| Revision as of 12:43, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 466516259 of page Tetralin for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 12:43, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{drugbox}} taken from revid 470102073 of page Tetralinylaminopropane for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| verifiedrevid = 444220230 |
|
| verifiedrevid = 451350040 |
|
|
| IUPAC_name = <small>1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-2-amine</small><br />or<br /><small>1-(6-tetralinyl)propan-2-amine</small> |
|
| Name = Tetralin |
|
|
|
| image = Tetralinylaminopropane.png |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
|
|
| ImageFile = Tetralin.svg |
|
|
|
<!--Clinical data--> |
|
| ImageSize = 160px |
|
|
|
| tradename = |
|
| ImageAlt = Skeletal formula |
|
|
|
| pregnancy_category = |
|
| ImageFile1 = Tetralin-3D-balls.png |
|
|
|
| legal_status = Uncontrolled <small>(but may be covered under the ] in the ] and under similar bills in other countries)</small> |
|
| ImageSize1 = 170px |
|
|
|
| routes_of_administration = ] |
|
| ImageAlt1 = Ball-and-stick model |
|
|
|
|
|
| IUPACName = 1,2,3,4-tetrahydronaphthalene |
|
|
|
<!--Pharmacokinetic data--> |
|
| OtherNames = naphthalene 1,2,3,4-tetrahydride<br />Bacticin<br />benzocyclohexane<br />THN |
|
|
|
| bioavailability = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| metabolism = |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
|
| elimination_half-life = |
|
| ChEBI = 35008 |
|
|
|
| excretion = |
|
| SMILES = c1ccc2c(c1)CCCC2 |
|
|
|
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
<!--Identifiers--> |
| ⚫ |
| ChemSpiderID = 8097 |
|
|
|
| CAS_number = <!-- blanked - oldvalue: ? --> |
|
| PubChem = 8404 |
|
|
|
| ATC_prefix = none |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| ATC_suffix = |
|
| UNII = FT6XMI58YQ |
|
|
|
| ChEMBL = 331488 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C14114 |
|
| PubChem = 14964398 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChI = 1/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2,5-6H,3-4,7-8H2 |
|
|
⚫ |
| ChemSpiderID = 23204045 |
|
| InChIKey = CXWXQJXEFPUFDZ-UHFFFAOYAG |
|
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=13 | H=19 | N=1 |
|
|
| molecular_weight = 189.30 g/mol |
|
|
| smiles = CC(CC1=CC2=C(CCCC2)C=C1)N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H12/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2,5-6H,3-4,7-8H2 |
|
| StdInChI = 1S/C13H19N/c1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11/h6-7,9-10H,2-5,8,14H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CXWXQJXEFPUFDZ-UHFFFAOYSA-N |
|
| StdInChIKey = UTVKUFYOPJCDPE-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 119-64-2 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| C=10|H=12 |
|
|
| Appearance = Clear, colorless liquid |
|
|
| Density = 0.970 g/cm³ |
|
|
| Solubility = Insoluble |
|
|
| MeltingPtC = -35.8 |
|
|
| BoilingPtCL = 206 |
|
|
| BoilingPtCH = 208 |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| FlashPt = 77 °C |
|
|
| Autoignition = 385 °C |
|
|
}} |
|
|
}} |
|
}} |
