Revision as of 14:48, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 402841329 of page Uridine_diphosphate_glucuronic_acid for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 14:49, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464791970 of page Urobilin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 402840353 |
|
| verifiedrevid = 449602468 |
|
|ImageFile=UDP glucuronic acid.png |
|
|ImageFile=I-Urobilin1.svg |
|
|ImageSize=200px |
|
|ImageSize=250px |
|
|IUPACName= |
|
|IUPACName= |
|
|OtherNames= |
|
|OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChI = 1/C9H12N2O6.C6H12O13P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-2(18-20(12,13)14)5(19-21(15,16)17)3(8)4(9)6(10)11/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);1-5,8-9H,(H,10,11)(H2,12,13,14)(H2,15,16,17)/p-4/t4-,6-,7-,8-;2-,3+,4-,5+/m10/s1 |
|
|
⚫ |
| ChemSpiderID = 4938471 |
|
| InChIKey = GIFKDHYZEJQSDD-DNQFPBLIBB |
|
|
|
| InChI = 1/C33H42N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h15,26-27,35H,7-14H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b28-15-/t26-,27-/m0/s1 |
|
|
| InChIKey = KDCCOOGTVSRCHX-UYMYUHGCBF |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H12N2O6.C6H12O13P2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;7-1-2(18-20(12,13)14)5(19-21(15,16)17)3(8)4(9)6(10)11/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);1-5,8-9H,(H,10,11)(H2,12,13,14)(H2,15,16,17)/p-4/t4-,6-,7-,8-;2-,3+,4-,5+/m10/s1 |
|
| StdInChI = 1S/C33H42N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h15,26-27,35H,7-14H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b28-15-/t26-,27-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = GIFKDHYZEJQSDD-BZYIUNRFSA-J |
|
| StdInChIKey = KDCCOOGTVSRCHX-UYMYUHGCSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = <!-- blanked - oldvalue: 2616-64-0 --> |
|
| CASNo = <!-- blanked - oldvalue: 1856-98-0 --> |
|
| PubChem=17473 |
|
| PubChem=6433298 |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| SMILES = O=C1/C(=C(/CC)(N1)Cc2c(c(c(n2)\C=C3/N=C(\C(=C3CCC(=O)O)C)C/4NC(=O)\C(=C\4C)CC)CCC(=O)O)C)C |
⚫ |
| ChemSpiderID=19951236 |
|
|
|
| MeSHName=Urobilin |
|
| IUPHAR_ligand = 1784 |
|
|
| SMILES = OC(=O)(O)(O)(OP()()=O)(C=O)OP()()=O.O=C\1NC(=O)N(/C=C/1)2O(CO)(O)2O |
|
|
| MeSHName=UDP+glucuronic+acid |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>22</sub>N<sub>2</sub>O<sub>18</sub>P<sub>2</sub> |
|
| Formula=C<sub>33</sub>H<sub>42</sub>N<sub>4</sub>O<sub>6</sub> |
|
| MolarMass=580.285 |
|
| MolarMass=590.71 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |