Isodesmosine: Difference between revisions

Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 17:19, 5 December 2010 editSMasters (talk \| contribs)Extended confirmed users, File movers, Pending changes reviewers, Rollbackers51,397 editsm general fixes, removed expand tag using AWB ← Previous edit		Latest revision as of 16:49, 17 September 2023 edit undoKoIobok (talk \| contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids
(23 intermediate revisions by 12 users not shown)
Line 1:		Line 1:
	{{Unreferenced\|date=February 2007}}

	{{Chembox		{{Chembox
			\| Verifiedfields = changed
			\| Watchedfields = changed
			\| verifiedrevid = 424832042
	\| ImageFile = isodesmosine.svg		\| ImageFile = isodesmosine.svg
	\| ImageSize =		\| ImageSize =
	\| IUPACName =		\| IUPACName =
	\| OtherNames =		\| OtherNames =
	\| Section1 = {{Chembox Identifiers		\|Section1={{Chembox Identifiers
	\| Abbreviations =		\| Abbreviations =
			\| CASNo_Ref = {{cascite\|correct\|??}}
	\| CASNo = 991-01-5		\| CASNo = 991-01-5
	\| EINECS =		\| EINECS =
	\| PubChem = 13811		\| PubChem = 13811
			\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}
	\| SMILES =
	\| ~~InChI~~ =		\| ChemSpiderID = 13214
			\| SMILES = c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N
			\| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
			\| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD
			\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
			\| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O
	\| RTECS =		\| RTECS =
	\| MeSHName =		\| MeSHName = D007524
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| ChEBI =		\| ChEBI = 64366
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG =		\| KEGG =
			}}
	\| ATCCode_prefix =
		⚫	\|Section2={{Chembox Properties
	\| ATCCode_suffix =
			\| C=24
	\| ATC_Supplemental =}}
			\| H=40
⚫	\| Section2 = {{Chembox Properties
			\| N=5
	\| Formula = C<sub>24</sub>H<sub>40</sub>N<sub>5</sub>O<sub>8</sub>
			\| O=8
	\| MolarMass = 526.603 g/mol
	\| Appearance =		\| Appearance =
	\| Density =		\| Density =
	\| MeltingPt =		\| MeltingPt =
	\| ~~Melting_notes~~ =		\| MeltingPt_notes =
	\| BoilingPt =		\| BoilingPt =
	\| ~~Boiling_notes~~ =		\| BoilingPt_notes =
	\| Solubility =		\| Solubility =
	\| SolubleOther =		\| SolubleOther =
Line 41:		Line 52:
	\| Viscosity =		\| Viscosity =
	\| Dipole = }}		\| Dipole = }}
	\| Section3 = {{Chembox Structure		\|Section3={{Chembox Structure
	\| CrystalStruct =		\| CrystalStruct =
	\| Coordination =		\| Coordination =
	\| MolShape =		\| MolShape =
	\| Dipole = }}		\| Dipole = }}
	\| Section4 = {{Chembox Thermochemistry		\|Section4={{Chembox Thermochemistry
	\| DeltaHf =		\| DeltaHf =
	\| DeltaHc =		\| DeltaHc =
	\| Entropy =		\| Entropy =
	\| HeatCapacity = }}		\| HeatCapacity = }}
	\| Section5 = {{Chembox Pharmacology		\|Section5={{Chembox Pharmacology
	\| AdminRoutes =		\| AdminRoutes =
	\| Bioavail =		\| Bioavail =
Line 63:		Line 74:
	\| Legal_AU =		\| Legal_AU =
	\| Legal_CA =		\| Legal_CA =
	\| ~~PregCat~~ =		\| Pregnancy_category =
	\| ~~PregCat_AU~~ =		\| Pregnancy_AU =
	\| ~~PregCat_US~~ = }}		\| Pregnancy_US = }}
	\| Section6 = {{Chembox Explosive		\|Section6={{Chembox Explosive
	\| ShockSens =		\| ShockSens =
	\| FrictionSens =		\| FrictionSens =
	\| ~~ExplosiveV~~ =		\| DetonationV =
	\| REFactor = }}		\| REFactor = }}
	\| Section7 = {{Chembox Hazards		\|Section7={{Chembox Hazards
	\| ~~ExternalMSDS~~ =		\| ExternalSDS =
	\| EUClass =
	\| EUIndex =
	\| MainHazards =		\| MainHazards =
	\| NFPA-H =		\| NFPA-H =
	\| NFPA-F =		\| NFPA-F =
	\| NFPA-R =		\| NFPA-R =
	\| NFPA-O =		\| NFPA-S =
	\| RPhrases =
	\| SPhrases =
	\| RSPhrases =
	\| FlashPt =		\| FlashPt =
	\| ~~Autoignition~~ =		\| AutoignitionPt =
	\| ExploLimits =		\| ExploLimits =
	\| PEL = }}		\| PEL = }}
	\| Section8 = {{Chembox Related		\|Section8={{Chembox Related
	\| OtherAnions =		\| OtherAnions =
	\| OtherCations =		\| OtherCations =
	\| ~~OtherFunctn~~ =		\| OtherFunction =
	\| ~~Function~~ =		\| OtherFunction_label =
	\| ~~OtherCpds~~ = }}		\| OtherCompounds = }}
	}}		}}
	'''Isodesmosine''' is a ] derivative found in ].

			'''Isodesmosine''' is a ] derivative found in ]. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by ]. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.<ref>{{cite journal \| doi = 10.1016/j.matbio.2006.09.011 \| pmid = 17112714 \| title = Differential expression of two tropoelastin genes in zebrafish \| journal = Matrix Biology \| volume = 26 \| issue = 2 \| pages = 115–124 \| year = 2007 \| last1 = Miao \| first1 = M. \| last2 = Bruce \| first2 = A.E.E. \| last3 = Bhanji \| first3 = T. \| last4 = Davis \| first4 = E.C. \| last5 = Keeley \| first5 = F.W. }}</ref>
⚫	]

			==See also==
			* ]

			==References==
⚫	{{Biochemistry-stub}}
			{{reflist}}

		⚫	]
	]


		⚫	{{Biochemistry-stub}}

Latest revision as of 16:49, 17 September 2023

Isodesmosine
Identifiers

CAS Number	991-01-5
3D model (JSmol)	Interactive image
ChEBI	CHEBI:64366
ChemSpider	13214
MeSH	D007524
PubChem CID	13811
InChI InChI=1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1Key: RGXCTRIQQODGIZ-UHFFFAOYSA-O InChI=1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1Key: RGXCTRIQQODGIZ-IKLDFBCSAD
SMILES c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N
Properties
Chemical formula	C₂₄H₄₀N₅O₈
Molar mass	526.611 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Chemical compound

Isodesmosine is a lysine derivative found in elastin. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by lysyl-oxidase. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.

References

Miao, M.; Bruce, A.E.E.; Bhanji, T.; Davis, E.C.; Keeley, F.W. (2007). "Differential expression of two tropoelastin genes in zebrafish". Matrix Biology. 26 (2): 115–124. doi:10.1016/j.matbio.2006.09.011. PMID 17112714.

This biochemistry article is a stub. You can help Misplaced Pages by expanding it.

Categories:

Latest revision as of 16:49, 17 September 2023

See also

References