Revision as of 15:19, 15 April 2012 editMSBOT (talk | contribs)13,809 editsm r2.7.3) (Robot: Adding fa:۳-متوکسی-۴-هیدروکسیهیپوریک اسید← Previous edit |
Latest revision as of 01:03, 27 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
(14 intermediate revisions by 10 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 449119416 |
|
| verifiedrevid = 477219271 |
⚫ |
| Name = 3-Methoxy-4-hydroxy-hippuric acid |
|
|
| ImageFile = 3-methoxy-4-hydroxy-hippuric acid.PNG |
|
| Name = 3-Methoxy-4-hydroxyhippuric acid |
|
⚫ |
| ImageFile = 3-Methoxy-4-hydroxyhippuric acid.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of 3-methoxy-4-hydroxy-hippuric acid |
|
| ImageName = Chemical structure of 3-methoxy-4-hydroxyhippuric acid |
|
| ImageAlt = Chemical structure of 3-methoxy-4-hydroxy-hippuric acid |
|
| ImageAlt = Chemical structure of 3-methoxy-4-hydroxyhippuric acid |
|
<!-- | ImageCaption = Chemical structure of --> |
|
<!-- | ImageCaption = Chemical structure of --> |
|
| IUPACName = |
|
| IUPACName = ''N''-(4-Hydroxy-3-methoxybenzoyl)glycine |
|
|
| SystematicName = (4-Hydroxy-3-methoxybenzamido)acetic acid |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = Vanilloylglycine<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 1212-04-0 |
|
| CASNo_Ref = |
|
| CASNo_Ref = |
|
| CASOther = |
|
| CASNoOther = |
|
| PubChem = |
|
| PubChem = 3083688 |
|
|
| UNII = 82F2E8I1NJ |
|
|
| ChEBI = 89556 |
|
|
| DTXSID = DTXSID50153176 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2340857 |
|
| ChemSpiderID = 2340857 |
Line 20: |
Line 24: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LOODYTDRRBLQNH-UHFFFAOYSA-N |
|
| StdInChIKey = LOODYTDRRBLQNH-UHFFFAOYSA-N |
|
| SMILES = |
|
| SMILES = COc1cc(C(=O)NCC(=O)O)ccc1O |
|
| InChI = |
|
| InChI = |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>10</sub>H<sub>11</sub>NO<sub>5</sub> |
|
| Formula = C<sub>10</sub>H<sub>11</sub>NO<sub>5</sub> |
|
| MolarMass = 225.19 g/mol |
|
| MolarMass = 225.19 g/mol |
|
| ExactMass = 225.063722 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''3-Methoxy-4-hydroxyhippuric acid''' is one of the main ] ]s found in humans after consumption of ] infusions.<ref>{{cite journal | doi = 10.1002/biof.5520080119 | title = Catechin metabolites after intake of green tea infusions | year = 1998 | last1 = Pietta | first1 = P. G. | last2 = Simonetti | first2 = P. | last3 = Gardana | first3 = C. | last4 = Brusamolino | first4 = A. | last5 = Morazzoni | first5 = P. | last6 = Bombardelli | first6 = E. | journal = BioFactors | volume = 8 | pages = 111–8 | pmid = 9699018 | issue = 1–2}}</ref> |
|
'''3-Methoxy-4-hydroxyhippuric acid''' is one of the main ] ]s found in humans after consumption of ] infusions.<ref>{{cite journal | doi = 10.1002/biof.5520080119 | title = Catechin metabolites after intake of green tea infusions | year = 1998 | last1 = Pietta | first1 = P. G. | last2 = Simonetti | first2 = P. | last3 = Gardana | first3 = C. | last4 = Brusamolino | first4 = A. | last5 = Morazzoni | first5 = P. | last6 = Bombardelli | first6 = E. | journal = BioFactors | volume = 8 | pages = 111–8 | pmid = 9699018 | issue = 1–2| s2cid = 37684286 }}</ref>{{elucidate|date=May 2015}} |
|
|
|
|
|
==See also== |
|
==See also== |
Line 52: |
Line 53: |
|
|
|
|
|
{{DEFAULTSORT:Methoxy-4-hydroxyhippuric acid, 3-}} |
|
{{DEFAULTSORT:Methoxy-4-hydroxyhippuric acid, 3-}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
Line 58: |
Line 59: |
|
|
|
|
|
{{Aromatic-stub}} |
|
{{Aromatic-stub}} |
|
|
|
|
] |
|