Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:49, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458431466 of page Sodium_perborate for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 15:49, 6 December 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455291382 of page Sodium_percarbonate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 444111288 | verifiedrevid = 433533860
| ImageFile1 = Sodium_percarbonate.svg<!--there is a file sodium percarbonate.png which is incorrect so I changed the file name to prevent it dispalying-->
| ImageFile = perborate dimer.png
| ImageSize = 150px | ImageSize1 = 250px
| ImageFile2 = Sodium-percarbonate-xtal-100K-2003-CM-3D-balls.png
| ImageName = Perborate dimer, peroxide bond shown in red, charges in blue
| IUPACName = | ImageSize2 = 300px
| IUPACName = sodium carbonate—hydrogen peroxide (2/3)
| OtherNames = PBS-1 (mono), PBS-4 (tetra)
| SystematicName =
| OtherNames = PCS, solid hydrogen peroxide, Sodium carbonate hydrogen peroxide, sodium carbonate peroxyhydrate
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4574023 | ChemSpiderID = 13399092
| InChI = 1S/CH2O4.Na/c2-1(3)5-4;/h4H,(H,2,3);/q;+1/p-1
| UNII_Ref = {{fdacite|correct|FDA}}
| InChIKey = MWNQXXOSWHCCOZ-REWHXWOFAO
| UNII = Y52BK1W96C
⚫ | SMILES = .C(=O)OO
| InChI = 1/B2H4O8.2Na/c3-1(4)7-9-2(5,6)10-8-1;;/h3-6H;;/q-2;2*+1
| InChIKey = JBUKJLNBQDQXLI-UHFFFAOYAG
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 30178
⚫ | SMILES = ..O1(OO(O)(O)OO1)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/B2H4O8.2Na/c3-1(4)7-9-2(5,6)10-8-1;;/h3-6H;;/q-2;2*+1 | StdInChI = 1S/CH2O4.Na/c2-1(3)5-4;/h4H,(H,2,3);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JBUKJLNBQDQXLI-UHFFFAOYSA-N | StdInChIKey = MWNQXXOSWHCCOZ-UHFFFAOYSA-M
| InChIKey1 = MWNQXXOSWHCCOZ-UHFFFAOYSA-M
| CASNo = 7632-04-4
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 15630-89-4
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 10332-33-9 | EINECS = 239-707-6
| CASNo1_Comment = (monohydrate) | PubChem = 159762
⚫ | InChI =
| CASNo1_Ref = {{cascite|correct|CAS}}
| CASNo2 = 10486-00-7 | RTECS =
⚫ }}
| CASNo2_Comment = (tetrahydrate)
| CASNo2_Ref = {{cascite|correct|CAS}}
| PubChem = 5460514
| RTECS = SC7350000
| UNNumber = 1479
| EINECS = 231-556-4
⚫ }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = NaBO<sub>3</sub>·nH<sub>2</sub>O | Formula = Na<sub>2</sub>CO<sub>3</sub><nowiki>&middot;</nowiki>1.5H<sub>2</sub>O<sub>2</sub>
| MolarMass = 99.815 g/mol (monohydrate);<br/>153.86 g/mol (tetrahydrate) | MolarMass = 157.01 g/mol
| Appearance = white powders | Appearance = white solid
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = | Solubility = 150 g/l
| SolubleOther =
⚫ }}
| Solvent =
⚫ | Section3 = {{Chembox Hazards
| pKb =
| ExternalMSDS =
⚫ }}
⚫ | MainHazards =
⚫ | Section7 = {{Chembox Hazards
⚫ | NFPA-H = 1
| NFPA-F = 1 | ExternalMSDS =
| NFPA-R = 0 | EUClass =
| EUIndex = Not listed
⚫ | MainHazards = Irritant, Oxidizer
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O = | NFPA-O =
| FlashPt = non-flammable | RPhrases =
| Autoignition = | SPhrases =
| FlashPt = Non-flammable
⚫ }}
| PEL =
⚫ }}
| Section8 = {{Chembox Related
| OtherAnions = ]<br/>]
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = ]<br/>]<br/>]
}}
}} }}

Revision as of 15:49, 6 December 2011

This page contains a copy of the infobox ({{chembox}}) taken from revid 455291382 of page Sodium_percarbonate with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name sodium carbonate—hydrogen peroxide (2/3)
Other names PCS, solid hydrogen peroxide, Sodium carbonate hydrogen peroxide, sodium carbonate peroxyhydrate
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
EC Number
  • 239-707-6
PubChem CID
InChI
  • InChI=1S/CH2O4.Na/c2-1(3)5-4;/h4H,(H,2,3);/q;+1/p-1Key: MWNQXXOSWHCCOZ-UHFFFAOYSA-M
  • Key: MWNQXXOSWHCCOZ-REWHXWOFAO
  • Key: MWNQXXOSWHCCOZ-UHFFFAOYSA-M
SMILES
  • .C(=O)OO
Properties
Chemical formula Na2CO3·1.5H2O2
Molar mass 157.01 g/mol
Appearance white solid
Solubility in water 150 g/l
Hazards
Occupational safety and health (OHS/OSH):
Main hazards Irritant, Oxidizer
Flash point Non-flammable
Related compounds
Other anions Sodium carbonate
Sodium bicarbonate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound