Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:28, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 476446124 of page Potassium_chloride for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit Revision as of 12:29, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 475232701 of page Tartaric_acid for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed | Watchedfields = changed
| verifiedrevid = 464362321 | verifiedrevid = 470481910
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Potassium chloride.jpg | ImageFile = Tartaric acid.svg
| ImageFile1 = Potassium-chloride-3D-ionic.png | ImageFile1 = Tartaric-acid-3D-balls.png
| OtherNames = ]<br/>Muriate of potash
| ImageSize =
| IUPACName = 2,3-dihydroxybutanedioic acid
| OtherNames = 2,3-dihydroxysuccinic acid<br>threaric acid<br>racemic acid<br>uvic acid<br>paratartaric acid
| Reference = <ref>, ].</ref>
|-
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}} | KEGG_Ref = {{keggcite|correct|kegg}}
| UNII = 660YQ98I10 | KEGG = C00898
| InChI = 1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)
⚫ | ChEMBL_Ref = {{ebicite|changed|EBI}}
| InChIKey = FEWJPZIEWOKRBE-UHFFFAOYAZ
| ChEMBL = <!-- blanked - oldvalue: 1200731 -->
| KEGG_Ref = {{keggcite|correct|kegg}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| KEGG = D02060 | ChEMBL = 333714
| ChEMBL2 = 1200861
| InChI = 1/ClH.K/h1H;/q;+1/p-1
| InChIKey = WCUXLLCKKVVCTQ-REWHXWOFAZ
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank = DB00761
| ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 32588
| SMILES = .
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/ClH.K/h1H;/q;+1/p-1 | StdInChI = 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WCUXLLCKKVVCTQ-UHFFFAOYSA-M | StdInChIKey = FEWJPZIEWOKRBE-UHFFFAOYSA-N
⚫ | CASNo = 7447-40-7
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CASNo = 526-83-0
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4707 | PubChem = 875
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem = 4873
| ChemSpiderID = 852
| RTECS = TS8050000
| MeSHName = tartaric+acid
| ATCCode_prefix = A12
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ATCCode_suffix = BA01
⚫ | DrugBank = DB01694
| ATC_Supplemental = {{ATC|B05|XA01}}
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 15674
| SMILES = O=C(O)C(O)C(O)C(=O)O
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>4</sub>H<sub>6</sub>O<sub>6</sub><small> (Basic formula)</small><br>HO<sub>2</sub>CCH(OH)CH(OH)CO<sub>2</sub>H <small>(Structural formula)</small>
| Formula = KCl
| MolarMass = 74.5513 g mol<sup>-1</sup> | MolarMass = 150.087 g/mol
| Appearance = white crystalline solid | Appearance = white powder
⚫ | Density = 1.79 g/mL (H<sub>2</sub>O)
| Odor = odorless
| MeltingPt = 171–174&nbsp;°C (''L or D''-tartaric; pure)<br>206&nbsp;°C (''DL'', racemic)<br> 165-166°C ("meso-anhyrdous") <br> 146–148&nbsp;°C (''meso-hydrous'')<ref>{{RubberBible86th}}</ref> <br>
⚫ | Density = 1.984 g/cm<sup>3</sup>
⚫ | BoilingPt =
| Solubility = 281 g/L (0°C) <br> 344 g/L (20°C) <br> 567 g/L (100°C)
| Solubility = 133 g/100ml (20&nbsp;°C)
| SolubleOther = soluble in ], ]es <br> slightly soluble in ], insoluble in ]<ref>{{cite web | url = http://www.inchem.org/documents/pims/pharm/potasscl.htm | title = Potassium chloride (PIM 430) | at = 3.3.1 Properties of the substance | publisher = ] | accessdate = 2011-01-17 }}</ref>
| pKa = L(+) 25&nbsp;°C :<br>pK<sub>a1</sub>= 2.95 pK<sub>a2</sub>= 4.25<br>meso 25&nbsp;°C:<br>pK<sub>a1</sub>= 3.22 pK<sub>a2</sub>= 4.85
| MeltingPt = 770 °C
⚫ | BoilingPt = 1420 °C
| RefractIndex = 1.4902 (589 nm)
| pKa = ~7
}}
| Section3 = {{Chembox Structure
| CrystalStruct = ]
}} }}
| Section4 = {{Chembox Thermochemistry | Section3 = {{Chembox Hazards
| MainHazards =
| DeltaHf = −436&nbsp;kJ·mol<sup>−1</sup><ref name=b1>{{cite book| author = Zumdahl, Steven S.|title =Chemical Principles 6th Ed.| publisher = Houghton Mifflin Company| year = 2009| isbn = 061894690X|page=A22}}</ref>
|EUClass=Irritant('''Xi''')
| Entropy = 83&nbsp;J·mol<sup>−1</sup>·K<sup>−1</sup><ref name=b1/>
|RPhrases={{R36}}
}}
| Autoignition =
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = Not listed
| FlashPt = Non-flammable
| NFPA-H = 1
| NFPA-F = 0
| NFPA-R = 0
| NFPA-O =
| LD50 = 2.6 g/kg (oral/rat), 0.142 g/kg (intravenous/rat)<ref>{{Cite book|title = Material Safety Data Sheet – Potassium Chloride|publisher = Sigma–Aldrich|date = July 2001}}</ref>
}} }}
| Section8 = {{Chembox Related | Section4 = {{Chembox Related
| OtherAnions = ]<br/>]<br/>] | OtherCations = ]<br />]<br />]<br />]
| Function = ]s
| OtherCations = ]<br/>]<br/>]<br/>]
| OtherFunctn = ]<br />]<br />]<br />]<br />]
| OtherCpds = ]<br/>] | OtherCpds = ]<br />]
}} }}

}} }}

Revision as of 12:29, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475232701 of page Tartaric_acid with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
IUPAC name 2,3-dihydroxybutanedioic acid
Other names 2,3-dihydroxysuccinic acid
threaric acid
racemic acid
uvic acid
paratartaric acid
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
DrugBank
KEGG
MeSH tartaric+acid
PubChem CID
InChI
  • InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)Key: FEWJPZIEWOKRBE-UHFFFAOYSA-N
  • InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)Key: FEWJPZIEWOKRBE-UHFFFAOYAZ
SMILES
  • O=C(O)C(O)C(O)C(=O)O
Properties
Chemical formula C4H6O6 (Basic formula)
HO2CCH(OH)CH(OH)CO2H (Structural formula)
Molar mass 150.087 g/mol
Appearance white powder
Density 1.79 g/mL (H2O)
Melting point 171–174 °C (L or D-tartaric; pure)
206 °C (DL, racemic)
165-166°C ("meso-anhyrdous")
146–148 °C (meso-hydrous)
Solubility in water 133 g/100ml (20 °C)
Acidity (pKa) L(+) 25 °C :
pKa1= 2.95 pKa2= 4.25
meso 25 °C:
pKa1= 3.22 pKa2= 4.85
Related compounds
Other cations Monosodium tartrate
Disodium tartrate
Monopotassium tartrate
Dipotassium tartrate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound
  1. Tartaric Acid – Compound Summary, PubChem.
  2. Lide, D. R., ed. (2005). CRC Handbook of Chemistry and Physics (86th ed.). Boca Raton, Florida: CRC Press. ISBN 0-8493-0486-5.