Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:28, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 473904967 of page Cyclic_adenosine_monophosphate for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:28, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 473902055 of page Gallium(III)_fluoride for the Chem/Drugbox validation project (updated: 'CASNo').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 470456754 | verifiedrevid = 403836509
| ImageFile =Aluminium-trifluoride-3D-polyhedra.png
| ImageFileL1 = Cyclic-adenosine-monophosphate-2D-skeletal.png
| ImageFile2 =FeF3structure.jpg
| ImageSizeL1 = 150 px
| ImageName = Gallium(III) fluoride
| ImageFileR1 = Cyclic-adenosine-monophosphate-3D-balls.png
| OtherNames = gallium trifluoride
| ImageSizeR1 = 150 px
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5851 | ChemSpiderID = 74191
| InChI = 1/3FH.Ga/h3*1H;/q;;;+3/p-3
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| InChIKey = WXXZSFJVAMRMPV-DFZHHIFOAM
| ChEMBL = 316966
| SMILES = F(F)F
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = E0399OZS9N
| InChI = 1/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1
| InChIKey = IVOMOUWHDPKRLL-KQYNXXCUBU
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/3FH.Ga/h3*1H;/q;;;+3/p-3
| StdInChI = 1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IVOMOUWHDPKRLL-KQYNXXCUSA-N | StdInChIKey = WXXZSFJVAMRMPV-UHFFFAOYSA-K
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 60-92-4
| CASNo = <!-- blanked - oldvalue: 7783-51-9 -->
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 6076 | PubChem = 82211
| IUPHAR_ligand = 2352
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02527
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17489
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00575
| SMILES = c1nc(c2c(n1)n(cn2)3(4(O3)COP(=O)(O4)O)O)N
| MeSHName = Cyclic+AMP
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>10</sub>H<sub>12</sub>N<sub>5</sub>O<sub>6</sub>P | Formula = GaF<sub>3</sub>
| MolarMass = 329.206 | MolarMass = 126.718 g/mol
| Appearance = | Appearance = white powder
| Density = | Density = 4.47 g/cm<sup>3</sup>
| Solubility = 0.0002 g/100 mL
| MeltingPt =
| BoilingPt = | MeltingPt = 800 °C
| BoilingPt = 1000°C
}} }}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Structure
| CrystalStruct = ], ]
| Solubility =
| SpaceGroup = R-3c, No. 167
| MainHazards =
}}
| FlashPt =
| Section7 = {{Chembox Hazards
| Autoignition =
| EUClass = not listed
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 2
| NFPA-O =
}} }}
}} }}

Revision as of 12:28, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 473902055 of page Gallium(III)_fluoride with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Gallium(III) fluoride
Gallium(III) fluoride
Names
Other names gallium trifluoride
Identifiers
3D model (JSmol)
ChemSpider
PubChem CID
InChI
  • InChI=1S/3FH.Ga/h3*1H;/q;;;+3/p-3Key: WXXZSFJVAMRMPV-UHFFFAOYSA-K
  • InChI=1/3FH.Ga/h3*1H;/q;;;+3/p-3Key: WXXZSFJVAMRMPV-DFZHHIFOAM
SMILES
  • F(F)F
Properties
Chemical formula GaF3
Molar mass 126.718 g/mol
Appearance white powder
Density 4.47 g/cm
Melting point 800 °C
Boiling point 1000°C
Solubility in water 0.0002 g/100 mL
Structure
Crystal structure Rhombohedral, hR24
Space group R-3c, No. 167
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 3: Short exposure could cause serious temporary or residual injury. E.g. chlorine gasFlammability 0: Will not burn. E.g. waterInstability 2: Undergoes violent chemical change at elevated temperatures and pressures, reacts violently with water, or may form explosive mixtures with water. E.g. white phosphorusSpecial hazards (white): no code
3 0 2
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Chemical compound