Revision as of 13:41, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447451603 of page Tolazamide for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 13:41, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457229522 of page Tolazoline for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 408966679 |
|
| verifiedrevid = 415670568 |
|
| IUPAC_name = ''N''--4-methylbenzenesulfonamide |
|
|
|
| IUPAC_name = 2-benzyl-4,5-dihydro-1''H''-imidazole |
|
| image = Tolazamide.svg |
|
| image = Tolazoline.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|monograph|tolazamide}} |
|
| Drugs.com = {{drugs.com|international|tolazoline}} |
|
|
| pregnancy_category = |
|
| MedlinePlus = a682482 |
|
|
|
| legal_status = |
|
| licence_US = Tolazamide |
|
|
⚫ |
| routes_of_administration = IV |
|
| pregnancy_AU = C |
|
|
| pregnancy_US = C |
|
|
| legal_US = Rx-only |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = ? |
|
| bioavailability = |
|
| metabolism = ? |
|
| protein_bound = |
|
|
| metabolism = |
|
| elimination_half-life = 7 hours |
|
| elimination_half-life = |
|
| excretion = ] (85%) and fecal (7%) |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 1156-19-0 |
|
|
| ATC_prefix = A10 |
|
| CAS_number = 59-98-3 |
|
| ATC_suffix = BB05 |
|
| ATC_prefix = C04 |
|
| PubChem = 5503 |
|
| ATC_suffix = AB02 |
|
|
| ATC_supplemental = {{ATC|M02|AX02}} {{ATCvet|V03|AB94}} |
|
|
| PubChem = 5504 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00839 |
|
| DrugBank = DB00797 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5302 |
|
| ChemSpiderID = 5303 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 9LT1BRO48Q |
|
| UNII = CHH9H12AQ3 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00379 |
|
| KEGG = D08614 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 28502 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 817 |
|
| ChEMBL = 770 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=14 | H=21 | N=3 | O=3 | S=1 |
|
| C=10 | H=12 | N=2 |
|
| molecular_weight = 311.401 ]/] |
|
| molecular_weight = 160.216 g/mol |
|
| smiles = O=S(=O)(c1ccc(cc1)C)NC(=O)NN2CCCCCC2 |
|
| smiles = N\1=C(\NCC/1)Cc2ccccc2 |
|
| InChI = 1/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18) |
|
| InChI = 1/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
|
| InChIKey = OUDSBRTVNLOZBN-UHFFFAOYAL |
|
| InChIKey = JIVZKJJQOZQXQB-UHFFFAOYAZ |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H21N3O3S/c1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/h6-9H,2-5,10-11H2,1H3,(H2,15,16,18) |
|
| StdInChI = 1S/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = OUDSBRTVNLOZBN-UHFFFAOYSA-N |
|
| StdInChIKey = JIVZKJJQOZQXQB-UHFFFAOYSA-N |
|
}} |
|
}} |