Revision as of 13:27, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report← Previous edit |
Revision as of 11:58, 3 September 2011 edit undoBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBotNext edit → |
Line 3: |
Line 3: |
|
{{unreferenced|date=December 2010}} |
|
{{unreferenced|date=December 2010}} |
|
|
|
|
|
{{drugbox |
|
{{Drugbox |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 7786W0VV8M |
|
|
| verifiedrevid = 444056288 |
|
| verifiedrevid = 444056288 |
|
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate |
|
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate |
|
| image = Piprozolin.png |
|
| image = Piprozolin.png |
|
|
|
⚫ |
| CAS_number = 17243-64-0 |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = AX01 |
|
| tradename = |
|
| PubChem = 5911905 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| CASNo = 63250-48-6 |
|
|
⚫ |
| pregnancy_category = |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 17243-64-0 |
|
⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = AX01 |
|
|
| PubChem = 5911905 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4744588 |
|
| ChemSpiderID = 4744588 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 7786W0VV8M |
⚫ |
| StdInChIKey = UAXYBJSAPFTPNB-KHPPLWFESA-N |
|
|
|
|
|
| SMILES = O=C(OCC)\C=C1/SC(C(=O)N1CC)N2CCCCC2 |
|
|
|
<!--Chemical data--> |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| C=14 | H=22 | N=2 | O=3 | S=1 |
|
⚫ |
| molecular_weight = 298.40 g/mol |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10- |
|
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10- |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = UAXYBJSAPFTPNB-KHPPLWFESA-N |
⚫ |
| DrugBank = |
|
⚫ |
| C=14|H=22|N=2|O=3|S=1 |
|
⚫ |
| molecular_weight = 298.40 g/mol |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|