||
| MolarMass = 526.603 g/mol | |||
| Appearance = | | Appearance = | ||
| Density = | | Density = | ||
| MeltingPt = | | MeltingPt = | ||
| |
| MeltingPt_notes = | ||
| BoilingPt = | | BoilingPt = | ||
| |
| BoilingPt_notes = | ||
| Solubility = | | Solubility = | ||
| SolubleOther = | | SolubleOther = | ||
Line 42: | Line 52: | ||
| Viscosity = | | Viscosity = | ||
| Dipole = }} | | Dipole = }} | ||
| |
|Section3={{Chembox Structure | ||
| CrystalStruct = | | CrystalStruct = | ||
| Coordination = | | Coordination = | ||
| MolShape = | | MolShape = | ||
| Dipole = }} | | Dipole = }} | ||
| |
|Section4={{Chembox Thermochemistry | ||
| DeltaHf = | | DeltaHf = | ||
| DeltaHc = | | DeltaHc = | ||
| Entropy = | | Entropy = | ||
| HeatCapacity = }} | | HeatCapacity = }} | ||
| |
|Section5={{Chembox Pharmacology | ||
| AdminRoutes = | | AdminRoutes = | ||
| Bioavail = | | Bioavail = | ||
Line 64: | Line 74: | ||
| Legal_AU = | | Legal_AU = | ||
| Legal_CA = | | Legal_CA = | ||
| |
| Pregnancy_category = | ||
| |
| Pregnancy_AU = | ||
| |
| Pregnancy_US = }} | ||
| |
|Section6={{Chembox Explosive | ||
| ShockSens = | | ShockSens = | ||
| FrictionSens = | | FrictionSens = | ||
| |
| DetonationV = | ||
| REFactor = }} | | REFactor = }} | ||
| |
|Section7={{Chembox Hazards | ||
| |
| ExternalSDS = | ||
| EUClass = | |||
| EUIndex = | |||
| MainHazards = | | MainHazards = | ||
| NFPA-H = | | NFPA-H = | ||
| NFPA-F = | | NFPA-F = | ||
| NFPA-R = | | NFPA-R = | ||
| NFPA- |
| NFPA-S = | ||
| RPhrases = | |||
| SPhrases = | |||
| RSPhrases = | |||
| FlashPt = | | FlashPt = | ||
| |
| AutoignitionPt = | ||
| ExploLimits = | | ExploLimits = | ||
| PEL = }} | | PEL = }} | ||
| |
|Section8={{Chembox Related | ||
| OtherAnions = | | OtherAnions = | ||
| OtherCations = | | OtherCations = | ||
| |
| OtherFunction = | ||
| |
| OtherFunction_label = | ||
| |
| OtherCompounds = }} | ||
}} | }} | ||
'''Isodesmosine''' is a ] derivative found in ]. | |||
'''Isodesmosine''' is a ] derivative found in ]. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by ]. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.<ref>{{cite journal | doi = 10.1016/j.matbio.2006.09.011 | pmid = 17112714 | title = Differential expression of two tropoelastin genes in zebrafish | journal = Matrix Biology | volume = 26 | issue = 2 | pages = 115–124 | year = 2007 | last1 = Miao | first1 = M. | last2 = Bruce | first2 = A.E.E. | last3 = Bhanji | first3 = T. | last4 = Davis | first4 = E.C. | last5 = Keeley | first5 = F.W. }}</ref> | |||
⚫ | ] | ||
==See also== | |||
* ] | |||
==References== | |||
⚫ | {{Biochemistry-stub}} | ||
{{reflist}} | |||
⚫ | ] | ||
] | |||
⚫ | {{Biochemistry-stub}} |
Latest revision as of 16:49, 17 September 2023
Identifiers | |
---|---|
CAS Number | |
3D model (JSmol) | |
ChEBI | |
ChemSpider | |
MeSH | D007524 |
PubChem CID | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C24H40N5O8 |
Molar mass | 526.611 g·mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Isodesmosine is a lysine derivative found in elastin. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by lysyl-oxidase. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.
See also
References
- Miao, M.; Bruce, A.E.E.; Bhanji, T.; Davis, E.C.; Keeley, F.W. (2007). "Differential expression of two tropoelastin genes in zebrafish". Matrix Biology. 26 (2): 115–124. doi:10.1016/j.matbio.2006.09.011. PMID 17112714.
This biochemistry article is a stub. You can help Misplaced Pages by expanding it. |