Revision as of 02:13, 12 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,588 editsmNo edit summary← Previous edit | Latest revision as of 18:38, 8 September 2024 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,410 edits →top: | Altered template type. Add: bibcode, pages, issue, volume, journal, date, title, doi, authors 1-4. Changed bare reference to CS1/2. | Use this tool. Report bugs. | #UCB_Gadget | ||
(18 intermediate revisions by 15 users not shown) | |||
Line 1: | Line 1: | ||
{{distinguish|retusin (isoflavone)}} | {{distinguish|retusin (isoflavone)}} | ||
{{chembox | {{chembox | ||
| Verifiedfields = changed | |||
⚫ | | verifiedrevid = |
||
| Watchedfields = changed | |||
⚫ | | verifiedrevid = 449638802 | ||
| Name = Retusin | | Name = Retusin | ||
| ImageFile = Retusin.svg | | ImageFile = Retusin.svg | ||
| ImageSize = 250px | | ImageSize = 250px | ||
| ImageName = Chemical structure of | | ImageName = Chemical structure of | ||
| IUPACName = |
| IUPACName = 5-Hydroxy-3,3′,4′,7-tetramethoxyflavone | ||
| SystematicName = 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4''H''-1-benzopyran-4-one | |||
| OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine | | OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine | ||
|Section1= |
|Section1={{Chembox Identifiers | ||
| CASNo_Ref = {{cascite|correct|??}} | |||
| CASNo = 1245-15-4 | | CASNo = 1245-15-4 | ||
| |
| CASNoOther = | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| CASOther = | |||
| UNII = M8591903SD | |||
| PubChem = 5352005 | | PubChem = 5352005 | ||
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC | | SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC | ||
| |
| EINECS = 214-991-4 | ||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | |||
| MeSHName = | |||
| ChemSpiderID = 4508983 | |||
| InChI = 1/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 | |||
| InChIKey = HHGPYJLEJGNWJA-UHFFFAOYAJ | |||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChI = 1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 | |||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | |||
| StdInChIKey = HHGPYJLEJGNWJA-UHFFFAOYSA-N | |||
| ChEBI = 144861 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 77966 | |||
}} | }} | ||
|Section2= |
|Section2={{Chembox Properties | ||
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> | | Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> | ||
| MolarMass = 358.34 g/mol | | MolarMass = 358.34 g/mol | ||
| ExactMass = 358.105253 u | |||
| Appearance = | | Appearance = | ||
| Density = | | Density = | ||
| MeltingPt = |
| MeltingPt = | ||
| BoilingPt = |
| BoilingPt = | ||
| Solubility = | | Solubility = | ||
}} | }} | ||
}} | }} | ||
'''Retusin''' is |
'''Retusin''' is an ], a type of flavonoid. It can be found in '']''<ref>{{cite journal | url=http://www.sciencedirect.com/science/article/pii/S030519780800063X | doi=10.1016/j.bse.2008.05.003 | title=Exudate flavones and flavanones in Origanum species and their interspecific variation | date=2008 | last1=Skoula | first1=Melpomene | last2=Grayer | first2=Renée J. | last3=Kite | first3=Geoffrey C. | last4=Veitch | first4=Nigel C. | journal=Biochemical Systematics and Ecology | volume=36 | issue=8 | pages=646–654 | bibcode=2008BioSE..36..646S }}</ref> and in '']''.<ref></ref> | ||
==References== | == References == | ||
{{reflist}} | {{reflist}} | ||
Line 38: | Line 52: | ||
{{flavonol}} | {{flavonol}} | ||
] | ] | ||
] | |||
{{ |
{{aromatic-stub}} |
Latest revision as of 18:38, 8 September 2024
Not to be confused with retusin (isoflavone).Names | |
---|---|
IUPAC name 5-Hydroxy-3,3′,4′,7-tetramethoxyflavone | |
Systematic IUPAC name 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one | |
Other names
Quercetin tetramethylether Quercetin-3,7,3',4'-tetramethyl ether Tetramethylquercetin Retusine | |
Identifiers | |
CAS Number | |
3D model (JSmol) | |
ChEBI | |
ChEMBL | |
ChemSpider | |
ECHA InfoCard | 100.013.629 |
EC Number |
|
PubChem CID | |
UNII | |
CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
Properties | |
Chemical formula | C19H18O7 |
Molar mass | 358.34 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Retusin is an O-methylated flavonol, a type of flavonoid. It can be found in Origanum vulgare and in Ariocarpus retusus.
References
- Skoula, Melpomene; Grayer, Renée J.; Kite, Geoffrey C.; Veitch, Nigel C. (2008). "Exudate flavones and flavanones in Origanum species and their interspecific variation". Biochemical Systematics and Ecology. 36 (8): 646–654. Bibcode:2008BioSE..36..646S. doi:10.1016/j.bse.2008.05.003.
- Retusin (Ariocarpus) on kanaya.naist.jp
This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it. |