Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 09:26, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464298351 of page Sodium_fluoride for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit Revision as of 09:26, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464263360 of page Sodium_bicarbonate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| verifiedrevid = 464184701
| Verifiedfields = changed
| ImageFile2 = Sodium bicarbonate.jpg
| verifiedrevid = 458956980
| ImageFile2_Ref = {{Chemboximage|correct|??}}
| Name = Sodium fluoride
| ImageSize2 = 244
| ImageFile = Sodium-fluoride-3D-ionic.png
| ImageName2 = Sample of sodium bicarbonate
<!-- | ImageSize = 150px -->
| ImageFile = SodiumBicarbonate.svg
| ImageName = Sodium fluoride
| ImageFile_Ref = {{Chemboximage|correct|??}}
| IUPACName = Sodium fluoride
| ImageSize = 121
| OtherNames = Florocid
| ImageFileL1 = Sodium-3D.png
| ImageFileL1_Ref = {{Chemboximage|correct|??}}
| ImageSizeL1 = 121
| ImageNameL1 = Ball and stick model of a sodium cation
| ImageFileR1 = Bicarbonate-ion-3D-balls-B.png
| ImageFileR1_Ref = {{Chemboximage|correct|??}}
| ImageSizeR1 = 121
| ImageNameR1 = Ball and stick model of a bicarbonate anion
| IUPACName = Sodium hydrogen carbonate
| SytematicName = <!-- Sodium hydrogen carbonate -->
| OtherNames = Baking soda, bicarbonate of soda, ], sodium bicarbonate, sodium hydrogencarbonate
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = 144-55-8
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 5045
| PubChem = 516892
| PubChem_Ref = {{Pubchemcite|correct|??}}
| ChemSpiderID = 8609
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII = 8MDF5V39QO
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8ZYQ1474W7 | EINECS = 205-633-8
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| InChI = 1/FH.Na/h1H;/q;+1/p-1
| DrugBank = DB01390
| InChIKey = PUZPDOWCWNUUKD-REWHXWOFAH
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C12603
| StdInChIKey = PUZPDOWCWNUUKD-UHFFFAOYSA-M
| MeSHName = Sodium+bicarbonate
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32139
| ChEMBL = 1353
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1528 | RTECS = VZ0950000
| ATCCode_prefix = B05
| CASNo = 7681-49-4
| ATCCode_suffix = CB04
| CASNo_Ref = {{cascite|correct|CAS}}
| ATC_Supplemental = {{ATC|B05|XA02}}
| RTECS = WB0350000
| EINECS = 231-667-8 | Beilstein = 4153970
| SMILES = .OC()=O
| UNNumber = 1690
| StdInChI = 1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28741
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/FH.Na/h1H;/q;+1/p-1 | InChI = 1/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1
| StdInChIKey = UIIMBOGNXHQVGW-UHFFFAOYSA-M
| PubChem = 5235
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ATCCode_prefix=A01
| InChIKey = UIIMBOGNXHQVGW-REWHXWOFAQ}}
| ATCCode_suffix=AA01
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C08142 -->
}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = NaF | C = 1
| H = 1
| MolarMass = 41.988713 g/mol
| Na = 1
| Appearance = White solid
| Odor = odorless | O = 3
| Density = 2.558 g/cm<sup>3</sup> | ExactMass = 83.982338573 g mol<sup>−1</sup>
| Appearance = White crystals
| Solubility = 0.5 M (20 °C)
| Density = 2.20 g cm<sup>−3</sup><ref name="crc84.4-85">"Physical Constants of Inorganic Compounds". ''CRC Handbook'', p. 4-85.</ref>
| SolubleOther = soluble in ] <br> insoluble in ]
| MeltingPt = 993 °C | MeltingPtC = 50
| BoilingPt = 1695 °C | BoilingPtC = 851
| Melting_notes = decomposes
| VaporPressure = 1 mmHg @ 1077 C°<ref>Lewis, R.J. Sax's Dangerous Properties of Industrial Materials. 10th ed. Volumes 1-3 New York, NY: John Wiley & Sons Inc., 1999., p. 3248</ref>
| Solubility = 9 g/100 mL
}}
69 g/L (0 °C)<ref name=crc84.8-116>"Aqueous solubility of inorganic compounds at various temperatures". ''CRC Handbook'', p. 8-116.</ref> <br>
| Section7 = {{Chembox Hazards
96 g/l (20 °C)<ref name=UNEP>{{cite web|publisher = UNEP Publications|url = http://www.chem.unep.ch/irptc/sids/oecdsids/Sodium%20bicarbonate.pdf|title = Sodium Bicarbonate}}</ref> <br>
| ExternalMSDS =
165 g/l (60 °C)<ref name=UNEP/><br>
| EUIndex = 009-004-00-7
236 g/L (100 °C)<ref name=crc84.8-116/>
| EUClass = Toxic ('''T''')<br/>Irritant ('''Xi''')
| LogP = -0.82
| RPhrases = {{R25}}, {{R32}}, {{R36/38}}
| pKa = 10.329<ref name="crc84.7-13">{{cite book|last1=Goldberg|first1=Robert N.|last2=Kishore|first2=Nand|last3=Lennen|first3=Rebecca M.|title=CRC Handbook|pages=7–13|contribution=Thermodynamic quantities for the ionization reactions of buffers in water}}</ref>
| SPhrases = {{S1/2}}, {{S22}}, {{S36}}, {{S45}}
6.351 (carbonic acid)<ref name=crc84.7-13/>
| NFPA-H = 3
| RefractIndex = 1.3344}}
| NFPA-F = 0
| Section3 = {{Chembox Pharmacology
| NFPA-R = 0
| AdminRoutes = Intravenous, oral}}
| FlashPt = Non-flammable
| Section4 = {{Chembox Hazards
| LD50 = 52–200 mg/kg (oral in rats, mice, rabbits)<ref>{{Citation |author=Martel, B.; Cassidy, K. |title=Chemical Risk Analysis: A Practical Handbook |publisher=Butterworth–Heinemann |year=2004 |isbn=1903996651 |page=363}}</ref>
| ExternalMSDS =
}}
| MainHazards = Causes serious eye irritation
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| LD50 = 4.22 g kg<sup>−</sup>}}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| OtherAnions = ]<br/>]<br/>] | OtherAnions = ]
| OtherCations = ]<br/>]<br/>]<br/>] | OtherCations = ]<br />
]
| OtherCpds = ]
| OtherCpds = ]<br />
}}
]}}
}} }}

Revision as of 09:26, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 464263360 of page Sodium_bicarbonate with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Ball and stick model of a sodium cation
Ball and stick model of a sodium cation
Ball and stick model of a bicarbonate anion
Ball and stick model of a bicarbonate anion
Sample of sodium bicarbonate
Names
IUPAC name Sodium hydrogen carbonate
Other names Baking soda, bicarbonate of soda, nahcolite, sodium bicarbonate, sodium hydrogencarbonate
Identifiers
CAS Number
3D model (JSmol)
Beilstein Reference 4153970
ChEBI
ChEMBL
ChemSpider
DrugBank
EC Number
  • 205-633-8
KEGG
MeSH Sodium+bicarbonate
PubChem CID
RTECS number
  • VZ0950000
UNII
InChI
  • InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M
  • InChI=1/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1Key: UIIMBOGNXHQVGW-REWHXWOFAQ
SMILES
  • .OC()=O
Properties
Chemical formula CHNaO3
Molar mass 84.006 g·mol
Appearance White crystals
Density 2.20 g cm
Melting point 50 °C (122 °F; 323 K)
Boiling point 851 °C (1,564 °F; 1,124 K)
Solubility in water 9 g/100 mL

69 g/L (0 °C)
96 g/l (20 °C)
165 g/l (60 °C)
236 g/L (100 °C)

log P -0.82
Acidity (pKa) 10.329

6.351 (carbonic acid)

Refractive index (nD) 1.3344
Pharmacology
Routes of
administration 		Intravenous, oral
Hazards
Occupational safety and health (OHS/OSH):
Main hazards Causes serious eye irritation
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability 0: Will not burn. E.g. waterInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
1 0 0
Lethal dose or concentration (LD, LC):
LD50 (median dose) 4.22 g kg
Related compounds
Other anions Sodium carbonate
Other cations Ammonium bicarbonate

Potassium bicarbonate

Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. "Physical Constants of Inorganic Compounds". CRC Handbook, p. 4-85.
  2. ^ "Aqueous solubility of inorganic compounds at various temperatures". CRC Handbook, p. 8-116.
  3. ^ "Sodium Bicarbonate" (PDF). UNEP Publications.
  4. ^ Goldberg, Robert N.; Kishore, Nand; Lennen, Rebecca M. "Thermodynamic quantities for the ionization reactions of buffers in water". CRC Handbook. pp. 7–13.