Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 09:21, 6 December 2011 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464303919 of page Potassium_hydroxide for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 09:22, 6 December 2011 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464303031 of page Sodium_carbonate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
			\| Watchedfields = changed
	\| verifiedrevid = ~~464211940~~		\| verifiedrevid = 458281776
	\| Name = Potassium hydroxide
			\| Name = Sodium carbonate
	\| ImageFile = ~~Potassium~~ ~~hydroxide~~.~~jpg~~		\| ImageFile = Sodium carbonate.png
	\| ImageSize = ~~200px~~		\| ImageSize = 180px
	\| ImageName = pellets of potassium hydroxide
			\| ImageName = Structural formula of sodium carbonate
	\| ImageFile1 = Potassium-hydroxide-xtal-3D-vdW.png
			\| ImageFile1 = Uhličitan sodný.JPG
	\| ImageSize1 = 200px
			\| ImageName1 = Sodium carbonate
	\| ImageName1 = crystal structure of KOH
			\| ImageFile2 = Sodium-carbonate-xtal-3D-SF-C.png
	\| IUPACName = Potassium hydroxide
			\| ImageName2 = Space-filling model of the crystal structure of sodium carbonate
	\| OtherNames = Caustic potash<br/>Potash lye<br/>Potassia<br/>Potassium hydrate
			\| OtherNames = Soda ash<br/>Washing soda<br/>Soda crystals
	\| Section1 = {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
		⚫	\| CASNo = 497-19-8
⚫	\| UNII_Ref = {{fdacite\|correct\|FDA}}
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
⚫	\| UNII = ~~WZH3C48M4T~~
			\| CASOther = <br>5968-11-6 (monohydrate)<br>6132-02-1 (decahydrate)
	\| InChI = 1/K.H2O/h;1H2/q+1;/p-1
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| InChIKey = KWYUFKZDYYNOTN-REWHXWOFAT
			\| ChEMBL = 186314
		⚫	\| PubChem = 10340
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 9916
		⚫	\| RTECS = VZ4050000
		⚫	\| EINECS = 207-838-8\| UNII_Ref = {{fdacite\|correct\|FDA}}
		⚫	\| UNII = 45P3261C7T
			\| InChI = 1/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
			\| InChIKey = CDBYLPFSWZWCQE-NUQVWONBAP
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}		\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ChEBI = ~~32035~~		\| ChEBI = 29377
	\| SMILES = .		\| SMILES = ..C()=O
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/K.~~H2O~~/h;~~1H2~~/q+1;/p-1		\| StdInChI = 1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~KWYUFKZDYYNOTN~~-UHFFFAOYSA-M		\| StdInChIKey = CDBYLPFSWZWCQE-UHFFFAOYSA-L}}
⚫	\| CASNo = ~~1310~~-58-3
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
⚫	\| PubChem = ~~6093213~~
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
⚫	\| ChemSpiderID = ~~14113~~
⚫	\| RTECS = ~~TT2100000~~
	\| UNNumber = 1813
	\| EINECS = 215-181-3
⚫	}}
	\| Section2 = {{Chembox Properties		\| Section2 = {{Chembox Properties
	\| Formula = ~~KOH~~		\| Formula = Na<sub>2</sub>CO<sub>3</sub>
			\| MolarMass = 105.9784 g/mol (anhydrous) <br> 124.00 g/mol (monohydrate) <br> 286.14 g/mol (decahydrate)
	\| MolarMass = 56.1056 g/mol
	\| Appearance = ~~white~~ solid, ]		\| Appearance = White solid, ]
			\| Odor = Odorless
	\| Density = 2.044 g/cm<sup>3</sup><ref name=crc/>
			\| Density = 2.54 g/cm<sup>3</sup> (anhydrous) <br> 2.25 g/cm<sup>3</sup> (monohydrate) <br> 1.46 g/cm<sup>3</sup> (decahydrate)
	\| Solubility = 1210 g/L (25 °C) <br> 1780 g/L (100 °C)<ref name=crc>{{RubberBible86th\|page=4-80}}</ref>
			\| Solubility = 70 g/L (0 °C)<br/>216 g/L (20 °C)<ref name=UNEP>{{cite web\|publisher = UNEP Publications\|url = http://www.chem.unep.ch/irptc/sids/oecdsids/Naco.pdf\|title = Sodium Carbonate}}</ref><br/>450 g/L (100 °C)<ref name="ndctz.com">{{dead link\|date=June 2011}}</ref>
	\| SolubleOther = soluble in ], ] <br> insoluble in ], liquid ]
	\| ~~MeltingPt~~ = ~~406~~ °C<ref name=~~crc~~/>		\| HeatofSolution = 24.7 kJ/mol at 100 mol H<sub>2</sub>O<ref name="ndctz.com"/>
			\| SolubleOther = insoluble in ]
⚫	\| BoilingPt = ~~1327~~ °C~~<ref~~ ~~name=crc/>~~
			\| MeltingPt = 851 °C (anhydrous)<ref name=UNEP>{{cite web\|publisher = UNEP Publications\|url = http://www.chem.unep.ch/irptc/sids/oecdsids/Naco.pdf\|title = Sodium Carbonate}}</ref> <br> 100 °C (decomp, monohydrate) <br> 34 °C (decomp, decahydrate)
	\| pKa = 13.5 (0.1 M)
		⚫	\| BoilingPt = 1633 °C (anhydrous)
	\| RefractIndex = 1.409
			\| pKb = 4.67
⚫	}}
			\| RefractIndex = 1.485 (anhydrous) <br> 1.420 (monohydrate)
		⚫	}}
	\| Section3 = {{Chembox Structure		\| Section3 = {{Chembox Structure
	\| Coordination =		\| Coordination = trigonal planar
			\| Structure = triclinic (anhydrous) <br> orthorhombic (monohydrate)
	\| CrystalStruct =rhombohedral
	}}		}}
	\| Section7 = {{Chembox Hazards		\| Section7 = {{Chembox Hazards
	\| ExternalMSDS =		\| ExternalMSDS =
	\| EUIndex = ~~019~~-~~002~~-00-8		\| EUIndex = 011-005-00-2
	\| EUClass = ~~Corrosive ('''C''')<br/>Harmful~~ ('''Xn''')		\| EUClass = Irritant ('''Xi''')
		⚫	\| NFPA-H = 1
	\| RPhrases = {{R22}}, {{R35}}
		⚫	\| NFPA-F = 0
⚫	\| SPhrases = {{~~S1/2~~}}, {{~~S26~~}}, {{~~S36/37/39}}, {{S45~~}}
	\| NFPA-H = 3		\| NFPA-R = 1
	\| ~~NFPA-F~~ = 0		\| RPhrases = {{R36}}
		⚫	\| SPhrases = {{S2}}, {{S22}}, {{S26}}
⚫	\| NFPA-R = 1
		⚫	\| FlashPt = Non-flammable
⚫	\| NFPA-O =
		⚫	}}
⚫	\| FlashPt = Non-flammable
	\| LD50 = 273 mg/kg
	}}
	\| Section8 = {{Chembox Related		\| Section8 = {{Chembox Related
	\| OtherAnions = ]<br/>]		\| OtherAnions = ]
	\| OtherCations = ]<br/>]<br/>]<br/>]		\| OtherCations = ]<br/>]<br/>]<br/>]
	\| OtherCpds = ]		\| OtherCpds = ]<br/>]<br/>]
	}}		}}
	}}		}}

Revision as of 09:22, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 464303031 of page Sodium_carbonate with values updated to verified values.

Sodium carbonate
Names



Other names Soda ash Washing soda Soda crystals
Identifiers
CAS Number	497-19-8
3D model (JSmol)	Interactive image
ChEBI	CHEBI:29377
ChEMBL	ChEMBL186314
ChemSpider	9916
EC Number	207-838-8
PubChem CID	10340
RTECS number	VZ4050000
UNII	45P3261C7T
InChI InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2Key: CDBYLPFSWZWCQE-NUQVWONBAP
SMILES ..C()=O
Properties
Chemical formula	Na₂CO₃
Molar mass	105.9784 g/mol (anhydrous) 124.00 g/mol (monohydrate) 286.14 g/mol (decahydrate)
Appearance	White solid, hygroscopic
Odor	Odorless
Density	2.54 g/cm (anhydrous) 2.25 g/cm (monohydrate) 1.46 g/cm (decahydrate)
Melting point	851 °C (anhydrous) 100 °C (decomp, monohydrate) 34 °C (decomp, decahydrate)
Boiling point	1633 °C (anhydrous)
Solubility in water	70 g/L (0 °C) 216 g/L (20 °C) 450 g/L (100 °C)
Solubility	insoluble in ethanol
Basicity (pK_b)	4.67
Refractive index (n_D)	1.485 (anhydrous) 1.420 (monohydrate)
Structure
Coordination geometry	trigonal planar
Hazards
NFPA 704 (fire diamond)	1 0 1
Flash point	Non-flammable
Related compounds
Other anions	Sodium bicarbonate
Other cations	Lithium carbonate Potassium carbonate Rubidium carbonate Caesium carbonate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound

^ "Sodium Carbonate" (PDF). UNEP Publications.
^