| Revision as of 18:18, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473948324 of page 4-Methylaminorex for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 18:18, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 465586388 of page 4-Methylamphetamine for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443354135 |
|
| verifiedrevid = 418216592 |
|
| IUPAC_name = 4-Methyl-5-phenyl-2-amino-oxazoline |
|
| IUPAC_name = 1-(4-methylphenyl)propan-2-amine |
|
| image = 4-Methyl-Aminorex.svg |
|
| image = 4-Methylamphetamine.svg |
|
| width = 200px |
|
|
| image2 = 4-Methyl-aminorex.gif |
|
|
| imagename = 1 : 1 mixture (racemate) |
|
|
| drug_name = 4-Methylaminorex |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_US = D |
|
| pregnancy_category = |
|
| legal_AU = S9 |
|
| legal_status = |
|
|
| routes_of_administration = |
|
| legal_CA = Schedule III |
|
|
| legal_UK = Class A |
|
|
| legal_US = Schedule I |
|
|
| routes_of_administration = ], ]d, ], ] |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 62% oral; 79% nasal; 91 - 93.5% smoked; 100% IV |
|
| bioavailability = |
|
| metabolism = ] |
|
| metabolism = |
|
| elimination_half-life = 10-19 hours |
|
| elimination_half-life = |
|
| excretion = ] |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 3568-94-3 --> |
|
| CAS_number = <!-- blanked - oldvalue: 22683-78-9 --> |
|
|
| ATC_prefix = none |
|
| CAS_supplemental = <BR>29493-77-4 - (±)-cis isomers |
|
|
| PubChem = 92196 |
|
| PubChem = 199116 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB01447 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 83237 |
|
| ChemSpiderID = 172349 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 166183 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=12 | N=2 | O=1 |
|
| C=10 | H=15 | N=1 |
|
| molecular_weight = 176.21 |
|
| molecular_weight = 149.23 g/mol |
|
| smiles = N\2=C(\OC(c1ccccc1)C/2C)N |
|
| smiles = NC(Cc1ccc(cc1)C)C |
|
| InChI = 1/C10H12N2O/c1-7-9(13-10(11)12-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H2,11,12) |
|
| InChI = 1/C10H15N/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6,9H,7,11H2,1-2H3 |
|
| InChIKey = LJQBMYDFWFGESC-UHFFFAOYAX |
|
| InChIKey = ZDHZDWSHLNBTEB-UHFFFAOYAG |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H12N2O/c1-7-9(13-10(11)12-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H2,11,12) |
|
| StdInChI = 1S/C10H15N/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6,9H,7,11H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LJQBMYDFWFGESC-UHFFFAOYSA-N |
|
| StdInChIKey = ZDHZDWSHLNBTEB-UHFFFAOYSA-N |
|
}} |
|
}} |
