Revision as of 13:00, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{chembox}} taken from revid 455772276 of page Thioacetamide for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit | Revision as of 13:00, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,054 edits Saving copy of the {{drugbox}} taken from revid 447556549 of page Thioacetazone for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{Drugbox | ||
⚫ | | verifiedrevid = 443222189 | ||
| Verifiedfields = changed | |||
| IUPAC_name = ''N''-{4-phenyl}acetamide | |||
⚫ | | verifiedrevid = |
||
| image = Thioacetazone.svg | |||
| Name = Thioacetamide | |||
| ImageFile = TA.png | |||
<!--Clinical data--> | |||
| ImageSize = 140px | |||
| tradename = | |||
| ImageName = Structural formula | |||
| Drugs.com = {{drugs.com|international|thioacetazone}} | |||
| ImageFile1 = Thioacetamide-3D-balls.png | |||
| routes_of_administration = Oral | |||
| ImageSize1 = 170px | |||
| ImageName1 = Ball-and-stick model | |||
<!--Identifiers--> | |||
| PIN = Ethanethioamide | |||
⚫ | | CAS_number = <!-- blanked - oldvalue: 104-06-3 --> | ||
| IUPACName = Thioacetamide | |||
| ATC_prefix = J04 | |||
| OtherNames = acetothioamide, TAA, thioacetimidic acid, TA | |||
| ATC_suffix = AM04 | |||
| Section1 = {{Chembox Identifiers | |||
⚫ | | ChEMBL = 375492 | ||
| UNII_Ref = {{fdacite|changed|FDA}} | |||
| |
| PubChem = 9568512 | ||
| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChEBI = 32497 | |||
| |
| ChemSpiderID = 7843221 | ||
| |
| UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = MMG78X7SSR | |||
| ChemSpiderID = 2006126 | |||
⚫ | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| PubChem = 2723949 | |||
| KEGG = D08584 | |||
| InChI = 1/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) | |||
| InChIKey = YUKQRDCYNOVPGJ-UHFFFAOYAD | |||
<!--Chemical data--> | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| C=10 | H=12 | N=4 | O=1 | S=1 | |||
⚫ | | ChEMBL = |
||
| molecular_weight = 236.3 | |||
| smiles = O=C(Nc1ccc(cc1)\C=N\NC(=S)N)C | |||
| InChI = 1/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | |||
| InChIKey = SRVJKTDHMYAMHA-WUXMJOGZBW | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = SRVJKTDHMYAMHA-WUXMJOGZSA-N | ||
| synonyms = <small>''N''-phenyl]acetamide</small> | |||
| CASNo = 62-55-5 | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| RTECS = AC8925000 | |||
⚫ | | KEGG_Ref = {{keggcite| |
||
⚫ | | |
||
}} | |||
| Section2 = {{Chembox Properties | |||
| Formula = C<sub>2</sub>H<sub>5</sub>NS | |||
| MolarMass = 75.13 g/mol | |||
| Appearance = colourless crystals, slight ] odor | |||
| Density = 1.269 g/cm³<!--from X-ray structure --> | |||
| Solubility = good, with hydrolysis | |||
| MeltingPt = 115 °C | |||
| BoilingPt = decomp. | |||
}} | |||
| Section3 = {{Chembox Structure | |||
| CrystalStruct = ] | |||
| Dipole = | |||
}} | |||
| Section7 = {{Chembox Hazards | |||
| ExternalMSDS = | |||
| MainHazards = stench | |||
| FlashPt = ?°C | |||
| RPhrases = R22 R36 R37 R45 | |||
| SPhrases = S45 S53 | |||
}} | |||
| Section8 = {{Chembox Related | |||
| OtherCpds = ], dithioacetic acid | |||
}} | |||
}} | }} |
Revision as of 13:00, 10 January 2012
This page contains a copy of the infobox ({{drugbox}}) taken from revid 447556549 of page Thioacetazone with values updated to verified values. |
{{Drugbox | verifiedrevid = 443222189 | IUPAC_name = N-{4-phenyl}acetamide | image = Thioacetazone.svg
| tradename = | Drugs.com = International Drug Names | routes_of_administration = Oral
| CAS_number = | ATC_prefix = J04 | ATC_suffix = AM04 | ChEMBL = 375492 | PubChem = 9568512 | DrugBank_Ref = | ChemSpiderID_Ref = | ChemSpiderID = 7843221 | UNII_Ref = | UNII = MMG78X7SSR | KEGG_Ref = | KEGG = D08584
| C=10 | H=12 | N=4 | O=1 | S=1 | molecular_weight = 236.3 | smiles = O=C(Nc1ccc(cc1)\C=N\NC(=S)N)C | InChI = 1/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | InChIKey = SRVJKTDHMYAMHA-WUXMJOGZBW | StdInChI_Ref = | StdInChI = 1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ | StdInChIKey_Ref = | StdInChIKey = SRVJKTDHMYAMHA-WUXMJOGZSA-N | synonyms = N-phenyl]acetamide }}