Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:00, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470620432 of page Phosphoric_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 15:00, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 470620405 of page Hydrocodone/paracetamol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Drugbox
⚫ | verifiedrevid = 455058649
| Verifiedfields = changed
| image = Vicodin5mg.jpg
⚫ | verifiedrevid = 409759369
| drug_name = Hydrocodone / Paracetamol
| ImageFile = Phosphoric-acid-2D-dimensions.png

| ImageSize = 180px
<!--Combo data-->
| ImageName = Structural formula of phosphoric acid, showing dimensions
| type = combo
| ImageFile1 = Phosphoric-acid-3D-balls.png
| component1 = Hydrocodone
| ImageSize1 = 150px
| class1 = ]
| ImageName1 = Ball-and-stick model
| component2 = Paracetamol
| IUPACName = trihydroxidooxidophosphorus<br/>phosphoric acid
| class2 = ]
| OtherNames = Orthophosphoric acid
| component4 = <!-- Drugname, automatically linked -->
| Section1 = {{Chembox Identifiers
| class4 = <!-- Group, manual link using ] -->
⚫ | PubChem = 1004

⚫ | UNII_Ref = {{fdacite|correct|FDA}}
<!--Clinical data-->
| UNII = E4GA8884NN
| tradename =
| KEGG_Ref = {{keggcite|correct|kegg}}
| Drugs.com = {{drugs.com|parent|hydrocodone/paracetamol}}
| KEGG = D05467
| licence_EU = <!-- EMEA requires brand name -->
| InChI = 1/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)
| licence_US = Vicodin
| InChIKey = NBIIXXVUZAFLBC-UHFFFAOYAI
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 26078 | pregnancy_US = C
| pregnancy_category =
| SMILES = OP(=O)(O)O
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| ChEMBL = 1187
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = Schedule III
| routes_of_administration = ]

<!--Identifiers-->
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = <!-- blanked - oldvalue: 330988-71-1 -->
⚫ | PubChem = 11247932
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 9422965

<!--Chemical data-->
| smiles = O=C(Nc1ccc(O)cc1)C.O=C45Oc1c2c(ccc1OC)C3N(CC253CC4)C
| InChI = 1/C18H21NO3.C8H9NO2/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-6(10)9-7-2-4-8(11)5-3-7/h3,6,11-12,17H,4-5,7-9H2,1-2H3;2-5,11H,1H3,(H,9,10)/t11-,12+,17-,18-;/m0./s1
| InChIKey = DQGPYIDMOHQZSY-RNWHKREABN
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H21NO3.C8H9NO2/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-6(10)9-7-2-4-8(11)5-3-7/h3,6,11-12,17H,4-5,7-9H2,1-2H3;2-5,11H,1H3,(H,9,10)/t11-,12+,17-,18-;/m0./s1
| StdInChI = 1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NBIIXXVUZAFLBC-UHFFFAOYSA-N | StdInChIKey = DQGPYIDMOHQZSY-RNWHKREASA-N
| CASNo = 7664-38-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br/>16271-20-8 (hemihydrate)
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 979
| EINECS = 231-633-2
| UNNumber = 1805
| RTECS = TB6300000
}}
| Section2 = {{Chembox Properties
| Formula = H<sub>3</sub>PO<sub>4</sub>
| MolarMass = 98.00 g/mol
| Appearance = white solid or colourless, viscous liquid (>42 °C)
| Density = 1.885 g/mL (liquid)<br/>1.685 g/mL (85 % solution)<br/>2.030 g/mL (crystal at 25 °C)
| MeltingPt = 42.35 °C (anhydrous)<br/>29.32 °C (hemihydrate)
| BoilingPt = 158 °C (decomp)
| Solubility = 5.48 g/mL
| pKa = 2.148, 7.198, 12.375
| Viscosity = 2.4–9.4 ] (85% aq. soln.)<br/>147 ] (100 %)
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = 015-011-00-6
| EUClass = Corrosive ('''C''')
| NFPA-H = 2
| NFPA-R = 0
| NFPA-F = 0
| NFPA-O = COR
| RPhrases = {{R34}}
| SPhrases = {{S1/2}} {{S26}} {{S45}}
| FlashPt = Non-flammable
}}
| Section8 = {{Chembox Related
| OtherFunctn = ]<br/>]<br/>]<br/>]<br/>]<br/>]
| Function = ] ]s
}}
}} }}

Revision as of 15:00, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 470620405 of page Hydrocodone/paracetamol with values updated to verified values.
Hydrocodone / Paracetamol
Combination of
HydrocodoneOpioid analgesic
ParacetamolAnilide analgesic
Clinical data
AHFS/Drugs.comhydrocodone/paracetamol
License data
Routes of
administration		Oral
Legal status
Legal status
Identifiers
PubChem CID
ChemSpider
Chemical and physical data
3D model (JSmol)
SMILES
  • O=C(Nc1ccc(O)cc1)C.O=C45Oc1c2c(ccc1OC)C3N(CC253CC4)C
InChI
  • InChI=1S/C18H21NO3.C8H9NO2/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-6(10)9-7-2-4-8(11)5-3-7/h3,6,11-12,17H,4-5,7-9H2,1-2H3;2-5,11H,1H3,(H,9,10)/t11-,12+,17-,18-;/m0./s1
  • Key:DQGPYIDMOHQZSY-RNWHKREASA-N
  (verify)