Misplaced Pages

2,2-Dimethoxy-2-phenylacetophenone: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 13:20, 25 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user t...← Previous edit Latest revision as of 14:26, 8 September 2022 edit undoMigfab008 (talk | contribs)Extended confirmed users19,936 editsNo edit summary 
(24 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Use dmy dates|date=September 2022}}
{{Chembox {{Chembox
| Verifiedfields = changed | Watchedfields = changed
| verifiedrevid = 457311897 | verifiedrevid = 477209762
| ImageFile = DMPA.png | ImageFile = DMPA.png
| ImageSize = 200px | ImageSize = 200px
| ImageAlt = | ImageAlt =
| IUPACName = 2,2-Dimethoxy-2-phenylacetophenone | PIN = 2,2-Dimethoxy-1,2-diphenylethan-1-one
⚫ | OtherNames = 2,2-Dimethoxy-2-phenylacetophenone<br />α,α-Dimethoxy-α-phenylacetophenone<br />Benzil α,α-dimethyl acetal
| PIN =
⚫ |Section1={{Chembox Identifiers
⚫ | OtherNames = α,α-Dimethoxy-α-phenylacetophenone, Benzil α,α-dimethyl acetal
⚫ | Abbreviations = DMPA
⚫ | Section1 = {{Chembox Identifiers
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | Abbreviations = DMPA
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 81777 | ChemSpiderID = 81777
| InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 | InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3
| InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK | InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 364734 | ChEMBL = 364734
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 | StdInChI = 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KWVGIHKZDCUPEU-UHFFFAOYSA-N | StdInChIKey = KWVGIHKZDCUPEU-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 24650-42-8 | CASNo = 24650-42-8
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | PubChem = 90571
| UNII = 1DK0094V28
⚫ | SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2
⚫ | PubChem = 90571
⚫ | SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C = 16 | O = 3 | H = 16 | C=16 | O=3 | H=16
| MolarMass = | MolarMass =
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}
⚫ '''2,2-Dimethoxy-2-phenylacetophenone''' is a ], which is used to initialize radical ] e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo |vauthors=Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65 | doi=10.1016/j.bios.2008.01.012|pmid=18304798}}</ref> Under the influence of light the molecule will form radicals which initiate the radical polymerization. It can also be used as an initiator in the process of making an ].

⚫ '''2,2-Dimethoxy-2-phenylacetophenone''' is a photoinitiator, which is used to initialise radical polymerisation e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo | author = Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65}}</ref>


== References == == References ==
{{reflist}} {{reflist}}


{{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2,2-}} {{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2, 2-}}
] ]
] ]


{{ketone-stub}} {{ketone-stub}}

Latest revision as of 14:26, 8 September 2022

Chemical compound

2,2-Dimethoxy-2-phenylacetophenone
Names
Preferred IUPAC name 2,2-Dimethoxy-1,2-diphenylethan-1-one
Other names 2,2-Dimethoxy-2-phenylacetophenone
α,α-Dimethoxy-α-phenylacetophenone
Benzil α,α-dimethyl acetal
Identifiers
CAS Number
3D model (JSmol)
Abbreviations DMPA
ChEMBL
ChemSpider
ECHA InfoCard 100.042.154 Edit this at Wikidata
PubChem CID
UNII
CompTox Dashboard (EPA)
InChI
  • InChI=1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3Key: KWVGIHKZDCUPEU-UHFFFAOYSA-N
  • InChI=1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3Key: KWVGIHKZDCUPEU-UHFFFAOYAK
SMILES
  • O=C(c1ccccc1)C(OC)(OC)c2ccccc2
Properties
Chemical formula C16H16O3
Molar mass 256.301 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound

2,2-Dimethoxy-2-phenylacetophenone is a photoinitiator, which is used to initialize radical polymerization e.g. in the preparation of acrylate polymers. Under the influence of light the molecule will form radicals which initiate the radical polymerization. It can also be used as an initiator in the process of making an integrated circuit.

References

  1. Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE (2008). "Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo". Biosens Bioelectron. 23 (10): 1458–65. doi:10.1016/j.bios.2008.01.012. PMID 18304798.


Stub icon

This article about a ketone is a stub. You can help Misplaced Pages by expanding it.

Categories: