Revision as of 06:15, 28 March 2011 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Cyclohexanes using HotCat← Previous edit | Latest revision as of 01:47, 29 December 2024 edit undoD6dmso (talk | contribs)35 edits →Medical uses | ||
(28 intermediate revisions by 17 users not shown) | |||
Line 1: | Line 1: | ||
{{short description|Chemical compound}} | |||
{{Drugbox | |||
{{cs1 config|name-list-style=vanc|display-authors=6}} | |||
| IUPAC_name = 2-(diethylamino)-1-methylethyl (1''S'')-1-hydroxy-1,1'-bi(cyclohexyl)-2-carboxylate | |||
{{Infobox drug | |||
|synonyms = <small>(1''S'')-1-(diethylamino)propan-2-yl 1-hydroxybi(cyclohexane)-2-carboxylate</small> | |||
| |
| drug_name = | ||
| |
| INN = | ||
| |
| type = <!-- empty --> | ||
| |
| image = Rociverine.svg | ||
| |
| width = | ||
| |
| alt = | ||
| caption = | |||
| C=20|H=37|N=1|O=3 | |||
| image2 = | |||
| molecular_weight = 339.51 g/mol | |||
| width2 = | |||
| alt2 = | |||
| caption2 = | |||
| imageL = | |||
| widthL = | |||
| altL = | |||
| imageR = | |||
| widthR = | |||
| altR = | |||
| captionLR = | |||
<!-- Clinical data --> | |||
| pronounce = | |||
| tradename = | |||
| Drugs.com = | |||
| MedlinePlus = | |||
| licence_CA = | |||
| licence_EU = | |||
| DailyMedID = | |||
| licence_US = | |||
| pregnancy_AU = | |||
| pregnancy_AU_comment = | |||
| pregnancy_category= | |||
| dependency_liability = | |||
| addiction_liability = | |||
| routes_of_administration = | |||
| class = | |||
| ATCvet = | |||
| ATC_prefix = A03 | |||
| ATC_suffix = AA06 | |||
| ATC_supplemental = | |||
<!-- Legal status --> | |||
| legal_AU = | |||
| legal_AU_comment = | |||
| legal_BR = | |||
| legal_BR_comment = | |||
| legal_CA = | |||
| legal_CA_comment = | |||
| legal_DE = | |||
| legal_DE_comment = | |||
| legal_NZ = | |||
| legal_NZ_comment = | |||
| legal_UK = | |||
| legal_UK_comment = | |||
| legal_US = | |||
| legal_US_comment = | |||
| legal_EU = | |||
| legal_EU_comment = | |||
| legal_UN = | |||
| legal_UN_comment = | |||
| legal_status = | |||
<!-- Pharmacokinetic data --> | |||
| bioavailability = | | bioavailability = | ||
| protein_bound = | | protein_bound = | ||
| metabolism = | | metabolism = | ||
| metabolites = | |||
| onset = | |||
| elimination_half-life = | | elimination_half-life = | ||
| duration_of_action= | |||
| excretion = | | excretion = | ||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
<!-- Identifiers --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| CAS_number = 53716-44-2 | |||
| pregnancy_category= | |||
| CAS_supplemental = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| |
| PubChem = 24892842 | ||
| PubChemSubstance = | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| IUPHAR_ligand = | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| |
| DrugBank = DB13581 | ||
| ChemSpiderID = 28534065 | |||
| routes_of_administration = | |||
| UNII = VI08KS44V0 | |||
| KEGG = D07078 | |||
| ChEBI = 135440 | |||
| ChEMBL = 4755537 | |||
| NIAID_ChemDB = | |||
| PDB_ligand = | |||
| synonyms = | |||
<!-- Chemical and physical data --> | |||
| IUPAC_name = <nowiki>1-(diethylamino)propan-2-yl (1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate</nowiki> | |||
| C=20 | H=37 | N=1 | O=3 | |||
| molecular_weight = | |||
| SMILES = CCN(CC)CC(C)OC(=O)1CCCC1(C2CCCCC2)O | |||
| Jmol = | |||
| StdInChI = InChI=1S/C20H37NO3/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17/h16-18,23H,4-15H2,1-3H3/t16?,18-,20+/m1/s1 | |||
| StdInChI_comment = | |||
| StdInChIKey = XPYLKZZOBVLVHB-QDKIRNHSSA-N | |||
| density = | |||
| density_notes = | |||
| melting_point = | |||
| melting_high = | |||
| melting_notes = | |||
| boiling_point = | |||
| boiling_notes = | |||
| solubility = | |||
| sol_units = | |||
| specific_rotation = | |||
}} | }} | ||
{{Unreferenced|date=February 2009}} | |||
'''Rociverine''' is an ]. | |||
'''Rociverine''' is an ] drug used to treat urinary, gastrointestinal and biliary spasms.<ref>{{Cite web |title=Rociverine |url=https://go.drugbank.com/drugs/DB13581}}</ref> It is ] drug.<ref name="pmid582702">{{cite journal | vauthors = Toson G, Schiantarelli P, Murmann W | title = Rociverine, a new antispasmodic agent with balanced neurotropic and myotropic activity | journal = Arzneimittel-Forschung | volume = 28 | issue = 7 | pages = 1130–42 | date = 1978 | pmid = 582702 | doi = | url = }}</ref> | |||
{{Drugs for functional gastrointestinal disorders}} | |||
== Medical uses == | |||
In India, rociverine is used as part of the "Programmed Labour Protocol" to help reduce pain and shorten the duration of labor. However, an analysis of clinical trials provides little evidence supporting its effectiveness in reducing labor duration.<ref name="pmid23737030">{{cite journal | vauthors = Rohwer AC, Khondowe O, Young T | title = Antispasmodics for labour | journal = The Cochrane Database of Systematic Reviews | volume = 2013 | issue = 6 | pages = CD009243 | date = June 2013 | pmid = 23737030 | pmc = 6823273 | doi = 10.1002/14651858.CD009243.pub3 }}</ref> | |||
== Pharmacology == | |||
The (1R,2R) stereoisomer showed 240-fold greater affinity for the muscarinic receptor, but the (1S,2S) compound showed the best selectivity. <ref>{{cite journal | vauthors = Barbier P, Renzetti AR, Turbanti L, Di Bugno C, Fornai F, Vaglini F, Maggio R, Corsini GU | title = Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine | journal = European Journal of Pharmacology | volume = 290 | issue = 2 | pages = 125–132 | date = July 1995 | pmid = 8575526 | doi = 10.1016/0922-4106(95)90024-1 }}</ref> | |||
==References== | |||
{{Reflist}} | |||
{{Drugs for functional gastrointestinal disorders}} | |||
{{Muscarinic acetylcholine receptor modulators}} | |||
] | |||
] | ] | ||
] | ] | ||
] | ] | ||
] | |||
] | ] | ||
{{gastrointestinal-drug-stub}} | {{gastrointestinal-drug-stub}} | ||
] |
Latest revision as of 01:47, 29 December 2024
Chemical compoundPharmaceutical compound
Clinical data | |
---|---|
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.053.356 |
Chemical and physical data | |
Formula | C20H37NO3 |
Molar mass | 339.520 g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
|
Rociverine is an antispasmodic drug used to treat urinary, gastrointestinal and biliary spasms. It is antimuscarinic drug.
Medical uses
In India, rociverine is used as part of the "Programmed Labour Protocol" to help reduce pain and shorten the duration of labor. However, an analysis of clinical trials provides little evidence supporting its effectiveness in reducing labor duration.
Pharmacology
The (1R,2R) stereoisomer showed 240-fold greater affinity for the muscarinic receptor, but the (1S,2S) compound showed the best selectivity.
References
- "Rociverine".
- Toson G, Schiantarelli P, Murmann W (1978). "Rociverine, a new antispasmodic agent with balanced neurotropic and myotropic activity". Arzneimittel-Forschung. 28 (7): 1130–42. PMID 582702.
- Rohwer AC, Khondowe O, Young T (June 2013). "Antispasmodics for labour". The Cochrane Database of Systematic Reviews. 2013 (6): CD009243. doi:10.1002/14651858.CD009243.pub3. PMC 6823273. PMID 23737030.
- Barbier P, Renzetti AR, Turbanti L, Di Bugno C, Fornai F, Vaglini F, et al. (July 1995). "Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine". European Journal of Pharmacology. 290 (2): 125–132. doi:10.1016/0922-4106(95)90024-1. PMID 8575526.
Drugs for functional gastrointestinal disorders (A03) | |||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Drugs for functional bowel disorders |
| ||||||||||||
Belladonna and derivatives (antimuscarinics) |
| ||||||||||||
Propulsives |
This drug article relating to the gastrointestinal system is a stub. You can help Misplaced Pages by expanding it. |