Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 16:22, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476917548 of page 1,3-Dichloropropene for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{drugbox
| verifiedrevid = 477001424
| Verifiedfields = changed
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| verifiedrevid = 456494933
| ImageFileL1 = Trans-1,3-Dichloropropene.svg | image = L-Ascorbic_acid.svg
| ImageSizeL1 = 130px | width = 200px
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageNameL1 = Skeletal formula of the trans isomer
| width2 = 200px
| ImageFileR1 = Cis-1,3-Dichloropropene.svg

| ImageSizeR1 = 120px
<!--Clinical data-->
| ImageNameR1 = Skeletal formula of the cis isomer
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| ImageFileL2 = Trans-1,3-Dichloropropene-3D-balls.png
| licence_EU = <!-- EMEA requires brand name -->
| ImageSizeL2 = 120px
| licence_US = <!-- FDA may use generic name -->
| ImageNameL2 = Ball-and-stick model of the trans isomer
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ImageFileR2 = Cis-1,3-Dichloropropene-3D-balls.png
| pregnancy_US = <!-- A / B / C / D / X -->
| ImageSizeR2 = 120px
| pregnancy_category = A
| ImageNameR2 = Ball-and-stick model of the cis isomer
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| IUPACName = 1,3-dichloroprop-1-ene
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| SystematicName = 1-Propene, 1,3-dichloro-, (1E)-
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| OtherNames = 1,3-D, Dorlone, Nematox, Telone, Nemex, cis-Dichloropropene, Di-Trapex CP, Vorlex 201, dichloro-1,3-propene, 1,3-dichloro-1-propene, 1,3-dichloro-2-propene, alpha-chloroallylchloride, chloroallylchloride, gamma-chloroallylchloride, chloroallyl chloride, chloroorpropenyl chloride, 3-dichloropropylene, 3-D, DCP
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| Section1 = {{Chembox Identifiers
| legal_status = general public availability
| Abbreviations =
| routes_of_administration = oral
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 23117
<!--Pharmacokinetic data-->
| InChIKey = UOORRWUZONOOLO-OWOJBTEDBJ
| bioavailability = rapid & complete
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| protein_bound = negligible
| StdInChI = 1S/C3H4Cl2/c4-2-1-3-5/h1-2H,3H2/b2-1+
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| excretion = renal
| StdInChIKey = UOORRWUZONOOLO-OWOJBTEDSA-N

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CASNo = 542-75-6
| EINECS = 208-826-5 | CAS_number = 50-81-7
| EINECSCASNO = | ATC_prefix = A
| ATC_suffix = 11G
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 155926
| PubChem = 24726 | ChEBI = 29073
| PubChem = 5785
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00126
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10189562
| NIAID_ChemDB = 002072
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9H780918D0 | UNII = PQ6CK8PD0R
| SMILES = Cl=CCCl
| InChI = 1/C3H4Cl2/c4-2-1-3-5/h1-2H,3H2/b2-1+
| RTECS = UC8310000
| MeSHName = 1,3-dichloro-1-propene
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 18624
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C18627 | KEGG = D00018
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ATCCode_prefix =
| ChEMBL = 196
| ATCCode_suffix =

| ATC_Supplemental =}}
<!--Chemical data-->
| Section2 = {{Chembox Properties
| chemical_formula =
| Formula = C<sub>3</sub>H<sub>4</sub>Cl<sub>2</sub>
| C=6 | H=7 | O=6
| MolarMass = 110.97 g/mol
| molecular_weight = 176.12 g/]
| Appearance = Colorless to straw-colored liquid, sweet chloroform-like odor
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| Density = 1.217 g/mL (cis); 1.224 g/mL (trans)
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| MeltingPt = -84.5 °C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| Melting_notes =
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| BoilingPt = 104 °C (cis); 112 °C (trans)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Boiling_notes =
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| Solubility = 2.18 g/L (cis) @ 25 °C; 2.32 g/L (trans) @ 25 °C
| synonyms = <small>L</small>-ascorbic acid
| SolubleOther =
| Solvent = | density = 1.694
| LogP = 1.82 | melting_point = 190
| boiling_point = 553
| VaporPressure = 34.4 mm Hg @ 25 °C (cis); 23.0 mm Hg @ 25 °C (trans)
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb = }}
| Section3 = {{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor = }}
| Section7 = {{Chembox Hazards
| EUClass = T,N
| EUIndex = 208-826-5
| MainHazards =
| NFPA-H = 2
| NFPA-F = 3
| NFPA-R = 0
| NFPA-O =
| RPhrases = 10-20/21-25-36/37/38-43-50/53
| SPhrases = (1/2-)-36/37-45-60-61
| RSPhrases =
| FlashPt = 28 °C
| Autoignition = > 500 °C
| ExploLimits = 5.3% - 14.5% (80 °C)
| PEL = 1}}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration
oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)