Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 14:07, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 453217261 of page Trifluoromethylphenylpiperazine for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'CAS_number').← Previous edit Revision as of 14:07, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456897965 of page Trifluperidol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
⚫ | IUPAC_name = 1-piperazine
| verifiedrevid = 418316981
| image = TFMPP.svg
⚫ | IUPAC_name = 1-(4-fluorophenyl)- 4-{4-hydroxy- 4- piperidin-1-yl} butan-1-one
| width = 150px
| image2 = TFMPP-3D-vdW.png | image = Trifluperidol.svg
| width2 = 150px | width = 200


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| Drugs.com = {{drugs.com|international|trifluperidol}}
| pregnancy_category =
| legal_AU = S9 | pregnancy_AU =
| pregnancy_US =
| legal_status = Unscheduled in US. Class C drug in New Zealand , II-P(Poland)<ref>{{cite web | title = Ustawa z dnia 15 kwietnia 2011 r. o zmianie ustawy o przeciwdziałaniu narkomanii ( Dz.U. 2011 nr 105 poz. 614 ) | url = http://isap.sejm.gov.pl/DetailsServlet?id = WDU20111050614 | publisher = Internetowy System Aktów Prawnych | accessdate = 17 June 2011}}</ref>
| legal_status =
| routes_of_administration = Oral | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =
Line 22: Line 22:


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = <!-- blanked - oldvalue: 15532-75-9 --> | CAS_number = <!-- blanked - oldvalue: 749-13-3 -->
| ATC_prefix = none
| ATC_suffix = | ATC_prefix = N05
| PubChem = 4296 | ATC_suffix = AD02
| ATC_supplemental =
| PubChem = 5567
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2057946 | ChemSpiderID = 5366
⚫ | C=11 | H=13 | F=3 | N=2
| UNII_Ref = {{fdacite|changed|FDA}}
⚫ | molecular_weight = 230.23 g/mol
| UNII = R8869Q7R8I
| StdInChI = 1S/C11H13F3N2/c12-11(13,14)9-3-1-2-4-10(9)16-7-5-15-6-8-16/h1-4,15H,5-8H2
| ChEMBL_Ref = {{ebicite|correct|EBI}}
⚫ | StdInChIKey = VZUBMIDXJRGARE-UHFFFAOYSA-N
| ChEMBL = 15023

<!--Chemical data-->
⚫ | C=22 | H=23 | F=4 | N=1 | O=2
⚫ | molecular_weight = 409.417 g/mol
| smiles = FC(F)(F)c1cccc(c1)C3(O)CCN(CCCC(=O)c2ccc(F)cc2)CC3
| InChI = 1/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2
| InChIKey = GPMXUUPHFNMNDH-UHFFFAOYAW
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = GPMXUUPHFNMNDH-UHFFFAOYSA-N
}} }}

Revision as of 14:07, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456897965 of page Trifluperidol with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 418316981 | IUPAC_name = 1-(4-fluorophenyl)- 4-{4-hydroxy- 4- piperidin-1-yl} butan-1-one | image = Trifluperidol.svg | width = 200

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | legal_status = | routes_of_administration = Oral

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = N05 | ATC_suffix = AD02 | ATC_supplemental = | PubChem = 5567 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 5366 | UNII_Ref = | UNII = R8869Q7R8I | ChEMBL_Ref = | ChEMBL = 15023

| C=22 | H=23 | F=4 | N=1 | O=2 | molecular_weight = 409.417 g/mol | smiles = FC(F)(F)c1cccc(c1)C3(O)CCN(CCCC(=O)c2ccc(F)cc2)CC3 | InChI = 1/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | InChIKey = GPMXUUPHFNMNDH-UHFFFAOYAW | StdInChI_Ref = | StdInChI = 1S/C22H23F4NO2/c23-19-8-6-16(7-9-19)20(28)5-2-12-27-13-10-21(29,11-14-27)17-3-1-4-18(15-17)22(24,25)26/h1,3-4,6-9,15,29H,2,5,10-14H2 | StdInChIKey_Ref = | StdInChIKey = GPMXUUPHFNMNDH-UHFFFAOYSA-N }}