Revision as of 14:49, 17 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456609432 of page Galactosamine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit |
Revision as of 15:04, 17 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456671290 of page Galantamine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 443831212 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = (4a''S'',6''R'',8a''S'')- 5,6,9,10,11,12- hexahydro- 3-methoxy- 11-methyl- 4a''H''- benzofuro benzazepin- 6-ol |
⚫ |
| verifiedrevid = 400097576 |
|
|
|
| image = Galantamine.svg |
|
| reference = <ref>''Merck Index'', 11th Edition, '''4240'''.</ref> |
|
|
|
| width = 175 |
|
| ImageFile = galactosamine.png |
|
|
|
|
|
| ImageFile1 = alpha-D-galactosamine.png |
|
|
|
<!--Clinical data--> |
|
| ImageSize = 150px |
|
|
| ImageSize1 = 150px |
|
| tradename = Razadyne |
|
|
| Drugs.com = {{drugs.com|monograph|razadyne}} |
|
| IUPACName = 2-Amino-2-deoxy-D-galactose |
|
|
|
| MedlinePlus = a699058 |
|
| OtherNames = α-D-galactosamine |
|
|
|
| pregnancy_category = B |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| legal_status = Rx |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| routes_of_administration = Oral |
⚫ |
| ChemSpiderID = 22576 |
|
|
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
|
<!--Pharmacokinetic data--> |
|
| ChEMBL = <!-- blanked - oldvalue: 207280 --> |
|
|
|
| bioavailability = 80 to 100% |
|
| InChI = 1/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4+,5-,6?/m1/s1 |
|
|
|
| protein_bound = 18% |
|
| InChIKey = MSWZFWKMSRAUBD-GASJEMHNBA |
|
|
|
| metabolism = ] partially ]:]/] substrate |
|
|
| elimination_half-life = 7 hours |
|
|
| excretion = ] (95%, of which 32% unchanged), fecal (5%) |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 357-70-0 |
|
|
| ATC_prefix = N06 |
|
|
| ATC_suffix = DA04 |
|
⚫ |
| PubChem = 9651 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00674 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 9272 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0D3Q044KCA |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D04292 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 42944 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 659 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=17 | H=21 | N=1 | O=3 |
|
|
| molecular_weight = 287.354 g/mol |
|
|
| smiles = O(c2c1O4C(O)/C=C\43c1c(cc2)CN(C)CC3)C |
|
|
| InChI = 1/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
|
|
| InChIKey = ASUTZQLVASHGKV-JDFRZJQEBY |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4+,5-,6?/m1/s1 |
|
| StdInChI = 1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MSWZFWKMSRAUBD-GASJEMHNSA-N |
|
| StdInChIKey = ASUTZQLVASHGKV-JDFRZJQESA-N |
|
|
| melting_point = 126.5 |
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| CASNo = <!-- blanked - oldvalue: 7535-00-4 --> |
|
⚫ |
| PubChem = 24154 |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 60312 |
|
|
| SMILES = O1(O)(OC(O)1N)CO |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>6</sub>H<sub>13</sub>NO<sub>5</sub> |
|
|
| MolarMass = 179.171 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = 180 °C (HCl salt) |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |