Revision as of 12:44, 9 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEBI').← Previous edit |
Latest revision as of 16:14, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,111 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
(18 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{more citations needed|date=January 2021}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 415659048 |
|
| verifiedrevid = 443864211 |
|
| IUPAC_name = 7-Hydroxy-4-methylchromen-2-one |
|
| IUPAC_name = 7-Hydroxy-4-methylchromen-2-one |
|
| image = Hymecromone.png |
|
| image = Hymecromone.png |
⚫ |
| synonyms = 4-Methylumbelliferone |
|
|
|
<!--Clinical data--> |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|hymecromone}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 90-33-5 |
|
⚫ |
| ATC_prefix = A05 |
|
⚫ |
| ATC_suffix = AX02 |
|
⚫ |
| PubChem = 5280567 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB07118 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4444190 |
|
| ChemSpiderID = 4444190 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 3T5NG4Q468 |
|
| UNII = 3T5NG4Q468 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| InChI = 1/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
|
|
⚫ |
| KEGG = D00170 |
⚫ |
| smiles = O=C/2Oc1cc(O)ccc1\C(=C\2)C |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| InChIKey = HSHNITRMYYLLCV-UHFFFAOYAZ |
|
|
⚫ |
| ChEBI = 17224 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 12208 |
|
| ChEMBL = 12208 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=10 | H=8 | O=3 |
|
⚫ |
| smiles = CC1=CC(=O)OC2=C1C=CC(=C2)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
|
| StdInChI = 1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HSHNITRMYYLLCV-UHFFFAOYSA-N |
|
| StdInChIKey = HSHNITRMYYLLCV-UHFFFAOYSA-N |
|
⚫ |
| synonyms = 4-Methylumbelliferone |
⚫ |
| CAS_number = 90-33-5 |
|
⚫ |
| ATC_prefix = A05 |
|
⚫ |
| ATC_suffix = AX02 |
|
⚫ |
| ChEBI = 17224 |
|
⚫ |
| PubChem = 5280567 |
|
⚫ |
| DrugBank = DB07118 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D00170 |
|
⚫ |
| C=10|H=8|O=3 |
|
|
| molecular_weight = 176.17 g/mol |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Hymecromone''' (4-methylumbelliferone) is a drug used in ] therapy. It is used as ] and ] drugs and as a standard for the fluorometric determination of enzyme activity. |
|
'''Hymecromone''' (4-methylumbelliferone) is a drug used in ] therapy. It is used as ] and ] drugs and as a standard for the fluorometric determination of enzyme activity.<ref name="pmid7390976">{{cite journal | vauthors = Yang Y, Hamaguchi K | title = Hydrolysis of 4-methylumbelliferyl N-acetyl-chitotrioside catalyzed by hen and turkey lysozymes. pH dependence of the kinetics constants | journal = Journal of Biochemistry | volume = 87 | issue = 4 | pages = 1003–14 | date = April 1980 | pmid = 7390976 | doi = 10.1093/oxfordjournals.jbchem.a132833 }}</ref> |
|
|
|
|
|
Hymecromone is crystalline solid with a melting point of 194-195 °C. It is soluble in ] and ]. |
|
Hymecromone is a crystalline solid with a melting point of 194–195 °C. It is soluble in ] and ]. |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Bile and liver therapy}} |
|
{{Bile and liver therapy}} |
Line 52: |
Line 67: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
⚫ |
{{gastrointestinal-drug-stub}} |
|
|
|
|
|
|
⚫ |
{{gastrointestinal-drug-stub}} |
|
] |
|
|
] |
|
Hymecromone is a crystalline solid with a melting point of 194–195 °C. It is soluble in methanol and glacial acetic acid.