| Revision as of 14:50, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466538628 of page Ursodiol for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:50, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466156572 of page Urtoxazumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 425146856 |
|
| verifiedrevid = 450332165 |
|
⚫ |
| image = |
|
| IUPAC_name = 3α,7β-dihydroxy-5β-cholan-24-oic acid<br />OR<br />(''R'')-4-((3''R'',5''S'',7''S'',8''R'',9''S'',10''S'',13''R'',14''S'',17''R'')-3,7-dihydroxy-<br />10,13-dimethylhexadecahydro-<br />1''H''-cyclopentaphenanthren-17-yl)pentanoic acid |
|
|
|
|
|
| image = Ursodeoxycholic acid acsv.svg |
|
|
|
<!--Monoclonal antibody data--> |
|
| width = 300 |
|
|
| image2 = |
|
| type = mab |
|
| width2 = |
|
| mab_type = mab |
|
|
| source = zu/o |
|
| drug_name = Ursodeoxycholic acid |
|
|
|
| target = '']'' ] II B subunit |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Actigall |
|
| tradename = |
|
|
| pregnancy_AU = |
|
| Drugs.com = {{drugs.com|monograph|ursodiol}} |
|
|
⚫ |
| pregnancy_US = |
|
| licence_EU = <!-- EMEA requires brand name --> |
|
|
| licence_US = Ursodiol |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = B |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
| legal_AU = |
|
|
| legal_CA = |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| legal_UK = |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = Rx-only |
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
| dependency_liability = |
|
| ⚫ |
| routes_of_administration = oral |
|
|
| MedlinePlus = a699047 |
|
|
| DailyMedID = 19396 |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 36: |
Line 31: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 128-13-2 |
|
| CAS_number = <!-- blanked - oldvalue: 502496-16-4 --> |
|
| ATC_prefix = A05 |
|
| ATC_prefix = none |
|
| ATC_suffix = AA02 |
|
| ATC_suffix = |
|
| ATC_supplemental = |
|
| PubChem = |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| PubChem = 31401 |
|
|
⚫ |
| DrugBank = |
| ⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| DrugBank = DB01586 |
|
|
⚫ |
| ChemSpiderID = NA |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 29131 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 724L30Y2QR |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D00734 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9907 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1551 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=24 | H=40 | O=4 |
|
| C=6414 | H=9934 | N=1718 | O=2010 | S=40 |
|
| molecular_weight = 392.56 g/mol |
|
| molecular_weight = 144.6 ] |
|
| smiles = O=C(O)CC(1CC21(C)CC42(O)C3C(O)CC34C)C |
|
|
| InChI = 1/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 |
|
|
| InChIKey = RUDATBOHQWOJDD-UZVSRGJWBC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20+,22+,23+,24-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = RUDATBOHQWOJDD-UZVSRGJWSA-N |
|
|
| synonyms = ursodeoxycholic acid, Actigall, Ursosan, Urso, Urso Forte |
|
| ⚫ |
| density = |
|
|
| melting_point = 203 |
|
|
| boiling_point = |
|
|
| solubility = |
|
|
| specific_rotation = |
|
|
| sec_combustion = |
|
|
}} |
|
}} |
