Misplaced Pages

Isodesmosine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editContent deleted Content addedVisualWikitext
Revision as of 11:40, 29 May 2012 editGareth CHEBI (talk | contribs)Extended confirmed users1,231 editsm ChEBI ID aded to Chembox identifiers← Previous edit Latest revision as of 16:49, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids 
(21 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Unreferenced|date=February 2007}}

{{Chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 400693821
| Watchedfields = changed
| verifiedrevid = 424832042
| ImageFile = isodesmosine.svg | ImageFile = isodesmosine.svg
| ImageSize = | ImageSize =
| IUPACName = | IUPACName =
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| Abbreviations = | Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 991-01-5 | CASNo = 991-01-5
| EINECS = | EINECS =
| PubChem = 13811 | PubChem = 13811
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 64366 | ChemSpiderID = 13214
| SMILES = c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N
| SMILES =
| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
| InChI =
| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O
| RTECS = | RTECS =
| MeSHName = | MeSHName = D007524
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = | ChEBI = 64366
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = | KEGG =
}}
| ATCCode_prefix =
|Section2={{Chembox Properties
| ATCCode_suffix =
| C=24
| ATC_Supplemental =}}
| H=40
| Section2 = {{Chembox Properties
| N=5
| Formula = C<sub>24</sub>H<sub>40</sub>N<sub>5</sub>O<sub>8</sub>
| O=8
| MolarMass = 526.603 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| Melting_notes = | MeltingPt_notes =
| BoilingPt = | BoilingPt =
| Boiling_notes = | BoilingPt_notes =
| Solubility = | Solubility =
| SolubleOther = | SolubleOther =
Line 45: Line 52:
| Viscosity = | Viscosity =
| Dipole = }} | Dipole = }}
| Section3 = {{Chembox Structure |Section3={{Chembox Structure
| CrystalStruct = | CrystalStruct =
| Coordination = | Coordination =
| MolShape = | MolShape =
| Dipole = }} | Dipole = }}
| Section4 = {{Chembox Thermochemistry |Section4={{Chembox Thermochemistry
| DeltaHf = | DeltaHf =
| DeltaHc = | DeltaHc =
| Entropy = | Entropy =
| HeatCapacity = }} | HeatCapacity = }}
| Section5 = {{Chembox Pharmacology |Section5={{Chembox Pharmacology
| AdminRoutes = | AdminRoutes =
| Bioavail = | Bioavail =
Line 67: Line 74:
| Legal_AU = | Legal_AU =
| Legal_CA = | Legal_CA =
| PregCat = | Pregnancy_category =
| PregCat_AU = | Pregnancy_AU =
| PregCat_US = }} | Pregnancy_US = }}
| Section6 = {{Chembox Explosive |Section6={{Chembox Explosive
| ShockSens = | ShockSens =
| FrictionSens = | FrictionSens =
| ExplosiveV = | DetonationV =
| REFactor = }} | REFactor = }}
| Section7 = {{Chembox Hazards |Section7={{Chembox Hazards
| ExternalMSDS = | ExternalSDS =
| EUClass =
| EUIndex =
| MainHazards = | MainHazards =
| NFPA-H = | NFPA-H =
| NFPA-F = | NFPA-F =
| NFPA-R = | NFPA-R =
| NFPA-O = | NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| ExploLimits = | ExploLimits =
| PEL = }} | PEL = }}
| Section8 = {{Chembox Related |Section8={{Chembox Related
| OtherAnions = | OtherAnions =
| OtherCations = | OtherCations =
| OtherFunctn = | OtherFunction =
| Function = | OtherFunction_label =
| OtherCpds = }} | OtherCompounds = }}
}} }}
'''Isodesmosine''' is a ] derivative found in ].


'''Isodesmosine''' is a ] derivative found in ]. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by ]. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.<ref>{{cite journal | doi = 10.1016/j.matbio.2006.09.011 | pmid = 17112714 | title = Differential expression of two tropoelastin genes in zebrafish | journal = Matrix Biology | volume = 26 | issue = 2 | pages = 115–124 | year = 2007 | last1 = Miao | first1 = M. | last2 = Bruce | first2 = A.E.E. | last3 = Bhanji | first3 = T. | last4 = Davis | first4 = E.C. | last5 = Keeley | first5 = F.W. }}</ref>
]


==See also==
* ]


==References==
{{Biochemistry-stub}}
{{reflist}}


]
]


{{Biochemistry-stub}}

Latest revision as of 16:49, 17 September 2023

Isodesmosine
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
MeSH D007524
PubChem CID
InChI
  • InChI=1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1Key: RGXCTRIQQODGIZ-UHFFFAOYSA-O
  • InChI=1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1Key: RGXCTRIQQODGIZ-IKLDFBCSAD
SMILES
  • c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N
Properties
Chemical formula C24H40N5O8
Molar mass 526.611 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Chemical compound

Isodesmosine is a lysine derivative found in elastin. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by lysyl-oxidase. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.

See also

References

  1. Miao, M.; Bruce, A.E.E.; Bhanji, T.; Davis, E.C.; Keeley, F.W. (2007). "Differential expression of two tropoelastin genes in zebrafish". Matrix Biology. 26 (2): 115–124. doi:10.1016/j.matbio.2006.09.011. PMID 17112714.


Stub icon

This biochemistry article is a stub. You can help Misplaced Pages by expanding it.

Categories: