Revision as of 08:17, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 06:10, 3 April 2022 edit undoGraeme Bartlett (talk | contribs)Administrators249,716 edits chemspider |
(30 intermediate revisions by 23 users not shown) |
Line 1: |
Line 1: |
|
|
{{lowercasetitle}} |
|
{{DISPLAYTITLE:''gamma''-Tocopherol}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443832494 |
|
| verifiedrevid = 443833493 |
|
|Name=γ-Tocopherol |
|
| Name=γ-Tocopherol |
|
|Reference=<ref> at ]</ref> |
|
| Reference=<ref> at ]</ref> |
|
|ImageFile=gamma-tocopherol.png |
|
| ImageFile=gamma-tocopherol.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName=(2''R'')-2,7,8-Trimethyl-2--6-chromanol |
|
| PIN=(2''R'')-2,7,8-Trimethyl-2--3,4-dihydro-2''H''-1-benzopyran-6-ol |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=54-28-4 |
|
| CASNo=54-28-4 |
⚫ |
| PubChem=92729 |
|
|
|
| Beilstein = 93072 |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 18185 |
|
|
| ChemSpiderID = 83708 |
|
|
| DrugBank = DB15394 |
|
|
| EC_number = 200-201-5 |
|
|
| KEGG = C02483 |
|
⚫ |
| PubChem=92729 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 8EF1Z1238F |
|
| UNII = 8EF1Z1238F |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI =1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QUEDXNHFTDJVIY-DQCZWYHMSA-N |
|
| SMILES=C(CCC(C)CCCC(C)C)CCC2(C)OC1=C(C)C(C)=C(O)C=C1CC2 |
|
| SMILES=C(CCC(C)CCCC(C)C)CCC2(C)OC1=C(C)C(C)=C(O)C=C1CC2 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>28</sub>H<sub>48</sub>O<sub>2</sub> |
|
| Formula=C<sub>28</sub>H<sub>48</sub>O<sub>2</sub> |
|
| MolarMass=416.68 g/mol |
|
| MolarMass=416.68 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''γ-Tocopherol''' is one of the chemical ]s that is considered ]. As a food additive, it has ] E308. |
|
'''γ-Tocopherol''' (''gamma''-tocopherol) is a ] and one of the ]s that comprise ]. As a ], it has ] E308. |
|
|
|
|
See the main article ] for more information. |
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{DEFAULTSORT:Tocopherol, gamma-}} |
|
{{DEFAULTSORT:Tocopherol, gamma-}} |
Line 49: |
Line 59: |
|
{{Vitamin}} |
|
{{Vitamin}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|