Revision as of 12:09, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447131021 of page Felodipine for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 12:10, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455774442 of page Felypressin for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 411546831 |
|
| verifiedrevid = 402117847 |
|
| IUPAC_name = 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|
|
| image = Felodipine.png |
|
|ImageFile=felypressin.png |
|
|
|ImageSize= |
|
| image2 = Felodipine-from-xtal-1989-3D-balls.png |
|
|
|
| IUPACName=<small>1--pyrrolidine-2-carboxylic acid -amide</small> |
|
|
|
|
|
|OtherNames= |
|
<!--Clinical data--> |
|
|
|
|Section1={{Chembox Identifiers |
|
| tradename = Plendil |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| Drugs.com = {{drugs.com|monograph|felodipine}} |
|
|
⚫ |
| ChemSpiderID = 16736539 |
|
| MedlinePlus = a692016 |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| pregnancy_US = C |
|
|
|
| ChEMBL = <!-- blanked - oldvalue: 1697764 --> |
|
| legal_status = Rx-only |
|
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 15% <ref>AstraZeneca MI Department, 16th April 2010</ref> |
|
|
| metabolism = ] |
|
|
| elimination_half-life = ?? |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 72509-76-3 |
|
|
| ATC_prefix = C08 |
|
|
| ATC_suffix = CA02 |
|
⚫ |
| PubChem = 3333 |
|
⚫ |
| DrugBank = DB01023 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 3216 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = OL961R6O2C |
|
| UNII = 17N2918V6G |
|
|
| InChI = 1/C46H65N13O11S2/c47-18-8-7-14-29(40(64)52-23-38(51)62)54-45(69)35-15-9-19-59(35)46(70)34-25-72-71-24-28(48)39(63)55-31(20-26-10-3-1-4-11-26)43(67)56-32(21-27-12-5-2-6-13-27)42(66)53-30(16-17-36(49)60)41(65)57-33(22-37(50)61)44(68)58-34/h1-6,10-13,28-35H,7-9,14-25,47-48H2,(H2,49,60)(H2,50,61)(H2,51,62)(H,52,64)(H,53,66)(H,54,69)(H,55,63)(H,56,67)(H,57,65)(H,58,68)/t28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
|
| InChIKey = SFKQVVDKFKYTNA-DZCXQCEKBI |
|
| KEGG = D00319 |
|
⚫ |
| ChEBI = 585948 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1480 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=18 | H=19 | Cl=2 | N=1 | O=4 |
|
|
| molecular_weight = 384.259 g/mol |
|
|
| smiles = O=C(OCC)\C1=C(\N/C(=C(/C(=O)OC)C1c2cccc(Cl)c2Cl)C)C |
|
|
| InChI = 1/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
|
|
| InChIKey = RZTAMFZIAATZDJ-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C46H65N13O11S2/c47-18-8-7-14-29(40(64)52-23-38(51)62)54-45(69)35-15-9-19-59(35)46(70)34-25-72-71-24-28(48)39(63)55-31(20-26-10-3-1-4-11-26)43(67)56-32(21-27-12-5-2-6-13-27)42(66)53-30(16-17-36(49)60)41(65)57-33(22-37(50)61)44(68)58-34/h1-6,10-13,28-35H,7-9,14-25,47-48H2,(H2,49,60)(H2,50,61)(H2,51,62)(H,52,64)(H,53,66)(H,54,69)(H,55,63)(H,56,67)(H,57,65)(H,58,68)/t28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 |
|
| StdInChI = 1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RZTAMFZIAATZDJ-UHFFFAOYSA-N |
|
| StdInChIKey = SFKQVVDKFKYTNA-DZCXQCEKSA-N |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=56-59-7 |
|
⚫ |
| PubChem=5956 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00093 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 60564 |
|
|
| SMILES = NC(=O)CNC(=O)(CCCCN)NC(=O)1CCCN1C(=O)4NC(=O)(NC(=O)(CCC(N)=O)NC(=O)(Cc2ccccc2)NC(=O)(Cc3ccccc3)NC(=O)(N)CSSC4)CC(N)=O |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>46</sub>H<sub>65</sub>N<sub>13</sub>O<sub>11</sub>S<sub>2</sub> |
|
|
| MolarMass=1040.22 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |