Revision as of 16:22, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 467453092 of page 1,3-Difluoro-2-propanol for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 16:23, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457723505 of page 1,3-Dihydroxyanthraquinone for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 401929184 |
|
| verifiedrevid = 456495013 |
|
|ImageFile=1,3-Difluoro-2-propanol.png |
|
| ImageFile = Xanthopurpurin.svg |
|
|ImageSize= |
|
| ImageSize = 200px |
|
|
| ImageName = Skeletal formula |
|
|IUPACName=1,3-Difluoro-2-propanol |
|
|
|
| ImageFile1 = Xanthopurpurin-3D-balls.png |
|
|OtherNames= |
|
|
|
| ImageSize1 = 220px |
⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| ImageName1 = Ball-and-stick model |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| IUPACName = 1,3-dihydroxyanthracene-9,10-dione |
⚫ |
| ChemSpiderID = 61300 |
|
|
|
| OtherNames = Purpuroxanthin; Xanthopurpurin |
|
| InChI = 1/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| SMILES1 = FCC(O)CF |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChIKey = PVDLUGWWIOGCNH-UHFFFAOYAJ |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 37502 |
|
⚫ |
| ChemSpiderID = 170598 |
|
|
| InChI = 1/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
|
|
| InChIKey = WPWWKBNOXTZDQJ-UHFFFAOYAR |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 372711 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
|
| StdInChI = 1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PVDLUGWWIOGCNH-UHFFFAOYSA-N |
|
| StdInChIKey = WPWWKBNOXTZDQJ-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 453-13-4 --> |
|
| CASNo = <!-- blanked - oldvalue: 518-83-2 --> |
|
| PubChem=67985 |
|
| PubChem = 196978 |
|
| SMILES=OC(CF)CF |
|
| SMILES = O=C2c1ccccc1C(=O)c3c2cc(O)cc3O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>14</sub>H<sub>8</sub>O<sub>4</sub> |
|
| C = 3 | H = 6 | F = 2 | O = 1 |
|
|
|
| MolarMass = 240.21 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density=1.24 g/cm<sup>3</sup> (at 25 °C) <ref>http://www.sigmaaldrich.com/catalog/ProductDetail.do?lang=de&N4=176923|ALDRICH&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC</ref> |
|
|
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt=54–55 °C |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
}} |
|
| Solubility = }} |
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt=42 °C |
|
| FlashPt = |
|
| Autoignition= |
|
| Autoignition = }} |
|
}} |
|
|
}} |
|
}} |