Revision as of 14:58, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456783665 of page Oxybutynin for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 14:58, 24 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 454010123 of page Oxymetazoline for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 420378290 |
|
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 3-(4,5-dihydro-1''H''-imidazol-2-ylmethyl)- 2,4-dimethyl-6-tert-butyl-phenol |
|
| Watchedfields = changed |
|
|
⚫ |
| image = Oxymetazoline structure.png |
⚫ |
| verifiedrevid = 411820278 |
|
|
|
| image2 = Oxymetazoline_3d.gif |
|
| IUPAC_name = 4-Diethylaminobut-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylethanoate |
|
⚫ |
| image = Oxybutynin structure.png |
|
|
| image2 = Oxybutynin 3d balls.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Ditropan |
|
| tradename = Afrin, Dristan12-hrnasalspray, Ocuclear |
|
| Drugs.com = {{drugs.com|monograph|oxybutynin-chloride}} |
|
| Drugs.com = {{drugs.com|monograph|oxymetazoline-hydrochloride}} |
|
|
| pregnancy_category = C |
|
| MedlinePlus = a682141 |
|
|
| pregnancy_category = B |
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
| legal_status = Rx Only (CA)<ref>{{cite web | url = http://webprod3.hc-sc.gc.ca/dpd-bdpp/info.do?lang = eng&code = 67903 | title = Product Information | publisher = ] | accessdate = 2011-08-13}}</ref>, Rx Only (US) |
|
⚫ |
| routes_of_administration = oral, transdermal |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 91%-93% |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 12.4-13.2 hours |
|
| elimination_half-life = 5-6 hours |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number = 1491-59-4 |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 5633-20-5 |
|
| ATC_prefix = R01 |
|
| ATC_prefix = G04 |
|
| ATC_suffix = AA05 |
|
|
| ATC_supplemental = {{ATC|R01|AB07}}, {{ATC|S01|GA04}} |
|
| ATC_suffix = BD04 |
|
|
|
| PubChem = 4636 |
|
| ATC_supplemental = |
|
|
| PubChem = 4634 |
|
| IUPHAR_ligand = 124 |
|
| IUPHAR_ligand = 359 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01062 |
|
| DrugBank = DB00935 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4473 |
|
| ChemSpiderID = 4475 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = K9P6MC7092 |
|
| UNII = 8VLN5B44ZY |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00465 |
|
| KEGG = D08322 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 7856 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1231 |
|
| ChEMBL = 762 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=22 | H=31 | N=1 | O=3 |
|
| C=16 | H=24 | N=2 | O=1 |
|
| molecular_weight = 357.486 g/mol |
|
| molecular_weight = 260.375 g·mol<sup>−1</sup> |
|
| smiles = O=C(OCC#CCN(CC)CC)C(O)(c1ccccc1)C2CCCCC2 |
|
| smiles = Oc1c(c(c(cc1C(C)(C)C)C)CC/2=N/CCN\2)C |
|
| InChI = 1/C22H31NO3/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3 |
|
| InChI = 1/C16H24N2O/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14/h8,19H,6-7,9H2,1-5H3,(H,17,18) |
|
| InChIKey = XIQVNETUBQGFHX-UHFFFAOYAB |
|
| InChIKey = WYWIFABBXFUGLM-UHFFFAOYAR |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H31NO3/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3 |
|
| StdInChI = 1S/C16H24N2O/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14/h8,19H,6-7,9H2,1-5H3,(H,17,18) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XIQVNETUBQGFHX-UHFFFAOYSA-N |
|
| StdInChIKey = WYWIFABBXFUGLM-UHFFFAOYSA-N |
|
|
| melting_point = 301.5 |
|
}} |
|
}} |