| Revision as of 15:59, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458427450 of page Vinyl_fluoride for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 16:00, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447550302 of page Vinylbital for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| verifiedrevid = 444245504 |
|
| verifiedrevid = 443333023 |
|
|
| IUPAC_name = 5-(1-methylbutyl)-5-vinylpyrimidine-2,4,6(1''H'',3''H'',5''H'')-trione |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
|
| image = Vinylbital structure.svg |
|
| ImageFile = Vinylfluoride t.png |
|
|
| ImageSize = 120px |
|
| width = 150 |
|
|
|
|
| IUPACName = Fluoroethene |
|
|
|
<!--Clinical data--> |
|
| OtherNames = Vinylfluoride, Fluoroethylene, Monofluoroethylene, Vinyl fluoride monomer, VF, R 1141, UN 1860 (inhibited) |
|
|
|
| tradename = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_category = ? |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6099 |
|
| legal_status = ? |
|
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = ? |
|
|
| metabolism = ] |
|
|
| elimination_half-life = ? |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number = <!-- blanked - oldvalue: 2430-49-1 --> |
|
|
| ATC_prefix = N05 |
|
|
| ATC_suffix = CA08 |
|
⚫ |
| PubChem = 72135 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 65109 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 3W58ITX06Q |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D07321 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=11 | H=16 | N=2 | O=3 |
|
|
| molecular_weight = 224.256 |
|
|
| smiles = O=C1NC(=O)NC(=O)C1(\C=C)C(C)CCC |
|
|
| InChI = 1/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h5,7H,2,4,6H2,1,3H3,(H2,12,13,14,15,16) |
|
|
| InChIKey = KGKJZEKQJQQOTD-UHFFFAOYAU |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C2H3F/c1-2-3/h2H,1H2 |
|
| StdInChI = 1S/C11H16N2O3/c1-4-6-7(3)11(5-2)8(14)12-10(16)13-9(11)15/h5,7H,2,4,6H2,1,3H3,(H2,12,13,14,15,16) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XUCNUKMRBVNAPB-UHFFFAOYSA-N |
|
| StdInChIKey = KGKJZEKQJQQOTD-UHFFFAOYSA-N |
|
| CASNo = 75-02-5 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| ⚫ |
| PubChem = 6339 |
|
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 51314 |
|
|
| SMILES = FC=C |
|
|
| InChI = 1/C2H3F/c1-2-3/h2H,1H2 |
|
|
| EINECS = 200-832-6 |
|
|
| RTECS = YZ7351000 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = C19185 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>2</sub>H<sub>3</sub>F |
|
|
| MolarMass = 46.04 g/mol |
|
|
| Appearance = Colorless gas with a faint, ethereal odor |
|
|
| Density = 2 g/cm<sup>3</sup> (gas) |
|
|
0.91 g/cm<sup>3</sup> (liquid) |
|
|
| MeltingPt = -160.5 °C (-257 °F) |
|
|
| BoilingPt = -72.2 °C (-98 °F) |
|
|
| Solubility = Slightly soluble |
|
|
| VaporPressure = 25 500 kPa |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| EUClass = Extremely flammable ('''F+''') |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = 385 °C |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 4 |
|
|
| NFPA-R = 2 |
|
|
| NFPA-O = |
|
|
| RPhrases = {{R12}} |
|
|
| SPhrases = {{S9}}, {{S16}}, {{S33}} |
|
|
| ExploLimits = 2.6 - 21.7 % |
|
|
}} |
|
|
}} |
|
}} |
