Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 04:38, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477306814 of page Hydrogen_sulfide for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Latest revision as of 14:25, 29 January 2022 edit undo119.246.116.98 (talk)No edit summary 
(518 intermediate revisions by 8 users not shown)
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{drugbox
| verifiedrevid = 477001424
| Verifiedfields = changed
| IUPAC_name = 2-Oxo-<small>L</small>-threo-hexono-1,4-lactone-2,3-enediol<br />''or''<br />(''R'')-3,4-dihydroxy-5-((''S'')- 1,2-dihydroxyethyl)furan-2(5''H'')-one
| Watchedfields = changed
| image = L-Ascorbic_acid.svg
| verifiedrevid = 476999170
| width = 200px
| ImageFileL1 = Hydrogen-sulfide-2D-dimensions.svg
| image2 = Ascorbic-acid-from-xtal-1997-3D-balls.png
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageSizeL1 = 121 | width2 = 200px

| ImageNameL1 = Skeletal formula of hydrogen sulfide with two dimensions
<!--Clinical data-->
| ImageFileR1 = Hydrogen-sulfide-3D-vdW.png
| Drugs.com = {{drugs.com|MTM|vitamin_c}}
| ImageFileR1_Ref = {{chemboximage|correct|??}}
| licence_EU = <!-- EMEA requires brand name -->
| ImageSizeR1 = 121
| licence_US = <!-- FDA may use generic name -->
| ImageNameR1 = Spacefill model of hydrogen sulfide
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| SystematicName = Hydrogen sulfide<ref>{{Cite web|title = Hydrogen Sulfide - PubChem Public Chemical Database|url = http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=402&loc=ec_rcs|work = The PubChem Project|location = USA|publisher = National Center for Biotechnology Information}}</ref>
| pregnancy_US = <!-- A / B / C / D / X -->
| OtherNames = Dihydrogen monosulfide<br />
| pregnancy_category = A
Dihydrogen sulfide<br />
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
Sewer gas<br />
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
Stink damp<br />
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
Sulfane<br />
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
Sulfurated hydrogen<br />
| legal_status = general public availability
Sulfureted hydrogen<br />
| routes_of_administration = oral
Sulfuretted hydrogen<br />

Sulfur hydride<br />
<!--Pharmacokinetic data-->
Hydrosulfuric acid
| bioavailability = rapid & complete
| Section1 = {{Chembox Identifiers
| protein_bound = negligible
| CASNo = 7783-06-4
| elimination_half-life = varies according to plasma concentration <!-- can be 30 min to weeks, depending on body stores -->
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 402 | excretion = renal

| PubChem_Ref = {{Pubchemcite|correct|PubChem}}
<!--Identifiers-->
| ChemSpiderID = 391
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| UNII = YY9FVM7NSN
| CAS_number = 50-81-7
| UNII_Ref = {{fdacite|correct|FDA}}
| EINECS = 231-977-3 | ATC_prefix = A
| UNNumber = 1053 | ATC_suffix = 11G
| ChEBI_Ref = {{ebicite|correct|EBI}}
| KEGG = C00283
| ChEBI = 29073
| KEGG_Ref = {{keggcite|correct|kegg}}
| PubChem = 5785
| MeSHName = Hydrogen+sulfide
| ChEBI_Ref = {{ebicite|correct|EBI}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChEBI = 16136 | DrugBank = DB00126
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL = <!-- blanked - oldvalue: 1200739 -->
| ChemSpiderID = 10189562
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| NIAID_ChemDB = 002072
| RTECS = MX1225000
| UNII_Ref = {{fdacite|correct|FDA}}
| Beilstein = 3535004
| Gmelin = 303 | UNII = PQ6CK8PD0R
| KEGG_Ref = {{keggcite|correct|kegg}}
| 3DMet = B01206
| SMILES = S | KEGG = D00018
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| StdInChI = 1S/H2S/h1H2
| ChEMBL = 196
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| InChI = 1/H2S/h1H2
<!--Chemical data-->
| StdInChIKey = RWSOTUBLDIXVET-UHFFFAOYSA-N
| chemical_formula =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| C=6 | H=7 | O=6
| InChIKey = RWSOTUBLDIXVET-UHFFFAOYAJ
| molecular_weight = 176.12 g/]
}}
| smiles = C((1C(=C(C(=O)O1)O)O)O)O
| Section2 = {{Chembox Properties
| InChI = 1/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| H = 2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| S = 1
| StdInChI = 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
| ExactMass = 33.987720754 g/mol
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| Appearance = Colorless gas
| StdInChIKey = CIWBSHSKHKDKBQ-JLAZNSOCSA-N
| Odor = faint rotten egg
| synonyms = <small>L</small>-ascorbic acid
| Density = 1.363 g dm<sup>-3</sup>
| MeltingPtC = -82 | density = 1.694
| BoilingPtC = -60 | melting_point = 190
| boiling_point = 553
| Solubility = 4 g dm<sup>-3</sup> (at 20 °C)
| VaporPressure = 1740 kPa (at 21 °C)
| pKa = 7.0<ref>Perrin, D.D., ''Ionisation Constants of Inorganic Acids and Bases in Aqueous Solution'', 2nd Ed., Pergamon Press: Oxford, '''1982'''.</ref>
| pKb = 6.95
| RefractIndex = 1.000644 (0 °C) <ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, ISBN 0-07-049439-8</ref>
}}
| Section3 = {{Chembox Structure
| MolShape = Bent
| Dipole = 0.97 D
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = −21&nbsp;kJ·mol<sup>−1</sup><ref name=b1>{{cite book| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed.| publisher = Houghton Mifflin Company| year = 2009| isbn = 061894690X|page=A23}}</ref>
| Entropy = 206&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
| HeatCapacity = 1.003 J K<sup>-1</sup> g<sup>-1</sup>
}}
| Section5 = {{Chembox Hazards
| MSDS =
| EUIndex = 016-001-00-4
| EUClass = {{Hazchem F+}} {{Hazchem T+}} {{Hazchem N}}
| RPhrases = {{R12}}, {{R26}}, {{R50}}
| SPhrases = {{S1/2}}, {{S9}}, {{S16}}, {{S36}}, {{S38}}, {{S45}}, {{S61}}
| NFPA-H = 4
| NFPA-F = 4
| NFPA-R = 0
| Autoignition = 232 °C
| FlashPt = 207 °C (closed cup)
| ExploLimits = 4.3–46%
}}
| Section6 = {{Chembox Related
| Function = hydrogen chalcogenides
| OtherFunctn = ]<br />]<br />]<br />]<br />]<br/>]
| OtherCpds = ]
}}
}} }}

Latest revision as of 14:25, 29 January 2022

This page contains a copy of the infobox ({{drugbox}}) taken from revid 477243833 of page Vitamin_C with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Other namesL-ascorbic acid
AHFS/Drugs.comMultum Consumer Information
Pregnancy
category
  • A
Routes of
administration
oral
ATC code
Legal status
Legal status
  • general public availability
Pharmacokinetic data
Bioavailabilityrapid & complete
Protein bindingnegligible
Elimination half-lifevaries according to plasma concentration
Excretionrenal
Identifiers
IUPAC name
  • 2-Oxo-L-threo-hexono-1,4-lactone-2,3-enediol
    or
    (R)-3,4-dihydroxy-5-((S)- 1,2-dihydroxyethyl)furan-2(5H)-one
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
NIAID ChemDB
Chemical and physical data
FormulaC6H7O6
Molar mass176.12 g/mole g·mol
3D model (JSmol)
Density1.694 g/cm
Melting point190 °C (374 °F)
Boiling point553 °C (1,027 °F)
SMILES
  • C((1C(=C(C(=O)O1)O)O)O)O
InChI
  • InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
  • Key:CIWBSHSKHKDKBQ-JLAZNSOCSA-N
  (verify)