Revision as of 16:24, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469888543 of page CHAPS_detergent for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey').← Previous edit |
Revision as of 16:24, 9 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469941559 of page Cyclic_adenosine_monophosphate for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 443545451 |
|
| Verifiedfields = changed |
|
|
|
| ImageFileL1 = Cyclic-adenosine-monophosphate-2D-skeletal.png |
⚫ |
| verifiedrevid = 459989405 |
|
|
|
| ImageSizeL1 = 150 px |
|
| ImageFile = CHAPS.png |
|
|
|
| ImageFileR1 = Cyclic-adenosine-monophosphate-3D-balls.png |
|
| ImageName = Structural formula of CHAPS detergent |
|
|
|
| ImageSizeR1 = 150 px |
|
| PIN = 3--1-<br /> |
|
|
|
| IUPACName = |
|
propanesulfonate |
|
|
|
| OtherNames = |
|
| SystematicName = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> |
|
|
dimethyltetracyclo<br /> |
|
|
heptadecan-14-yl}pentanamido)propyl]<br /> |
|
|
azaniumyl}propane-1-sulfonate |
|
|
| OtherNames = 3-{Dimethyl[3-(4-{5,9,16-trihydroxy-2,15-<br /> |
|
|
dimethyltetracyclo<br /> |
|
|
heptadecan-14-yl}pentanamido)propyl]aminio}<br /> |
|
|
propane-1-sulfonate |
|
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| Abbreviations = CHAPS |
|
|
| InChI = 1/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 |
|
|
| InChIKey = UMCMPZBLKLEWAF-BCTGSCMUBQ |
|
|
| SMILES1 = S(=O)(=O)CCC(C)(C)CCCNC(=O)CC(C)4CC32(1((C(O)CC1)C2O)C)C(O)34C |
|
|
| InChI1 = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 |
|
|
| InChIKey1 = UMCMPZBLKLEWAF-BCTGSCMUSA-N |
|
⚫ |
| CASNo = 75621-03-3 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 450950 |
|
⚫ |
| PubChem = 107670 |
|
|
| PubChem_Ref = {{Pubchemcite}} |
|
|
| PubChem1 = 24883538 |
|
|
| PubChem1_Comment = (),(5''R'',7''S'',<br /> |
|
|
16''S'') |
|
|
| PubChem1_Ref = {{Pubchemcite}} |
|
|
| PubChem2 = 10371606 |
|
|
| PubChem2_Comment = (),(1''S'',5''R'',11''S'',<br /> |
|
|
16''S'') |
|
|
| PubChem2_Ref = {{Pubchemcite}} |
|
|
| PubChem3 = 25244640 |
|
|
| PubChem3_Comment = (4''R''),(2''S'',5''R'',7''S'',<br /> |
|
|
15''R'',16''S'') |
|
|
| PubChem3_Ref = {{Pubchemcite}} |
|
|
| PubChem4 = 18397788 |
|
|
| PubChem4_Comment = (4''R''),(2''S'',5''R'',<br /> |
|
|
14''R'',15''R'',16''S'') |
|
|
| PubChem4_Ref = {{Pubchemcite}} |
|
|
| PubChem5 = 9895216 |
|
|
| PubChem5_Comment = (4''S''),<br /> |
|
|
(2''S'',5''R'',14''R'',15''S'',16''S'') |
|
|
| PubChem5_Ref = {{Pubchemcite}} |
|
⚫ |
| ChemSpiderID = 96843 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 5851 |
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
⚫ |
| KEGG = C11321 |
|
|
⚫ |
| ChEMBL = 316966 |
|
| MeSHName = 3-((3-Cholamidopropyl)dimethylammonium)-1-propanesulfonate |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| SMILES = CC(CCC(=O)NCCC(C)(C)CCCS()(=O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
|
|
|
| UNII = E0399OZS9N |
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C32H58N2O7S/c1-21(8-11-29(38)33-14-6-15-34(4,5)16-7-17-42(39,40)41)24-9-10-25-30-26(20-28(37)32(24,25)3)31(2)13-12-23(35)18-22(31)19-27(30)36/h21-28,30,35-37H,6-20H2,1-5H3,(H-,33,38,39,40,41)/t21-,22+,23-,24-,25+,26+,27-,28+,30+,31+,32-/m1/s1 |
|
| InChI = 1/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
|
|
| InChIKey = IVOMOUWHDPKRLL-KQYNXXCUBU |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
⚫ |
| StdInChIKey = UMCMPZBLKLEWAF-BCTGSCMUSA-N |
|
|
|
| StdInChI = 1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
⚫ |
}} |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = IVOMOUWHDPKRLL-KQYNXXCUSA-N |
|
⚫ |
| CASNo = 60-92-4 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| PubChem = 6076 |
|
|
| IUPHAR_ligand = 2352 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB02527 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 17489 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = C00575 |
|
|
| SMILES = c1nc(c2c(n1)n(cn2)3(4(O3)COP(=O)(O4)O)O)N |
|
|
| MeSHName = Cyclic+AMP |
|
⚫ |
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>10</sub>H<sub>12</sub>N<sub>5</sub>O<sub>6</sub>P |
|
| C=32|H=58|N=2|O=7|S=1 |
|
|
|
| MolarMass = 329.206 |
|
| LogP = -4.32 (predicted)}} |
|
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| Solubility = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |