Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 13:40, 10 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459240436 of page Tocopheryl_acetate for the Chem/Drugbox validation project (updated: '').← Previous edit		Revision as of 13:41, 10 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447451603 of page Tolazamide for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~chembox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~chembox~~		{{Drugbox
	\| verifiedrevid = ~~419011964~~		\| verifiedrevid = 408966679
			\| IUPAC_name = ''N''--4-methylbenzenesulfonamide
	\| ImageFile1 = Tocopheryl acetate.png
			\| image = Tolazamide.svg
	\| ImageSize1 = 200px

	\| ImageFile2= Tocopheryl_acetate_3d_structure.png
			<!--Clinical data-->
	\| ImageSize2 = 200px
			\| tradename =
	\| IUPACName = chroman-6-yl] acetate
			\| Drugs.com = {{drugs.com\|monograph\|tolazamide}}
	\| OtherNames = Tocopherol acetate <br>Vitamin E acetate
			\| MedlinePlus = a682482
	\| Section1 = {{Chembox Identifiers
			\| licence_US = Tolazamide
⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ~~ChemSpiderID~~ = ~~77987~~		\| pregnancy_AU = C
			\| pregnancy_US = C
			\| legal_US = Rx-only
			\| routes_of_administration = Oral

			<!--Pharmacokinetic data-->
			\| bioavailability = ?
			\| metabolism = ?
			\| elimination_half-life = 7 hours
			\| excretion = ] (85%) and fecal (7%)

			<!--Identifiers-->
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CAS_number = 1156-19-0
			\| ATC_prefix = A10
			\| ATC_suffix = BB05
		⚫	\| PubChem = 5503
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
			\| DrugBank = DB00839
		⚫	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
			\| ChemSpiderID = 5302
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = ~~A7E6112E4N~~		\| UNII = 9LT1BRO48Q
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| InChI = 1/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1
			\| KEGG = D00379
	\| InChIKey = ZAKOWWREFLAJOT-CEFNRUSXBQ
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}		\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ChEMBL = ~~1047~~		\| ChEMBL = 817

			<!--Chemical data-->
			\| C=14 \| H=21 \| N=3 \| O=3 \| S=1
			\| molecular_weight = 311.401 ]/]
			\| smiles = O=S(=O)(c1ccc(cc1)C)NC(=O)NN2CCCCCC2
			\| InChI = 1/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18)
			\| InChIKey = OUDSBRTVNLOZBN-UHFFFAOYAL
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C31H52O3~~/c1-~~21(2)13~~-10-14-22(~~3)15~~-11-16-23(4)17-12-19-~~31(9)20~~-18-28-~~26(7)29(33~~-~~27(8)32)24(5)25(6)30(28)34-31~~/~~h21~~-~~23H~~,10-~~20H2~~,~~1-9H3/t22~~-,~~23-~~,~~31-/m1/s1~~		\| StdInChI = 1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18)
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~ZAKOWWREFLAJOT~~-~~CEFNRUSXSA~~-N		\| StdInChIKey = OUDSBRTVNLOZBN-UHFFFAOYSA-N
	\| CASNo = 58-95-7
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
⚫	\| PubChem = ~~86472~~
	\| SMILES = O=C(Oc2c(c(c1O(CCc1c2C)(C)CCC(C)CCC(C)CCCC(C)C)C)C)C
	}}
	\| Section2 = {{Chembox Properties
	\| Formula = C<sub>31</sub>H<sub>52</sub>O<sub>3</sub>
	\| MolarMass = 472.743 g/mol
	\| Appearance =
	\| Density =
	\| MeltingPt =
	\| BoilingPt =
	\| Solubility =
	}}
	\| Section3 = {{Chembox Hazards
	\| MainHazards =
	\| FlashPt =
	\| Autoignition =
	}}
	}}		}}

Revision as of 13:41, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 447451603 of page Tolazamide with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data

AHFS/Drugs.com	Monograph
MedlinePlus	a682482
License data	US FDA: Tolazamide
Pregnancy category	AU: C
Routes of administration	Oral
ATC code	A10BB05 (WHO)
Legal status
Legal status	US: ℞-only
Pharmacokinetic data
Bioavailability	?
Metabolism	?
Elimination half-life	7 hours
Excretion	Renal (85%) and fecal (7%)
Identifiers
IUPAC name N--4-methylbenzenesulfonamide
CAS Number	1156-19-0
PubChem CID	5503
DrugBank	DB00839
ChemSpider	5302
UNII	9LT1BRO48Q
KEGG	D00379
ChEMBL	ChEMBL817
Chemical and physical data
Formula	C₁₄H₂₁N₃O₃S
Molar mass	311.401 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES O=S(=O)(c1ccc(cc1)C)NC(=O)NN2CCCCCC2
InChI InChI=1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18) Key:OUDSBRTVNLOZBN-UHFFFAOYSA-N
(verify)