| Revision as of 08:06, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit |
Latest revision as of 02:18, 24 December 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,383,276 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Whoop whoop pull up - 22211 |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 401019118 |
|
| Name = Nepetin |
|
| Name = Nepetin |
|
| ImageFile = Nepetin.PNG |
|
| ImageFile = Nepetin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of nepetin |
|
|
| ImageAlt = Chemical structure of nepetin |
|
| ImageAlt = Chemical structure of nepetin |
|
|
| ImageFile1 = Nepetin molecule ball.png |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| OtherNames = 6-Methoxyluteolin<br>6-methoxy 5,7,3',4'-tetrahydroxyflavone |
|
|
|
| ImageAlt1 = Ball-and-stick model of nepetin |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = 3′,4′,5,7-Tetrahydroxy-6-methoxyflavone |
|
|
| SystematicName = 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-6-methoxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = 6-Methoxyluteolin |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo = 520-11-6 |
|
| CASNo = 520-11-6 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = I3O7LF3GED |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 172350 |
|
| PubChem = 5317284 |
|
| PubChem = 5317284 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = |
|
|
| InChI = |
|
| ChemSpiderID = 4476172 |
|
|
| SMILES = COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC(=C(C=C3)O)O)O |
|
|
| InChI = 1/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
|
|
| InChIKey = FHHSEFRSDKWJKJ-UHFFFAOYAR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FHHSEFRSDKWJKJ-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>7</sub> |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>7</sub> |
|
| MolarMass = 316.26 g/mol |
|
| MolarMass = 316.26 g/mol |
|
| ExactMass = 316.058303 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Nepetin''' is an ]. It can be found in '']''<ref>. |
|
'''Nepetin''' is the 6-methoxy derivative of the pentahydroxyflavone ], an ]. It can be found in '']''.<ref>{{Cite web |url=http://cat.inist.fr/?aModele=afficheN&cpsidt=16354923 |title=Cytotoxic activity of nepetin, a flavonoid from Eupatorium ballotaefolium HBK. Militao G. C. G., Albuquerque M. R. J. R., Pessoa O. D. L., Pessoa C., Moraes M. E. A., De Moraes M. O., Costa-Lotufo L. V., Pharmazie, 2004, vol. 59, no12, pp. 965-966 |access-date=2010-04-06 |archive-date=2012-08-28 |archive-url=https://web.archive.org/web/20120828034645/http://cat.inist.fr/?aModele=afficheN&cpsidt=16354923 |url-status=dead }}</ref> |
|
|
|
|
|
==Glycosides== |
|
== Glycosides == |
|
] is the 7-glucoside of nepetin. |
|
] is the 7-glucoside of nepetin. |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavone}} |
|
{{flavone}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{polyphenol-stub}} |
|
{{aromatic-stub}} |
N verify (what is ?)
Infobox references
