Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 16:25, 9 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469946588 of page Phosphoribosyl_pyrophosphate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit		Revision as of 16:25, 9 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 469972953 of page Beryllium_iodide for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Chembox~~		{{chembox
	\| verifiedrevid = ~~444051569~~		\| verifiedrevid = 450710878
			\| ImageFile = Beryllium iodide.svg
	\| ImageFile_Ref = {{chemboximage\|correct\|??}}
			\| ImageSize = 250px
	\| ImageFile=Phosphoribosyl pyrophosphate.svg
			\| IUPACName =
	\|ImageSize=
			\| SystematicName = Beryllium iodide
	\|IUPACName=
	\|OtherNames=		\| OtherNames =
	\|Section1= {{Chembox Identifiers		\| Section1 = {{Chembox Identifiers
			\| Abbreviations =
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = 7062
			\| ChemSpiderID = 74209
	\| InChI = 1/C5H13O14P3/c6-3-2(1-16-20(8,9)10)17-5(4(3)7)18-22(14,15)19-21(11,12)13/h2-7H,1H2,(H,14,15)(H2,8,9,10)(H2,11,12,13)/t2-,3-,4-,5-/m1/s1
	\| InChIKey = ~~PQGCEDQWHSBAJP~~-~~TXICZTDVBW~~		\| InChIKey = JUCWKFHIHJQTFR-NUQVWONBAT
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/Be.2HI/h;2*1H/q+2;;/p-2
	\| StdInChI = 1S/C5H13O14P3/c6-3-2(1-16-20(8,9)10)17-5(4(3)7)18-22(14,15)19-21(11,12)13/h2-7H,1H2,(H,14,15)(H2,8,9,10)(H2,11,12,13)/t2-,3-,4-,5-/m1/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~PQGCEDQWHSBAJP~~-~~TXICZTDVSA~~-N		\| StdInChIKey = JUCWKFHIHJQTFR-UHFFFAOYSA-L
	\| CASNo_Ref = {{cascite\|correct\|??}}		\| CASNo_Ref = {{cascite\|correct\|??}}
	\| CASNo = <!-- blanked - oldvalue: ~~7540~~-64-9 -->		\| CASNo = <!-- blanked - oldvalue: 7787-53-3 -->
			\| EINECS =
	\| PubChem=7339
			\| EINECSCASNO =
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| ~~DrugBank~~ = ~~DB01632~~		\| PubChem = 82231
			\| SMILES = ..
			\| InChI = 1/Be.2HI/h;2*1H/q+2;;/p-2
			\| RTECS =
			\| MeSHName =
	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}		\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| ChEBI = ~~17111~~		\| ChEBI =
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| SMILES = O=P(O1O((O)1O)COP(=O)(O)O)(O)OP(=O)(O)O
			\| KEGG =
	\| MeSHName=Phosphoribosyl+pyrophosphate
			\| ATCCode_prefix =
	}}
			\| ATCCode_suffix =
	\|Section2= {{Chembox Properties
			\| ATC_Supplemental =}}
	\| Formula=C<sub>5</sub>H<sub>13</sub>O<sub>14</sub>P<sub>3</sub>
			\| Section2 = {{Chembox Properties
	\| MolarMass=390.07 g/mol
			\| Formula = ]]
	\| Appearance=
			\| MolarMass = 262.821 g/mol
	\| Density=
			\| Appearance = colorless needle-like crystals
	\| MeltingPt=
			\| Density = 4.325 g/cm³
	\| BoilingPt=
			\| MeltingPt = 480°C
	\| Solubility=
			\| Melting_notes =
	}}
			\| BoilingPt = 590°C<ref name="hand">
	\|Section3= {{Chembox Hazards
			{{Citation
	\| MainHazards=
			\| last = Perry
	\| FlashPt=
			\| first =Dale L.
	\| Autoignition=
			\| author-link =
	}}
			\| last2 =Phillips
			\| first2 =Sidney L.
			\| author2-link =
			\| publication-date =
			\| date =
			\| year =1995
			\| title =Handbook of Inorganic Compounds
			\| edition =
			\| volume =
			\| series =
			\| publication-place =
			\| place =
			\| publisher =CRC Press
			\| pages =63
			\| isbn =0-8493-8671-3
			\| doi =
			\| oclc =
			\| url= http://books.google.com/?id=0fT4wfhF1AsC&printsec=frontcover&dq=%22beryllium+iodide%22+properties
			\| accessdate = 2007-12-10
			}}</ref>
			\| Boiling_notes =
			\| Solubility = Reacts violently with ]<ref name="hand"/>
			\| SolubleOther = Slightly soluble in ]<br> Soluble in ]<ref name="lit">
			{{Citation
			\| last = Parsons
			\| first =Charles Lathrop
			\| author-link =
			\| last2 =
			\| first2 =
			\| author2-link =
			\| publication-date =
			\| date =
			\| year =1909
			\| title =The Chemistry and Literature of Beryllium
			\| edition =
			\| volume =
			\| series =
			\| publication-place =
			\| place =Easton, Pa.
			\| publisher =Chemical Publishing
			\| pages =22–23
			\| isbn =
			\| doi =
			\| oclc =
			\| url =http://books.google.com/?id=7MxAAAAAIAAJ&pg=PA21&dq=%22beryllium+iodide%22
			\| accessdate = 2007-12-10
			}}
			</ref>
			\| Solvent =
			\| LogP =
			\| VaporPressure =
			\| HenryConstant =
			\| AtmosphericOHRateConstant =
			\| pKa =
			\| pKb = }}
			\| Section3 = {{Chembox Structure
			\| CrystalStruct =
			\| Coordination =
			\| MolShape = }}
			\| Section4 = {{Chembox Thermochemistry
			\| DeltaHf = -0.7324 kJ/g
			\| DeltaHc =
			\| Entropy =
			\| HeatCapacity = 0.2705 J/K
			}}
			\| Section5 = {{Chembox Pharmacology
			\| AdminRoutes =
			\| Bioavail =
			\| Metabolism =
			\| HalfLife =
			\| ProteinBound =
			\| Excretion =
			\| Legal_status =
			\| Legal_US =
			\| Legal_UK =
			\| Legal_AU =
			\| Legal_CA =
			\| PregCat =
			\| PregCat_AU =
			\| PregCat_US = }}
			\| Section6 = {{Chembox Explosive
			\| ShockSens =
			\| FrictionSens =
			\| ExplosiveV =
			\| REFactor = }}
			\| Section7 = {{Chembox Hazards
			\| EUClass =
			\| EUIndex =
			\| MainHazards = ''see ]''
			\| NFPA-H =
			\| NFPA-F =
			\| NFPA-R =
			\| NFPA-O =
			\| RPhrases =
			\| SPhrases =
			\| RSPhrases =
			\| FlashPt =
			\| Autoignition =
			\| ExploLimits =
			\| LD50 =
			\| PEL = }}
			\| Section8 = {{Chembox Related
			\| OtherAnions = ]<br>]<br>]
			\| OtherCations = ]<br/>]<br/>]<br/>]
			\| OtherFunctn =
			\| Function =
			\| OtherCpds = }}
	}}		}}

Revision as of 16:25, 9 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 469972953 of page Beryllium_iodide with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names

Systematic IUPAC name Beryllium iodide
Identifiers
3D model (JSmol)	Interactive image
ChemSpider	74209
PubChem CID	82231
InChI InChI=1S/Be.2HI/h;21H/q+2;;/p-2Key: JUCWKFHIHJQTFR-UHFFFAOYSA-L InChI=1/Be.2HI/h;21H/q+2;;/p-2Key: JUCWKFHIHJQTFR-NUQVWONBAT
SMILES ..
Properties
Chemical formula	Be I₂
Molar mass	262.821 g/mol
Appearance	colorless needle-like crystals
Density	4.325 g/cm³
Melting point	480°C
Boiling point	590°C
Solubility in water	Reacts violently with water
Solubility	Slightly soluble in CS₂ Soluble in ethanol
Thermochemistry
Heat capacity (C)	0.2705 J/K
Std enthalpy of formation (Δ_fH₂₉₈)	-0.7324 kJ/g
Hazards
Occupational safety and health (OHS/OSH):
Main hazards	see Berylliosis
Related compounds
Other anions	Beryllium fluoride Beryllium chloride Beryllium bromide
Other cations	magnesium iodide calcium iodide strontium iodide barium iodide
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Tracking categories (test):

SizeSet

Chemical compound

^ Perry, Dale L.; Phillips, Sidney L. (1995), Handbook of Inorganic Compounds, CRC Press, p. 63, ISBN 0-8493-8671-3, retrieved 2007-12-10
Parsons, Charles Lathrop (1909), The Chemistry and Literature of Beryllium, Easton, Pa.: Chemical Publishing, pp. 22–23, retrieved 2007-12-10