Revision as of 17:00, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 429508070 of page 2,3-Oxidosqualene for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 17:00, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443344821 of page 2,4,6-Tribromoanisole for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 399199419 |
|
| verifiedrevid = 443342532 |
|
|
|Reference=<ref> at ]</ref> |
|
|ImageFile=2,3-oxidosqualene.svg |
|
|ImageFile=2,4,6-tribromoanisole.png |
|
|ImageSize=300px |
|
|ImageSize=150px |
|
|IUPACName=2,2-Dimethyl-3-oxirane |
|
|
|
|IUPACName=1,3,5-Tribromo-2-methoxybenzene |
|
|OtherNames=Squalene oxide<br>2,3-Squalene oxide |
|
|
|
|OtherNames=Tribromoanisole; TBA |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| InChI = 1/C30H50O/c1-24(2)14-11-17-27(5)20-12-18-25(3)15-9-10-16-26(4)19-13-21-28(6)22-23-29-30(7,8)31-29/h14-16,20-21,29H,9-13,17-19,22-23H2,1-8H3/b25-15+,26-16+,27-20+,28-21+ |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| InChIKey = QYIMSPSDBYKPPY-BANQPHDMBU |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| SMILES1 = CC(=CCC/C(=C/CC/C(=C/CC/C=C(\C)/CC/C=C(\C)/CCC1C(O1)(C)C)/C)/C)C |
|
|
|
| ChEBI = 38703 |
|
⚫ |
| ChemSpiderID = 11345 |
|
|
| InChI = 1/C10H12O3/c1-7(2)13-10(12)8-5-3-4-6-9(8)11/h3-7,11H,1-2H3 |
|
|
| InChIKey = YEULQIJMIOWCHB-UHFFFAOYAR |
|
|
| SMILES1 = O=C(OC(C)C)c1ccccc1O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C30H50O/c1-24(2)14-11-17-27(5)20-12-18-25(3)15-9-10-16-26(4)19-13-21-28(6)22-23-29-30(7,8)31-29/h14-16,20-21,29H,9-13,17-19,22-23H2,1-8H3/b25-15+,26-16+,27-20+,28-21+ |
|
| StdInChI = 1S/C10H12O3/c1-7(2)13-10(12)8-5-3-4-6-9(8)11/h3-7,11H,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QYIMSPSDBYKPPY-BANQPHDMSA-N |
|
| StdInChIKey = YEULQIJMIOWCHB-UHFFFAOYSA-N |
|
| CASNo = <!-- blanked - oldvalue: 7200-26-2 --> |
|
| CASNo = <!-- blanked - oldvalue: 607-99-8 --> |
|
| PubChem=5366020 |
|
| PubChem=11839 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = DO7M3M4LX5 |
⚫ |
| ChemSpiderID = 4517951 |
|
|
| SMILES = O1C(C)(C)C1CC/C(=C/CC/C(=C/CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)C)C |
|
| SMILES=COC1=C(C=C(C=C1Br)Br)Br |
|
| MeSHName=2,3-oxidosqualene |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>30</sub>H<sub>50</sub>O |
|
| Formula=C<sub>7</sub>H<sub>5</sub>Br<sub>3</sub>O |
|
| MolarMass=426.717 g/mol |
|
| MolarMass=344.826 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt=84-88 °C |
|
| BoilingPt= |
|
| BoilingPt=297-299 °C |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |