Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:57, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474344817 of page Tabun_(nerve_agent) for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').← Previous edit Revision as of 12:58, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475247487 of page Crystal_violet for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{Chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 417192414 | verifiedrevid = 460108792
| ImageFile = Methyl Violet 10B.png
| Name = Tabun
| ImageSize = 244
| ImageFile1 = GA-3D-balls-by-AHRLS-2011.png
| ImageName = Kekulé, skeletal formula of a crystal violet minor tautomer
| ImageSize1=200px
| IUPACName = Tris(4-(dimethylamino)phenyl)methylium chloride{{Citation needed|date = June 2011}}
| ImageFile2 = Tabun-2D-skeletal-by-AHRLS.png
| OtherNames = Aniline violet{{Citation needed|date = June 2011}}<br />
| ImageSize2=200px
Basic violet 3<br />
| IUPACName = Ethyl ''N'',''N''-Dimethylphosphoramidocyanidate
Baszol Violet 57L{{Citation needed|date = June 2011}}<br />
| OtherNames = GA; Ethyl dimethylphosphoramidocyanidate; Dimethylaminoethoxy-cyanophosphine oxide; Dimethylamidoethoxyphosphoryl cyanide; Ethyl dimethylaminocyanophosphonate; Ethyl ester of dimethylphosphoroamidocyanidic acid; Ethyl phosphorodimethylamidocyanidate; Cyanodimethylaminoethoxyphosphine oxide; Dimethylaminoethodycyanophosphine oxide; EA1205
Brilliant Violet 58{{Citation needed|date = June 2011}}<br />
Hexamethyl-''p''-rosaniline chloride{{Citation needed|date = June 2011}}<br />
Methylrosanilide chloride{{Citation needed|date = June 2011}}<br />
Methyl Violet 10B{{Citation needed|date = June 2011}}<br />
Methyl Violet 10BNS{{Citation needed|date = June 2011}}<br />
Pyoktanin{{Citation needed|date = June 2011}}<br />
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| CASNo = 548-62-9
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br />{{CAS|467-63-0}} (base)
| ChemSpiderID = 6254
| PubChem = 11057
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| ChEMBL = 446997
| PubChemOther = {{PubChemCID|68050}} (base)
| InChI = 1/C5H11N2O2P/c1-4-9-10(8,5-6)7(2)3/h4H2,1-3H3
| ChemSpiderID = 10588
| InChIKey = PJVJTCIRVMBVIA-UHFFFAOYAG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| UNII_Ref = {{fdacite|correct|FDA}}
| StdInChI = 1S/C5H11N2O2P/c1-4-9-10(8,5-6)7(2)3/h4H2,1-3H3
| UNII = J4Z741D6O5
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| EINECS = 208-953-6
| StdInChIKey = PJVJTCIRVMBVIA-UHFFFAOYSA-N
| UNNumber = 3077
| CASNo_Ref = {{cascite|correct|??}}
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| CASNo = <!-- blanked - oldvalue: 77-81-6 -->
| DrugBank = <!-- blanked - oldvalue: DB00406 -->
| EINECS =
| PubChem = | KEGG = D01046
| KEGG_Ref = {{keggcite|correct|kegg}}
| SMILES = N#CP(=O)(OCC)N(C)C
| MeSHName = Gentian+violet
| InChI =
| RTECS = | ChEMBL = 64894
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| MeSHName =
| RTECS = BO9000000
| ChEBI_Ref = {{ebicite|correct|EBI}}
| Beilstein = 3580948
| ChEBI =
| ATCCode_prefix = D01
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = | ATCCode_suffix = AE02
| ATC_Supplemental = {{ATC|G01|AX09}}
| ATCCode_prefix =
| SMILES = .CN(C)c1ccc(cc1)(c1ccc(cc1)N(C)C)c1ccc(cc1)N(C)C
| ATCCode_suffix =
| SMILES1 = .CN(C)C1=CC=C(C=C1)(C1=CC=C(C=C1)N(C)C)C1=CC=C(C=C1)N(C)C
| ATC_Supplemental =}}
| StdInChI = 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1
| StdInChIKey = ZXJXZNDDNMQXFV-UHFFFAOYSA-M
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = ZXJXZNDDNMQXFV-REWHXWOFAV
}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = {{Chem|C|25|N|3|H|30|Cl}}
| C=5 | H =11 | N=2 | O=2 | P=1
| MolarMass = 407.979 g mol<sup>-1</sup>
| Appearance = Colorless to brown liquid
| ExactMass = 407.212825682 g mol<sup>-1</sup>
| Density = 1.0887 g/cm³ at 25 °C<br />1.102 g/cm³ at 20 °C
| MeltingPtC = -50 | MeltingPtC = 205
}}
| BoilingPtC = 247.5
| Section3 = {{Chembox Hazards
| Solubility = 9.8 g/100 g at 25 °C <br /> 7.2 g/100 g at 20 °C
| GHSPictograms = {{GHS corrosion}} {{GHS exclamation mark}} {{GHS health hazard}} {{GHS environment}}
| SolubleOther =
| GHSSignalWord = '''DANGER'''
| Solvent =
| HPhrases = {{H-phrases|302|318|351|410}}
| LogP =
| PPhrases = {{P-phrases|273|280|305+351+338|501}}
| VaporPressure = 0.07 mmHg (9 Pa)
| EUIndex = 612-204-00-2
| HenryConstant =
| EUClass = {{Hazchem Xn}} {{Hazchem N}}
| AtmosphericOHRateConstant =
| RPhrases = {{R22}}, {{R40}}, {{R41}}, {{R50/53}}
| pKa =
| SPhrases = {{S2}}, {{S26}}, {{S36/37/39}}, {{S46}}, {{S60}}, {{S61}}
| pKb = }}
| LD50 = 1.2 g/kg (oral, mice)</br>
| Section5 = {{Chembox Pharmacology
1.0 g/kg (oral, rats)<ref>{{citation | last1=Hodge | first1=H.C. | last2=Indra | first2=J. | last3=Drobeck | first3=H.P. | last4=Duprey | first4=L.P. | last5=Tainter | first5=M.L. | year=1972 | title= Acute oral toxicity of methylrosaniline chloride | volume=22 | pages=1–5 | doi=10.1016/0041-008X(72)90219-0 | journal=Toxicology and Applied Pharmacology | pmid=5034986 | issue=1 }}</ref>
| AdminRoutes =
}}
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards = Highly Toxic. Fires involving this chemical may result in the formation of ]
| NFPA-H = 4
| NFPA-F = 2
| NFPA-R = 1
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt = 78 °C
| Autoignition =
| ExploLimits =
| LD50 =
| PEL = }}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Revision as of 12:58, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475247487 of page Crystal_violet with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Kekulé, skeletal formula of a crystal violet minor tautomer
Names
IUPAC name Tris(4-(dimethylamino)phenyl)methylium chloride
Other names Aniline violet

Basic violet 3
Baszol Violet 57L
Brilliant Violet 58
Hexamethyl-p-rosaniline chloride
Methylrosanilide chloride
Methyl Violet 10B
Methyl Violet 10BNS

Pyoktanin
Identifiers
CAS Number
3D model (JSmol)
Beilstein Reference 3580948
ChEMBL
ChemSpider
EC Number
  • 208-953-6
KEGG
MeSH Gentian+violet
PubChem CID
RTECS number
  • BO9000000
UNII
UN number 3077
InChI
  • InChI=1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1Key: ZXJXZNDDNMQXFV-UHFFFAOYSA-M
  • InChI=1/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1Key: ZXJXZNDDNMQXFV-REWHXWOFAV
SMILES
  • .CN(C)c1ccc(cc1)(c1ccc(cc1)N(C)C)c1ccc(cc1)N(C)C
  • .CN(C)C1=CC=C(C=C1)(C1=CC=C(C=C1)N(C)C)C1=CC=C(C=C1)N(C)C
Properties
Chemical formula C
25N
3H
30Cl
Molar mass 407.979 g mol
Melting point 205 °C (401 °F; 478 K)
Hazards
GHS labelling:
Pictograms GHS05: Corrosive GHS07: Exclamation mark GHS08: Health hazard GHS09: Environmental hazard
Signal word Danger
Hazard statements H302, H318, H351, H410
Precautionary statements P273, P280, P305+P351+P338, P501
Lethal dose or concentration (LD, LC):
LD50 (median dose) 1.2 g/kg (oral, mice)

1.0 g/kg (oral, rats)

Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Hodge, H.C.; Indra, J.; Drobeck, H.P.; Duprey, L.P.; Tainter, M.L. (1972), "Acute oral toxicity of methylrosaniline chloride", Toxicology and Applied Pharmacology, 22 (1): 1–5, doi:10.1016/0041-008X(72)90219-0, PMID 5034986