Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 11:29, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477076563 of page Ethanol for the Chem/Drugbox validation project (updated: '').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{drugbox
| verifiedrevid = 477001424
| Watchedfields = changed
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| verifiedrevid = 407816911
| image = L-Ascorbic_acid.svg
| ImageFileL1 = Ethanol-2D-flat.png
| width = 200px
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageSizeL1 = 131
| width2 = 200px
| ImageNameL1 = Full structural formula of ethanol

| ImageFileR1 = Ethanol-2D-skeletal.svg
<!--Clinical data-->
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| ImageSizeR1 = 111
| licence_EU = <!-- EMEA requires brand name -->
| ImageNameR1 = Skeletal formula of ethanol
| licence_US = <!-- FDA may use generic name -->
| ImageFileL2 = Ethanol-3D-balls.png
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ImageFileL2_Ref = {{chemboximage|correct|??}}
| pregnancy_US = <!-- A / B / C / D / X -->
| ImageSizeL2 = 131
| pregnancy_category = A
| ImageNameL2 = Ball-and-stick model of ethanol
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| ImageFileR2 = Ethanol-3D-vdW.png
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| ImageFileR2_Ref = {{chemboximage|correct|??}}
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| ImageSizeR2 = 111
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| ImageNameR2 = Space-filling model of ethanol
| legal_status = general public availability
| SystematicName = Ethanol<ref name="Pubchem">{{cite web|title = Ethanol – Compound Summary|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=702|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref>
| routes_of_administration = oral
| OtherNames = Absolute alcohol<br />

Alcohol <br />
<!--Pharmacokinetic data-->
Drinking alcohol<br />
| bioavailability = rapid & complete
Ethyl alcohol<br />
| protein_bound = negligible
Ethyl hydrate<br />
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
Ethyl hydroxide<br />
| excretion = renal
Ethylic alcohol<br />

Ethylol<br />
<!--Identifiers-->
Grain alcohol<br />
| CASNo_Ref = {{cascite|correct|CAS}}
Hydroxyethane<br />
| CAS_number_Ref = {{cascite|correct|??}}
Methylcarbinol
| CAS_number = 50-81-7
| Section1 = {{Chembox Identifiers
| CASNo = 64-17-5 | ATC_prefix = A
| ATC_suffix = 11G
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| PubChem = 702
| ChEBI = 29073
| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
| ChemSpiderID = 682 | PubChem = 5785
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| UNII = 3K9958V90M | DrugBank = DB00126
| UNII_Ref = {{fdacite|correct|FDA}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10189562
| EINECS = 200-578-6
| UNNumber = 1170 | NIAID_ChemDB = 002072
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | UNII_Ref = {{fdacite|correct|FDA}}
| DrugBank = DB00898 | UNII = PQ6CK8PD0R
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00068
| KEGG = D00018
| KEGG_Ref = {{keggcite|correct|kegg}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| MeSHName = Ethanol
| ChEMBL = 196
| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 16236
<!--Chemical data-->
| ChEMBL = 545
| chemical_formula =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| RTECS = KQ6300000 | C=6 | H=7 | O=6
| molecular_weight = 176.12 g/]
| ATCCode_prefix = D01
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| ATCCode_suffix = AE06
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| ATC_Supplemental = {{ATC|D08|AX08}}, {{ATC|V03|AB16}}, {{ATC|V03|AZ01}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| Beilstein = 1718733
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| Gmelin = 787
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| 3DMet = B01253
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| SMILES = CCO
| synonyms = <small>L</small>-ascorbic acid
| StdInChI = 1S/C2H6O/c1-2-3/h3H,2H2,1H3
| density = 1.694
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| melting_point = 190
| InChI = 1/C2H6O/c1-2-3/h3H,2H2,1H3
| boiling_point = 553
| StdInChIKey = LFQSCWFLJHTTHZ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = LFQSCWFLJHTTHZ-UHFFFAOYAB}}
| Section2 = {{Chembox Properties
| C = 2
| H = 6
| O = 1
| ExactMass = 46.041864814 g mol<sup>−1</sup>
| Appearance = Colorless liquid
| Density = 0.789 g/cm<sup>3</sup>
| MeltingPtC = −114
| BoilingPtC = 78
| LogP = -0.18
| VaporPressure = 5.95 kPa (at 20 °C)
| pKa = 15.9<ref>Ballinger, P., Long, F.A., ''J. Am. Chem. Soc.'', '''1960''', ''82'', 795.</ref>
| pKb = -1.9
| RefractIndex = 1.36
| Viscosity = 0.0012 Pa s (at 20 °C)
| Dipole = 1.69 D
}}
| Section3 = {{Chembox Pharmacology
| AdminRoutes = Intramuscular<br />
Intravenous<br />
Oral<br />
Topical
| Metabolism = Hepatic
| ] - Low-Moderate
}}
| Section4 = {{Chembox Hazards
| EUIndex = 603-002-00-5
| EUClass = {{Hazchem F}}
| RPhrases = {{R11}}
| SPhrases = {{S2}}, {{S7}}, {{S16}}
| NFPA-H = 2
| NFPA-F = 3
| NFPA-R = 0
| FlashPt = 13–14 °C
| Autoignition = 362 °C
| LD50 = 5628 mg kg<sup>−1</sup> (oral, rat)
}}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration		oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)