Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 15:37, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469151562 of page Ustekinumab for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').← Previous edit Revision as of 15:37, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 467886989 of page Uvaricin for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 458774464 | verifiedrevid = 402847471
| image = | Name = (+)-Uvaricin
| ImageFile = Uvaricin.svg

| ImageSize = 280
<!--Monoclonal antibody data-->
| IUPACName = 3-(13-(5′-(1-(acetyloxy)undecyl)octahydro(2,2′-bifuran) -5-yl)-13-hydroxytridecyl)-5-methyl-2(5''H'')-Furanone
| type = mab
| Section1 = {{Chembox Identifiers
| mab_type = mab
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| source = u
| ChemSpiderID = 390275
| target = ] and ]

<!--Clinical data-->
| tradename = Stelara
| Drugs.com = {{drugs.com|monograph|ustekinumab}}
| MedlinePlus = a611013
| licence_EU = Stelara
| licence_US = Ustekinumab
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = contraindicated
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = POM
| legal_US = Rx-only
| legal_status =
| routes_of_administration = ]

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = NA
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 815610-63-0 -->
| ATC_prefix = L04
| ATC_suffix = AC05
| PubChem =
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = FU77B4U5Z0
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D09214
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1201835 --> | ChEMBL = 504329
| InChI = 1/C39H68O7/c1-4-5-6-7-8-15-18-21-24-35(44-31(3)40)36-27-28-38(46-36)37-26-25-34(45-37)33(41)23-20-17-14-12-10-9-11-13-16-19-22-32-29-30(2)43-39(32)42/h29-30,33-38,41H,4-28H2,1-3H3/t30-,33+,34+,35-,36+,37+,38+/m0/s1
| C=6482 | H=10004 | N=1712 | O=2016 | S=46
| InChIKey = JQOYPOSGHDJFLI-AVNCTIOFBH
| molecular_weight = 145.64 ]
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C39H68O7/c1-4-5-6-7-8-15-18-21-24-35(44-31(3)40)36-27-28-38(46-36)37-26-25-34(45-37)33(41)23-20-17-14-12-10-9-11-13-16-19-22-32-29-30(2)43-39(32)42/h29-30,33-38,41H,4-28H2,1-3H3/t30-,33+,34+,35-,36+,37+,38+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JQOYPOSGHDJFLI-AVNCTIOFSA-N
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = <!-- blanked - oldvalue: 82064-83-3 -->
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C08572
| PubChem = 441645
| SMILES = O=C\1O(/C=C/1CCCCCCCCCCCC(O)3O(2O(CC2)(OC(=O)C)CCCCCCCCCC)CC3)C
}}
| Section2 = {{Chembox Properties
| C=39|H=68|O=7
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}} }}

Revision as of 15:37, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 467886989 of page Uvaricin with values updated to verified values.
(+)-Uvaricin
Names
IUPAC name 3-(13-(5′-(1-(acetyloxy)undecyl)octahydro(2,2′-bifuran) -5-yl)-13-hydroxytridecyl)-5-methyl-2(5H)-Furanone
Identifiers
3D model (JSmol)
ChEMBL
ChemSpider
KEGG
PubChem CID
InChI
  • InChI=1S/C39H68O7/c1-4-5-6-7-8-15-18-21-24-35(44-31(3)40)36-27-28-38(46-36)37-26-25-34(45-37)33(41)23-20-17-14-12-10-9-11-13-16-19-22-32-29-30(2)43-39(32)42/h29-30,33-38,41H,4-28H2,1-3H3/t30-,33+,34+,35-,36+,37+,38+/m0/s1Key: JQOYPOSGHDJFLI-AVNCTIOFSA-N
  • InChI=1/C39H68O7/c1-4-5-6-7-8-15-18-21-24-35(44-31(3)40)36-27-28-38(46-36)37-26-25-34(45-37)33(41)23-20-17-14-12-10-9-11-13-16-19-22-32-29-30(2)43-39(32)42/h29-30,33-38,41H,4-28H2,1-3H3/t30-,33+,34+,35-,36+,37+,38+/m0/s1Key: JQOYPOSGHDJFLI-AVNCTIOFBH
SMILES
  • O=C\1O(/C=C/1CCCCCCCCCCCC(O)3O(2O(CC2)(OC(=O)C)CCCCCCCCCC)CC3)C
Properties
Chemical formula C39H68O7
Molar mass 648.966 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound