Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 14:15, 5 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456883970 of page Prilocaine for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit		Revision as of 14:16, 5 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 463660296 of page Primaquine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{Drugbox		{{Drugbox
	\| Verifiedfields = changed		\| Verifiedfields = changed
	\| verifiedrevid = ~~418550175~~		\| verifiedrevid = 411549619
	\| IUPAC_name = (''RS'')-''N''-(2-~~methylphenyl~~)-~~''N''<sup>2</sup>~~-~~propylalaninamide~~		\| IUPAC_name = (''RS'')-''N''-(6-methoxyquinolin-8-yl)pentane-1,4-diamine
	\| image = ~~Prilocaine~~.~~png~~		\| image = Primaquine.svg
	\| width = 200px
	\| imagename = 1 : 1 mixture (racemate)		\| imagename = 1 : 1 mixture (racemate)
	\| drug_name = ~~Prilocaine~~		\| drug_name = Primaquine

	<!--Clinical data-->		<!--Clinical data-->
	\| tradename =		\| tradename =
	\| Drugs.com = {{drugs.com\|monograph\|~~prilocaine~~-~~hydrochloride~~}}		\| Drugs.com = {{drugs.com\|monograph\|primaquine-phosphate}}
	\| MedlinePlus = ~~a603026~~		\| MedlinePlus = a607037
	\| pregnancy_category = ~~B <small>(])</small>~~		\| pregnancy_category = ?
	\| ~~legal_status~~ =		\| legal_US = Rx-only
			\| legal_status = Unlicensed (UK)
	\| routes_of_administration =		\| routes_of_administration = Oral

	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
			\| bioavailability = 96%<ref>{{cite journal \| author = Mihaly GW, Ward SA, Edwards G, ''et al.'' \| title = Pharmacokinetics of primaquine in man. I. studies of the absolute bioavailability and effects of dose size \| year = 1985 \| journal = Br J Clin Pharmacol \| volume = 19 \| pages = 745–50 \| pmid = 4027117 \| issue = 6 \| pmc = 1463857}}</ref>
	\| bioavailability =
	\| ~~protein_bound~~ = ~~55%~~		\| metabolism = Liver
			\| elimination_half-life = 6 hours
	\| metabolism = Hepatic and renal
			\| excretion = ?
	\| elimination_half-life = 10-150 minutes, longer with impaired hepatic or renal function

	<!--Identifiers-->		<!--Identifiers-->
	\| CASNo_Ref = {{cascite\|correct\|CAS}}		\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number_Ref = {{cascite\|correct\|??}}		\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| CAS_number = ~~721~~-50-6		\| CAS_number = 90-34-6
	\| ATC_prefix = ~~N01~~		\| ATC_prefix = P01
	\| ATC_suffix = ~~BB04~~		\| ATC_suffix = BA03
		⚫	\| PubChem = 4908
	\| ATC_supplemental =
⚫	\| PubChem = ~~4906~~
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}		\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank = ~~DB00750~~		\| DrugBank = DB01087
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~4737~~		\| ChemSpiderID = 4739
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = ~~046O35D44R~~		\| UNII = MVR3634GX1
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}		\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = ~~D00553~~		\| KEGG = D08420
	\| ChEBI_Ref = {{ebicite\|changed\|EBI}}		\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| ChEBI = ~~8404~~		\| ChEBI = 8405
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = ~~1194~~		\| ChEMBL = 506

	<!--Chemical data-->		<!--Chemical data-->
	\| C=13 \| H=20 \| N=2 \| O=1		\| C=15 \| H=21 \| N=3 \| O=1
	\| molecular_weight = ~~220~~.~~311~~ g/mol		\| molecular_weight = 259.347 g/mol
	\| smiles = O=C(~~Nc1ccccc1C)C~~(~~NCCC~~)C		\| smiles = O(c1cc(NC(C)CCCN)c2ncccc2c1)C
	\| InChI = 1/~~C13H20N2O~~/c1~~-4-9-14~~-11(3)13(16)15-12-8-6-5-7-10(12)2/~~h5-8~~,11,~~14H~~,4,~~9H2~~,~~1-3H3~~,(H,~~15,16)~~		\| InChI = 1/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3
	\| InChIKey = ~~MVFGUOIZUNYYSO~~-~~UHFFFAOYAP~~		\| InChIKey = INDBQLZJXZLFIT-UHFFFAOYAU
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C13H20N2O~~/c1~~-4-9-14~~-11(3)13(16)15-12-8-6-5-7-10(12)2/~~h5-8~~,11,~~14H~~,4,~~9H2~~,~~1-3H3~~,(H,~~15,16)~~		\| StdInChI = 1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~MVFGUOIZUNYYSO~~-UHFFFAOYSA-N		\| StdInChIKey = INDBQLZJXZLFIT-UHFFFAOYSA-N
	}}		}}

Revision as of 14:16, 5 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 463660296 of page Primaquine with values updated to verified values.

Primaquine
Clinical data

AHFS/Drugs.com	Monograph
MedlinePlus	a607037
Pregnancy category	?
Routes of administration	Oral
ATC code	P01BA03 (WHO)
Legal status
Legal status	US: ℞-only Unlicensed (UK)
Pharmacokinetic data
Bioavailability	96%
Metabolism	Liver
Elimination half-life	6 hours
Excretion	?
Identifiers
IUPAC name (RS)-N-(6-methoxyquinolin-8-yl)pentane-1,4-diamine
CAS Number	90-34-6
PubChem CID	4908
DrugBank	DB01087
ChemSpider	4739
UNII	MVR3634GX1
KEGG	D08420
ChEBI	CHEBI:8405
ChEMBL	ChEMBL506
Chemical and physical data
Formula	C₁₅H₂₁N₃O
Molar mass	259.347 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O(c1cc(NC(C)CCCN)c2ncccc2c1)C
InChI InChI=1S/C15H21N3O/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14/h4,6,8-11,18H,3,5,7,16H2,1-2H3 Key:INDBQLZJXZLFIT-UHFFFAOYSA-N
(what is this?) (verify)

Mihaly GW, Ward SA, Edwards G; et al. (1985). "Pharmacokinetics of primaquine in man. I. studies of the absolute bioavailability and effects of dose size". Br J Clin Pharmacol. 19 (6): 745–50. PMC 1463857. PMID 4027117. {{cite journal}}: Explicit use of et al. in: |author= (help)CS1 maint: multiple names: authors list (link)