Revision as of 11:57, 3 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 16:14, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
(16 intermediate revisions by 14 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{more citations needed|date=January 2021}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443864211 |
|
| verifiedrevid = 443864211 |
|
| IUPAC_name = 7-Hydroxy-4-methylchromen-2-one |
|
| IUPAC_name = 7-Hydroxy-4-methylchromen-2-one |
|
| image = Hymecromone.png |
|
| image = Hymecromone.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
Line 16: |
Line 18: |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
Line 23: |
Line 24: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 90-33-5 |
|
| CAS_number = 90-33-5 |
|
| ATC_prefix = A05 |
|
| ATC_prefix = A05 |
Line 42: |
Line 42: |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 12208 |
|
| ChEMBL = 12208 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=8 | O=3 |
|
| C=10 | H=8 | O=3 |
|
⚫ |
| smiles = CC1=CC(=O)OC2=C1C=CC(=C2)O |
|
| molecular_weight = 176.17 g/mol |
|
⚫ |
| smiles = O=C/2Oc1cc(O)ccc1\C(=C\2)C |
|
|
| InChI = 1/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
|
|
| InChIKey = HSHNITRMYYLLCV-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
|
| StdInChI = 1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
Line 56: |
Line 52: |
|
}} |
|
}} |
|
|
|
|
|
'''Hymecromone''' (4-methylumbelliferone) is a drug used in ] therapy. It is used as ] and ] drugs and as a standard for the fluorometric determination of enzyme activity. |
|
'''Hymecromone''' (4-methylumbelliferone) is a drug used in ] therapy. It is used as ] and ] drugs and as a standard for the fluorometric determination of enzyme activity.<ref name="pmid7390976">{{cite journal | vauthors = Yang Y, Hamaguchi K | title = Hydrolysis of 4-methylumbelliferyl N-acetyl-chitotrioside catalyzed by hen and turkey lysozymes. pH dependence of the kinetics constants | journal = Journal of Biochemistry | volume = 87 | issue = 4 | pages = 1003–14 | date = April 1980 | pmid = 7390976 | doi = 10.1093/oxfordjournals.jbchem.a132833 }}</ref> |
|
|
|
|
|
Hymecromone is crystalline solid with a melting point of 194-195 °C. It is soluble in ] and ]. |
|
Hymecromone is a crystalline solid with a melting point of 194–195 °C. It is soluble in ] and ]. |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Bile and liver therapy}} |
|
{{Bile and liver therapy}} |
Line 64: |
Line 67: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
⚫ |
{{gastrointestinal-drug-stub}} |
|
|
|
|
|
|
⚫ |
{{gastrointestinal-drug-stub}} |
|
] |
|
|
] |
|
Hymecromone is a crystalline solid with a melting point of 194–195 °C. It is soluble in methanol and glacial acetic acid.