Revision as of 14:25, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 461256786 of page Sitagliptin for the Chem/Drugbox validation project (updated: '').← Previous edit | Revision as of 14:25, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{Drugbox | {{Drugbox | ||
| Verifiedfields = changed | | Verifiedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 457292162 | ||
| IUPAC_name = ''N''-{2-phenyl}sulfonyl)amino]benzoyl}glycine | |||
| IUPAC_name = (''R'')-4-oxo-4-triazolopyrazin-7(8''H'')-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine | |||
| image = |
| image = Sivelestat.png | ||
⚫ | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| width = 254 | |||
| ChEMBL = 76688 | |||
| image2 = Sitagliptin 3D.png | |||
<!--Clinical data--> | <!--Clinical data--> | ||
| tradename = | | tradename = | ||
| Drugs.com = {{drugs.com| |
| Drugs.com = {{drugs.com|international|sivelestat}} | ||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| MedlinePlus = a606023 | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| licence_EU = Januvia | |||
| pregnancy_category = | |||
| licence_US = Sitagliptin | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| pregnancy_US = B | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = POM | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
⚫ | | |
||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
⚫ | | routes_of_administration = |
||
⚫ | | legal_status = Rx-only | ||
⚫ | | routes_of_administration = ] | ||
<!--Pharmacokinetic data--> | <!--Pharmacokinetic data--> | ||
| bioavailability = |
| bioavailability = | ||
| protein_bound = |
| protein_bound = | ||
| metabolism = |
| metabolism = | ||
| elimination_half-life = | |||
| elimination_half-life = 8 to 14 h<ref name=Herman>{{cite journal | author = Herman GA | coauthors = Stevens C, Van Dyck K, Bergman A, Yi B, De Smet M, Snyder K, Hilliard D, Tanen M, Tanaka W, Wang AQ, Zeng W, Musson D, Winchell G, Davies MJ, Ramael S, Gottesdiener KM, Wagner JA | title = Pharmacokinetics and pharmacodynamics of sitagliptin, an inhibitor of dipeptidyl peptidase IV, in healthy subjects: results from two randomized, double-blind, placebo-controlled studies with single oral doses | journal = Clin Pharmacol Ther | volume = 78 | issue = 6 | pages = 675–88 | year = 2005 | month = December | pmid = 16338283 | doi = 10.1016/j.clpt.2005.09.002}}</ref> | |||
| excretion = |
| excretion = | ||
<!--Identifiers--> | <!--Identifiers--> | ||
| |
| CAS_number_Ref = {{cascite|changed|??}} | ||
| CAS_number = <!-- blanked - oldvalue: 127373-66-4 --> | |||
⚫ | | |
||
| ATC_prefix = none | |||
| CAS_number = 486460-32-6 | |||
| |
| ATC_suffix = | ||
| ATC_supplemental = | |||
| ATC_suffix = BH01 | |||
| PubChem = |
| PubChem = 107706 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = |
| DrugBank = | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 3571948 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = |
| UNII = DWI62G0P59 | ||
| |
| KEGG_Ref = {{keggcite|correct|kegg}} | ||
| |
| KEGG = D03788 | ||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| |
| ChemSpiderID = 96875 | ||
<!--Chemical data--> | <!--Chemical data--> | ||
| chemical_formula = | |||
| C= |
| C=20 | H=22 | N=2 | O=7 | S=1 | ||
| molecular_weight = |
| molecular_weight = 434.46 g/mol | ||
| smiles = Fc1cc(c(F)cc1F)C(N)CC(=O)N3Cc2nnc(n2CC3)C(F)(F)F | |||
| smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N | ||
}} | }} |
Revision as of 14:25, 6 December 2011
This page contains a copy of the infobox ({{drugbox}}) taken from revid 457293128 of page Sivelestat with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | verifiedrevid = 457292162 | IUPAC_name = N-{2-phenyl}sulfonyl)amino]benzoyl}glycine | image = Sivelestat.png | ChEMBL_Ref = | ChEMBL = 76688
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = IV
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 107706 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = DWI62G0P59 | KEGG_Ref = | KEGG = D03788 | ChemSpiderID_Ref = | ChemSpiderID = 96875
| chemical_formula = | C=20 | H=22 | N=2 | O=7 | S=1 | molecular_weight = 434.46 g/mol | smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O | StdInChI_Ref = | StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) | StdInChIKey_Ref = | StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N }}