Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:25, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 461256786 of page Sitagliptin for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 14:25, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 418851502 | verifiedrevid = 457292162
| IUPAC_name = ''N''-{2-phenyl}sulfonyl)amino]benzoyl}glycine
| IUPAC_name = (''R'')-4-oxo-4-triazolopyrazin-7(8''H'')-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine
| image = Sitagliptin.svg | image = Sivelestat.png
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| width = 254
| ChEMBL = 76688
| image2 = Sitagliptin 3D.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|monograph|januvia}} | Drugs.com = {{drugs.com|international|sivelestat}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| MedlinePlus = a606023
| pregnancy_US = <!-- A / B / C / D / X -->
| licence_EU = Januvia
| pregnancy_category =
| licence_US = Sitagliptin
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| pregnancy_US = B
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = POM
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = Rx-only
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| routes_of_administration = Oral
| legal_status = Rx-only
| routes_of_administration = ]


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 87% | bioavailability =
| protein_bound = 38% | protein_bound =
| metabolism = ] (]- and ]-mediated) | metabolism =
| elimination_half-life =
| elimination_half-life = 8 to 14 h<ref name=Herman>{{cite journal | author = Herman GA | coauthors = Stevens C, Van Dyck K, Bergman A, Yi B, De Smet M, Snyder K, Hilliard D, Tanen M, Tanaka W, Wang AQ, Zeng W, Musson D, Winchell G, Davies MJ, Ramael S, Gottesdiener KM, Wagner JA | title = Pharmacokinetics and pharmacodynamics of sitagliptin, an inhibitor of dipeptidyl peptidase IV, in healthy subjects: results from two randomized, double-blind, placebo-controlled studies with single oral doses | journal = Clin Pharmacol Ther | volume = 78 | issue = 6 | pages = 675–88 | year = 2005 | month = December | pmid = 16338283 | doi = 10.1016/j.clpt.2005.09.002}}</ref>
| excretion = ] (80%)<ref name=Herman/> | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 127373-66-4 -->
| CAS_number_Ref = {{cascite|correct|??}}
| ATC_prefix = none
| CAS_number = 486460-32-6
| ATC_prefix = A10 | ATC_suffix =
| ATC_supplemental =
| ATC_suffix = BH01
| PubChem = 4369359 | PubChem = 107706
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01261 | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3571948
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = QFP0P1DV7Z | UNII = DWI62G0P59
| ChEBI_Ref = {{ebicite|changed|EBI}} | KEGG_Ref = {{keggcite|correct|kegg}}
| ChEBI = 40237 | KEGG = D03788
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChEMBL = 1422 | ChemSpiderID = 96875


<!--Chemical data--> <!--Chemical data-->
| chemical_formula =
| C=16 | H=15 | F=6 | N=5 | O=1 | C=20 | H=22 | N=2 | O=7 | S=1
| molecular_weight = 407.314 ]/] | molecular_weight = 434.46 g/mol
| smiles = Fc1cc(c(F)cc1F)C(N)CC(=O)N3Cc2nnc(n2CC3)C(F)(F)F
| smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H15F6N5O/c17-10-6-12(19)11(18)4-8(10)3-9(23)5-14(28)26-1-2-27-13(7-26)24-25-15(27)16(20,21)22/h4,6,9H,1-3,5,7,23H2/t9-/m1/s1 | StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MFFMDFFZMYYVKS-SECBINFHSA-N | StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N
}} }}

Revision as of 14:25, 6 December 2011

This page contains a copy of the infobox ({{drugbox}}) taken from revid 457293128 of page Sivelestat with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 457292162 | IUPAC_name = N-{2-phenyl}sulfonyl)amino]benzoyl}glycine | image = Sivelestat.png | ChEMBL_Ref = | ChEMBL = 76688

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = IV

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 107706 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = DWI62G0P59 | KEGG_Ref = | KEGG = D03788 | ChemSpiderID_Ref = | ChemSpiderID = 96875

| chemical_formula = | C=20 | H=22 | N=2 | O=7 | S=1 | molecular_weight = 434.46 g/mol | smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O | StdInChI_Ref = | StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) | StdInChIKey_Ref = | StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic