Revision as of 16:31, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 413093172 of page 1,8-Diaminonaphthalene for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 16:32, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475471172 of page 1,8-Diazabicycloundec-7-ene for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 413090959 |
|
| verifiedrevid = 444320828 |
|
|
| Name = 1,8-Diazabicycloundec-7-ene |
|
|ImageFile=1,8-Diaminonaphthalene.png |
|
|
|
| ImageFile = DBU.svg |
|
|ImageSize= |
|
|
|
<!-- | ImageSize = 200px --> |
|
|IUPACName=naphthalene-1,8-diamine |
|
|
|
| ImageName = |
|
|OtherNames= |
|
|
|
| IUPACName = 2,3,4,6,7,8,9,10-octahydropyrimidoazepine |
⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| OtherNames = DBU,Diazabicycloundecene |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
⚫ |
| ChemSpiderID = 61381 |
|
|
|
| SMILES = N\2=C1\N(CCCCC1)CCC/2 |
⚫ |
| InChI = 1/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChIKey = YFOOEYJGMMJJLS-UHFFFAOYAU |
|
|
⚫ |
| ChemSpiderID = 73246 |
|
| SMILES1 = c1(cccc2cccc(N)c12)N |
|
|
⚫ |
| InChI = 1/C9H16N2/c1-2-5-9-10-6-4-8-11(9)7-3-1/h1-8H2 |
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| InChIKey = GQHTUMJGOHRCHB-UHFFFAOYAM |
|
| ChEMBL = 595537 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
|
| StdInChI = 1S/C9H16N2/c1-2-5-9-10-6-4-8-11(9)7-3-1/h1-8H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YFOOEYJGMMJJLS-UHFFFAOYSA-N |
|
| StdInChIKey = GQHTUMJGOHRCHB-UHFFFAOYSA-N |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 479-27-6 --> |
|
|
|
| CASNo = 6674-22-2 |
|
| PubChem=68067 |
|
|
|
| RTECS = |
|
| SMILES=C1=CC2=C(C(=C1)N)C(=CC=C2)N |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>10</sub>N<sub>2</sub> |
|
| Formula = C<sub>9</sub>H<sub>16</sub>N<sub>2</sub> |
|
| MolarMass=158.1998 |
|
| MolarMass = 152.24 g/mol |
|
| Appearance= |
|
| Appearance = Colorless liquid |
|
| Density= |
|
| Density = 1.018 g/mL liquid |
|
| MeltingPt= |
|
| Solubility = |
|
|
| MeltingPtC = -70 |
|
| BoilingPt= |
|
|
|
| BoilingPt = 80-83 °C (0.6 mmHg) |
|
| Solubility= |
|
|
|
| pKa = 24.34 (in ])<ref name="Kaljurand">I. Kaljurand, A. Kütt, L. Sooväli, T. Rodima, V. Mäemets, I. Leito, I. A. Koppel. Extension of the Self-Consistent Spectrophotometric Basicity Scale in Acetonitrile to a Full Span of 28 p''K''<sub>a</sub> Units: Unification of Different Basicity Scales. ''J. Org. Chem.'', '''2005''', ''70'', 1019–1028. </ref> (p''K''<sub>a</sub> value of protonated DBU) |
|
|
| Viscosity = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
| Section7 = {{Chembox Hazards |
|
| MainHazards= |
|
| ExternalMSDS = |
|
| FlashPt= |
|
| MainHazards = |
|
|
| FlashPt = 119.9°C |
|
| Autoignition= |
|
|
|
| RPhrases = R22 R34 |
|
|
| SPhrases = S24 S25 |
|
}} |
|
}} |
|
| Section8 = {{Chembox Related |
|
| Section8 = {{Chembox Related |
|
|
| OtherCpds = |
|
| Function = ]s |
|
|
| OtherFunctn = ]<br />] |
|
|
}} |
|
}} |
|
}} |
|
}} |