Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 11:51, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456622048 of page Perhexiline for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 11:51, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455411312 of page Perhydropyrene for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{Chembox
		⚫	\| verifiedrevid = 455341832
	\| Verifiedfields = changed
			\| ImageFile = Perhydropyrene.svg
⚫	\| verifiedrevid = ~~408794545~~
			\| ImageSize = 200px
	\| IUPAC_name = 2-(2,2-dicyclohexylethyl)piperidine
			\| IUPACName = Hexadecahydropyrene
	\| image = Perhexiline structure.svg
			\| OtherNames =

			\| Section1 = {{Chembox Identifiers
	<!--Clinical data-->
			\| CASNo = <!-- blanked - oldvalue: 2435-85-0 -->
	\| tradename =
		⚫	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| Drugs.com = {{drugs.com\|international\|perhexiline}}
		⚫	\| StdInChI = 1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2
	\| pregnancy_category =
	\| legal_status =
	\| routes_of_administration = Oral

	<!--Pharmacokinetic data-->
	\| bioavailability = Dose Dependent
	\| metabolism = Saturable Hepatic
	\| elimination_half-life = Dose Dependent
	\| excretion =

	<!--Identifiers-->
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| CAS_number = 6621-47-2
	\| ATC_prefix = C08
	\| ATC_suffix = EX02
⚫	\| PubChem = ~~4746~~
	\| DrugBank_Ref = {{drugbankcite\|changed\|drugbank}}
	\| DrugBank = DB01074
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID = ~~4584~~
	\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = KU65374X44
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = D08340
	\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| ChEBI = 35553
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = 75880

	<!--Chemical data-->
	\| C=19 \| H=35 \| N=1
	\| molecular_weight = 277.488
	\| smiles = N3C(CC(C1CCCCC1)C2CCCCC2)CCCC3
	\| InChI = 1/C19H35N/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18/h16-20H,1-15H2
	\| InChIKey = CYXKNKQEMFBLER-UHFFFAOYAN
⚫	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
⚫	\| StdInChI = 1S/~~C19H35N~~/c1-3-9-~~16(10~~-4-~~1)19(17-11~~-5-2-6-12-17)15~~-18-~~13~~-7-8-~~14~~-20-18~~/~~h16~~-~~20H~~,1-~~15H2~~
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~CYXKNKQEMFBLER~~-UHFFFAOYSA-N		\| StdInChIKey = BYBPEZLZCGOWIS-UHFFFAOYSA-N
		⚫	\| PubChem = 75524
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 68050
			\| SMILES = C2CCC3CCC1C4C(CCC1)CCC2C34
			\| InChI = 1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2
			}}
			\| Section2 = {{Chembox Properties
			\| C=16\|H=26
			\| Appearance =
			\| Density =
			\| MeltingPt =
			\| BoilingPt =
			\| Solubility =
			}}
			\| Section3 = {{Chembox Hazards
			\| MainHazards =
			\| FlashPt =
			\| Autoignition =
			}}
	}}		}}

Revision as of 11:51, 5 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455411312 of page Perhydropyrene with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names

IUPAC name Hexadecahydropyrene
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	68050
PubChem CID	75524
InChI InChI=1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2Key: BYBPEZLZCGOWIS-UHFFFAOYSA-N InChI=1S/C16H26/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-16H,1-10H2
SMILES C2CCC3CCC1C4C(CCC1)CCC2C34
Properties
Chemical formula	C₁₆H₂₆
Molar mass	218.384 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound