| Revision as of 18:13, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456503787 of page 4-Fluoropethidine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 18:13, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451556242 of page 4-HO-AMT for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 456502672 |
|
| verifiedrevid = 413272685 |
|
| IUPAC_name = ethyl 4-(4-fluorophenyl)-1-methylpiperidine-4-carboxylate |
|
| IUPAC_name = 3-(2-aminopropyl)-1''H''-indol-4-ol |
|
| image = 4-Fluoromeperidine.png |
|
| image = 4-hydroxy-alphamethyltryptamine.png |
|
|
| image2 = 4-Hydroxy-α-methyltryptamine.png |
|
| width = 240 |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_status = Uncontrolled <small>(but may be covered under the ] in the ] and under similar bills in other countries)</small> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| routes_of_administration = Oral |
|
| legal_CA = |
|
|
| legal_UK = |
|
|
| legal_US = |
|
|
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
| Line 26: |
Line 19: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
| ⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = |
|
| CAS_number = |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
⚫ |
| PubChem = 14083213 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ⚫ |
| ChEMBL = 112817 |
|
| ⚫ |
| PubChem = 11184669 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9359754 |
|
| ChemSpiderID = 23128298 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| synonyms = 4-Fluoromeperidine, 4-Fluoropethidine |
|
|
⚫ |
| ChEMBL = 285823 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=20 | F=1 | N=1 | O=2 |
|
| C=11 | H=14 | N=2 | O=1 |
|
| molecular_weight = 265.322 g/mol |
|
| molecular_weight = 190.242 g/mol |
|
| smiles = Fc2ccc(cc2)C(C(=O)OCC)(CC1)CCN1C |
|
| smiles = c2ccc1ncc(CC(C)N)c1c2O |
|
| InChI = 1/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
|
| InChI = 1/C11H14N2O/c1-7(12)5-8-6-13-9-3-2-4-10(14)11(8)9/h2-4,6-7,13-14H,5,12H2,1H3 |
|
| InChIKey = CHOQGLPFQOQESN-UHFFFAOYAI |
|
| InChIKey = BYMNOLWNRCZVLJ-UHFFFAOYAS |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H20FNO2/c1-3-19-14(18)15(8-10-17(2)11-9-15)12-4-6-13(16)7-5-12/h4-7H,3,8-11H2,1-2H3 |
|
| StdInChI = 1S/C11H14N2O/c1-7(12)5-8-6-13-9-3-2-4-10(14)11(8)9/h2-4,6-7,13-14H,5,12H2,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CHOQGLPFQOQESN-UHFFFAOYSA-N |
|
| StdInChIKey = BYMNOLWNRCZVLJ-UHFFFAOYSA-N |
|
}} |
|
}} |
