Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:18, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456965919 of page Norgestimate for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').← Previous edit Revision as of 14:18, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457115575 of page Norgestrienone for the Chem/Drugbox validation project (updated: 'UNII', 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 408343690 | verifiedrevid = 400332083
| IUPAC_name =
| IUPAC_name = (13-ethyl-17-ethynyl-3-hydroxyimino- 1,2,6,7,8,9,10,11,12,14,15,16- dodecahydrocyclopenta phenanthren-17-yl) acetate
| image = Norgestimate.svg | image = Norgestrienone.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|CONS|norgestimate}}
| MedlinePlus = a601050
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =
Line 21: Line 14:
<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound =
| metabolism = | metabolism =
| elimination_half-life = 12-30 hours
| excretion = | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 35189-28-7 | CAS_number = <!-- blanked - oldvalue: 848-21-5 -->
| ATC_prefix = G03 | ATC_prefix = G03
| ATC_suffix = AA11 | ATC_suffix = AC07
⚫ | PubChem = 13313
| ATC_supplemental =
⚫ | PubChem = 6540478
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00957
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5022837 | ChemSpiderID = 12749
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = C291HFX4DY | UNII = 89386PYU9O
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D05209 | KEGG = D07220

| ChEBI_Ref = {{ebicite|changed|EBI}}
<!--Chemical data-->
| ChEBI = 50815
⚫ | C=20 | H=22 | O=2
| ChEMBL_Ref = {{ebicite|changed|EBI}}
⚫ | molecular_weight = 294.387 g/mol
| ChEMBL = <!-- blanked - oldvalue: 1200934 -->
⚫ | smiles = O=C4\C=C3/C(=C2/C=C\1((CC1(C#C)O)2CC3)C)CC4
⚫ | C=23 | H=31 | N=1 | O=3
| InChI = 1/C20H22O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,8,10,12,17-18,22H,4-7,9,11H2,2H3/t17-,18+,19+,20+/m1/s1
⚫ | molecular_weight = 369.497 g/mol
| InChIKey = GVDMJXQHPUYPHP-FYQPLNBIBQ
⚫ | smiles = O=C(O2(C#C)CC14(CC12CC)3/C(=C\C(=N\O)CC3)CC4)C
| InChI = 1/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1
| InChIKey = KIQQMECNKUGGKA-NMYWJIRABS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H31NO3/c1-4-22-12-10-19-18-9-7-17(24-26)14-16(18)6-8-20(19)21(22)11-13-23(22,5-2)27-15(3)25/h2,14,18-21,26H,4,6-13H2,1,3H3/b24-17+/t18-,19+,20+,21-,22-,23-/m0/s1 | StdInChI = 1S/C20H22O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,8,10,12,17-18,22H,4-7,9,11H2,2H3/t17-,18+,19+,20+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KIQQMECNKUGGKA-NMYWJIRASA-N | StdInChIKey = GVDMJXQHPUYPHP-FYQPLNBISA-N
}} }}

Revision as of 14:18, 24 November 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 457115575 of page Norgestrienone with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
ATC code
Identifiers
PubChem CID
ChemSpider
UNII
KEGG
Chemical and physical data
FormulaC20H22O2
Molar mass294.387 g/mol g·mol
3D model (JSmol)
SMILES
  • O=C4\C=C3/C(=C2/C=C\1((CC1(C#C)O)2CC3)C)CC4
InChI
  • InChI=1S/C20H22O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,8,10,12,17-18,22H,4-7,9,11H2,2H3/t17-,18+,19+,20+/m1/s1
  • Key:GVDMJXQHPUYPHP-FYQPLNBISA-N
  (what is this?)  (verify)