Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:18, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469541539 of page Malachite_green for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 16:19, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469565256 of page Ethyl_methanesulfonate for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 438218601
| Watchedfields = changed
| ImageFile =Malachite green structure.svg
| verifiedrevid = 415323682
| ImageSize =
| Reference = <ref>'']'', 11th Edition, '''3782'''.</ref>
| ImageFile1 = Malachite green oxalate.jpg
| ImageFile_Ref = {{chemboximage|correct|??}}
| IUPACName = 4--''N'',''N''-dimethylaniline
| ImageFile = Ethyl-mesylate-2D-skeletal.svg
| OtherNames = Aniline green; Basic green 4; Diamond green B; Victoria green B
| ImageSize = 180px
| ImageName = Skeletal formula
| ImageFile1 = Ethyl-mesylate-3D-balls.png
| ImageSize1 =
| ImageName1 = Ball-and-stick model
| IUPACName = 1-Methylsulfonyloxyethane
| OtherNames = Ethyl mesylate<br>Ethyl methanesulphonate
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations = EMS
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10820 | ChemSpiderID = 5887
| InChIKey = PLUBXMRUUVWRLT-UHFFFAOYAM
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 186357 | ChEMBL = 338686
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 12058M7ORO
| InChI = 1/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1
| InChIKey = FDZZZRQASAIRJF-REWHXWOFAA
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 | StdInChI = 1S/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FDZZZRQASAIRJF-UHFFFAOYSA-M | StdInChIKey = PLUBXMRUUVWRLT-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 62-50-0
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 569-64-2 | EINECS =
| PubChem = 11294 | PubChem = 6113
| SMILES = CN(C)c1ccc(cc1)C(=C2C=CC(=(C)C)C=C2)c3ccccc3. | SMILES = O=S(=O)(OCC)C
| InChI = 1/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3
| ATCvet = yes
| RTECS =
| ATCCode_prefix = P53
| MeSHName =
| ATCCode_suffix = AX16
| ChEBI_Ref = {{ebicite|correct|EBI}}
}}
| ChEBI =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C19239 -->
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>23</sub>H<sub>25</sub>ClN<sub>2</sub> (chloride) | Formula = CH<sub>3</sub>SO<sub>3</sub>C<sub>2</sub>H<sub>5</sub>
| MolarMass = 364.911 g/mol (chloride) | MolarMass =124.16 g/mol
| Appearance = | Appearance = Clear colorless liquid
| Density = | Density = 1.1452 g/cm<sup>3</sup> (22 °C)
| MeltingPt = | MeltingPt = < 25 °C
| BoilingPt = | Melting_notes =
| BoilingPt = 213–213.5 °C, 486.2-486.7 K
| Solubility =
| Boiling_notes =
}}
| Solubility =
| Section3 = {{Chembox Hazards
| MainHazards = | SolubleOther =
| FlashPt = | Solvent =
| Autoignition = | pKa =
}} | pKb = }}
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL = }}
}} }}

Revision as of 16:19, 9 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 469565256 of page Ethyl_methanesulfonate with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Skeletal formula
Ball-and-stick model
Names
IUPAC name 1-Methylsulfonyloxyethane
Other names Ethyl mesylate
Ethyl methanesulphonate
Identifiers
CAS Number
3D model (JSmol)
Abbreviations EMS
ChEMBL
ChemSpider
PubChem CID
InChI
  • InChI=1S/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N
  • InChI=1/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3Key: PLUBXMRUUVWRLT-UHFFFAOYAM
SMILES
  • O=S(=O)(OCC)C
Properties
Chemical formula CH3SO3C2H5
Molar mass 124.16 g/mol
Appearance Clear colorless liquid
Density 1.1452 g/cm (22 °C)
Melting point < 25 °C
Boiling point 213–213.5 °C, 486.2-486.7 K
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability 1: Must be pre-heated before ignition can occur. Flash point over 93 °C (200 °F). E.g. canola oilInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
1 1 0
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Merck Index, 11th Edition, 3782.