Revision as of 16:18, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469541539 of page Malachite_green for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:19, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469565256 of page Ethyl_methanesulfonate for the Chem/Drugbox validation project (updated: 'KEGG').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 438218601 |
|
|
|
| Watchedfields = changed |
|
| ImageFile =Malachite green structure.svg |
|
|
⚫ |
| verifiedrevid = 415323682 |
⚫ |
| ImageSize = |
|
|
|
| Reference = <ref>'']'', 11th Edition, '''3782'''.</ref> |
|
| ImageFile1 = Malachite green oxalate.jpg |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| IUPACName = 4--''N'',''N''-dimethylaniline |
|
|
|
| ImageFile = Ethyl-mesylate-2D-skeletal.svg |
|
| OtherNames = Aniline green; Basic green 4; Diamond green B; Victoria green B |
|
|
⚫ |
| ImageSize = 180px |
|
|
| ImageName = Skeletal formula |
|
|
| ImageFile1 = Ethyl-mesylate-3D-balls.png |
|
|
| ImageSize1 = |
|
|
| ImageName1 = Ball-and-stick model |
|
|
| IUPACName = 1-Methylsulfonyloxyethane |
|
|
| OtherNames = Ethyl mesylate<br>Ethyl methanesulphonate |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| Abbreviations = EMS |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10820 |
|
| ChemSpiderID = 5887 |
|
|
| InChIKey = PLUBXMRUUVWRLT-UHFFFAOYAM |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 186357 |
|
| ChEMBL = 338686 |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 12058M7ORO |
|
|
| InChI = 1/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
|
|
| InChIKey = FDZZZRQASAIRJF-REWHXWOFAA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
|
| StdInChI = 1S/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FDZZZRQASAIRJF-UHFFFAOYSA-M |
|
| StdInChIKey = PLUBXMRUUVWRLT-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 62-50-0 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 569-64-2 |
|
| EINECS = |
|
| PubChem = 11294 |
|
| PubChem = 6113 |
|
| SMILES = CN(C)c1ccc(cc1)C(=C2C=CC(=(C)C)C=C2)c3ccccc3. |
|
| SMILES = O=S(=O)(OCC)C |
|
|
| InChI = 1/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3 |
|
| ATCvet = yes |
|
|
|
| RTECS = |
⚫ |
| ATCCode_prefix = P53 |
|
|
|
| MeSHName = |
⚫ |
| ATCCode_suffix = AX16 |
|
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
}} |
|
|
|
| ChEBI = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = <!-- blanked - oldvalue: C19239 --> |
|
⚫ |
| ATCCode_prefix = |
|
⚫ |
| ATCCode_suffix = |
|
|
| ATC_Supplemental =}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>23</sub>H<sub>25</sub>ClN<sub>2</sub> (chloride) |
|
| Formula = CH<sub>3</sub>SO<sub>3</sub>C<sub>2</sub>H<sub>5</sub> |
|
| MolarMass = 364.911 g/mol (chloride) |
|
| MolarMass =124.16 g/mol |
|
| Appearance = |
|
| Appearance = Clear colorless liquid |
|
| Density = |
|
| Density = 1.1452 g/cm<sup>3</sup> (22 °C) |
|
| MeltingPt = |
|
| MeltingPt = < 25 °C |
|
| BoilingPt = |
|
| Melting_notes = |
|
|
| BoilingPt = 213–213.5 °C, 486.2-486.7 K |
⚫ |
| Solubility = |
|
|
|
| Boiling_notes = |
|
}} |
|
|
⚫ |
| Solubility = |
⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| SolubleOther = |
|
| FlashPt = |
|
| Solvent = |
|
| Autoignition = |
|
| pKa = |
|
}} |
|
| pKb = }} |
|
⚫ |
| Section7 = {{Chembox Hazards |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 1 |
|
|
| NFPA-R = 0 |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
}} |
|
}} |