| Revision as of 14:12, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|erro← Previous edit |
Revision as of 11:55, 3 September 2011 edit undoBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBotNext edit → |
| Line 1: |
Line 1: |
|
{{drugbox |
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| ⚫ |
| UNII = 70JKL15MUH |
|
|
| verifiedrevid = 443501665 |
|
| verifiedrevid = 443501665 |
|
| IUPAC_name = (''RS'')-''N''-(2-Oxothiolan-3-yl)acetamide |
|
| IUPAC_name = (''RS'')-''N''-(2-Oxothiolan-3-yl)acetamide |
|
| image = Citiolone.png |
|
| image = Citiolone.png |
|
|
|
| ⚫ |
| CAS_number = 1195-16-0 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = 14520 |
|
|
|
| tradename = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| ChemSpiderID = 13864 |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| SMILES = O=C1SCCC1NC(=O)C |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| StdInChI=1S/C6H9NO2S/c1-4(8)7-5-2-3-10-6(5)9/h5H,2-3H2,1H3,(H,7,8) |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| ⚫ |
| StdInChIKey = NRFJZTXWLKPZAV-UHFFFAOYSA-N |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = BA04 |
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
| PubChem = 14520 |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 1195-16-0 |
|
⚫ |
| ATC_prefix = A05 |
|
|
| ATC_suffix = BA04 |
|
⚫ |
| PubChem = 14520 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 13864 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 70JKL15MUH |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07105 |
|
| KEGG = D07105 |
|
|
|
| ⚫ |
| C=6|H=9|N=1|O=2|S=1 |
|
|
|
<!--Chemical data--> |
| ⚫ |
| molecular_weight = 159.21 g/mol |
|
|
⚫ |
| C=6 | H=9 | N=1 | O=2 | S=1 |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| molecular_weight = 159.21 g/mol |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| metabolism = |
|
|
⚫ |
| StdInChI = 1S/C6H9NO2S/c1-4(8)7-5-2-3-10-6(5)9/h5H,2-3H2,1H3,(H,7,8) |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| excretion = |
|
|
⚫ |
| StdInChIKey = NRFJZTXWLKPZAV-UHFFFAOYSA-N |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
