Β-Methylfentanyl: Difference between revisions

Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 23:14, 6 August 2011 editCheMoBot (talk \| contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation\|Chem/← Previous edit		Revision as of 05:56, 2 September 2011 edit undoBogBot (talk \| contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot Next edit →
Line 1:		Line 1:
			{{Drugbox
	~~{{drugbox~~ \| verifiedrevid = 443421073		\| verifiedrevid = 443421073
	\|
	\| IUPAC_name = ''N''-phenyl-''N''-propanamide		\| IUPAC_name = ''N''-phenyl-''N''-propanamide
	\| image = Betamethylfentanyl.svg		\| image = Betamethylfentanyl.svg
	\| width = 140		\| width = 140

			<!--Clinical data-->
			\| tradename =
		⚫	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
		⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
		⚫	\| pregnancy_category =
		⚫	\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
		⚫	\| legal_CA =
		⚫	\| legal_UK =
		⚫	\| legal_US =
		⚫	\| legal_status =
		⚫	\| routes_of_administration =

			<!--Pharmacokinetic data-->
		⚫	\| bioavailability =
		⚫	\| protein_bound =
		⚫	\| metabolism =
		⚫	\| elimination_half-life =
		⚫	\| excretion =

			<!--Identifiers-->
	\| CASNo_Ref = {{cascite}}		\| CASNo_Ref = {{cascite}}
		⚫	\| CAS_number = 79146-56-8
		⚫	\| ATC_prefix = none
		⚫	\| ATC_suffix =
		⚫	\| PubChem = 6425761
		⚫	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
		⚫	\| DrugBank =
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 4931228

			<!--Chemical data-->
		⚫	\| C=23 \| H=30 \| N=2 \| O=1
		⚫	\| molecular_weight = 350.497 g/mol
		⚫	\| smiles = O=C(N(c1ccccc1)C3CCN(CC(c2ccccc2)C)CC3)CC
	\| InChI = 1/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3		\| InChI = 1/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3
	\| InChIKey = UXIGUKSHASXDNI-UHFFFAOYAM		\| InChIKey = UXIGUKSHASXDNI-UHFFFAOYAM
⚫	\| CAS_number = 79146-56-8
⚫	\| synonyms = β-Methylfentanyl
⚫	\| ATC_prefix = none
⚫	\| ATC_suffix =
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3		\| StdInChI = 1S/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = UXIGUKSHASXDNI-UHFFFAOYSA-N		\| StdInChIKey = UXIGUKSHASXDNI-UHFFFAOYSA-N
		⚫	\| synonyms = β-Methylfentanyl
⚫	\| PubChem = 6425761
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID=4931228
⚫	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
⚫	\| DrugBank =
⚫	\| C = 23 \| H = 30 \| N = 2 \| O = 1
⚫	\| molecular_weight = 350.497 g/mol
⚫	\| smiles = O=C(N(c1ccccc1)C3CCN(CC(c2ccccc2)C)CC3)CC
⚫	\| bioavailability =
⚫	\| protein_bound =
⚫	\| metabolism =
⚫	\| elimination_half-life =
⚫	\| excretion =
⚫	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
⚫	\| pregnancy_category=
⚫	\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
⚫	\| legal_CA =
⚫	\| legal_UK =
⚫	\| legal_US =
⚫	\| legal_status =
⚫	\| routes_of_administration =
	}}		}}

Revision as of 05:56, 2 September 2011

Pharmaceutical compound

Β-Methylfentanyl
Clinical data

Other names	β-Methylfentanyl
ATC code	none
Identifiers
IUPAC name N-phenyl-N-propanamide
CAS Number	79146-56-8
PubChem CID	6425761
ChemSpider	4931228
CompTox Dashboard (EPA)	DTXSID701018403
Chemical and physical data
Formula	C₂₃H₃₀N₂O
Molar mass	350.497 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O=C(N(c1ccccc1)C3CCN(CC(c2ccccc2)C)CC3)CC
InChI InChI=1S/C23H30N2O/c1-3-23(26)25(21-12-8-5-9-13-21)22-14-16-24(17-15-22)18-19(2)20-10-6-4-7-11-20/h4-13,19,22H,3,14-18H2,1-2H3 Key:UXIGUKSHASXDNI-UHFFFAOYSA-N
(verify)

β-Methylfentanyl is an opioid analgesic that is an analogue of fentanyl.

β-Methylfentanyl was sold briefly on the black market in the early 1980s, before the introduction of the Federal Analog Act which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.

β-Methylfentanyl has similar effects to fentanyl. Side effects of fentanyl analogues are similar to those of fentanyl itself, which include itching, nausea, and respiratory depression, which can be serious and even life-threatening.

References

Henderson GL. Designer Drugs: Past History and Future Prospects. Journal of Forensic Sciences 1988; 33(2):569-575

Categories: