Revision as of 14:05, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459416960 of page Triethylenetetramine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:06, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457351458 of page Trifluoperazine for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
⚫ |
{{drugbox | Verifiedfields = changed |
|
{{chembox |
|
|
⚫ |
| verifiedrevid = 416496872 |
⚫ |
| Verifiedfields = changed |
|
|
|
| IUPAC_name = 10--<br/>2-(trifluoromethyl)-10''H''-phenothiazine |
⚫ |
| verifiedrevid = 410157990 |
|
|
|
| image = Trifluoperazine.svg |
|
|ImageFile=Triethylene tetramine.png |
|
|
|
| width = 185 |
|
|ImageSize=200px |
|
|
|
|
|
|ImageName=Chemical structure of triethylenetetramine |
|
|
|
<!--Clinical data--> |
|
|IUPACName=''N'',''N'''-bis(2-aminoethyl)ethane-1,2-diamine |
|
|
|
| Drugs.com = {{drugs.com|monograph|trifluoperazine-hydrochloride}} |
|
|OtherNames=Trientine |
|
|
|
| MedlinePlus = a682121 |
|
|Section1= {{Chembox Identifiers |
|
|
|
| pregnancy_AU = C |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| pregnancy_US = C |
⚫ |
| UNII = SJ76Y07H5F |
|
|
|
| legal_UK = POM |
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C07166 |
|
| legal_US = Rx-only |
|
|
| routes_of_administration = oral, ] |
|
| InChI = 1/C6H18N4/c7-1-3-9-5-6-10-4-2-8/h9-10H,1-8H2 |
|
|
|
|
|
| InChIKey = VILCJCGEZXAXTO-UHFFFAOYAI |
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| metabolism = ] |
|
|
| elimination_half-life = 10–20 hours |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 117-89-5 |
|
|
| ATC_prefix = N05 |
|
|
| ATC_suffix = AB06 |
|
⚫ |
| PubChem = 5566 |
|
|
| IUPHAR_ligand = 214 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00831 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 5365 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 214IZI85K3 |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 45951 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 609 |
|
| ChEMBL = 422 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=21 | H=24 | F=3 | N=3 | S=1 |
|
|
| molecular_weight = 407.497 |
|
|
| smiles = FC(F)(F)c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(C)CC4 |
|
|
| InChI = 1/C21H24F3N3S/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H18N4/c7-1-3-9-5-6-10-4-2-8/h9-10H,1-8H2 |
|
| StdInChI = 1S/C21H24F3N3S/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VILCJCGEZXAXTO-UHFFFAOYSA-N |
|
| StdInChIKey = ZEWQUBUPAILYHI-UHFFFAOYSA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=112-24-3 |
|
⚫ |
| PubChem=5565 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID=21106175 |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 39501 |
|
|
| SMILES=C(CNCCNCCN)N |
|
|
}} |
|
|
|Section2= {{Chembox Properties |
|
|
| Formula=C<sub>6</sub>H<sub>18</sub>N<sub>4</sub> |
|
|
| MolarMass=146.23392 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPtC=12 |
|
|
| BoilingPtCL=266 | BoilingPtCH=267 |
|
|
| Solubility=Miscible |
|
|
}} |
|
|
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |